UNITED STATES ENVIRONMENTAL PROTECTION AGENCY
             OFFICE OF ENFORCEMENT
EPA-33019-83-001R

PESTICIDE FORMULATION METHODS INDEX
FOURTH EDITION
June 1991
Dean F. Hill
   NATIONAL ENFORCEMENT INVESTIGATIONS CENTER
                 Denver, Colorado

-------
                            FOREWORD

      This fourth edition of the NEIC Pesticide Formulation Methods Index
is intended solely as a guide to the published and other available methods
for pesticide formulations and related analyses.  Listing of the methods or
their order of appearance does not imply any degree of EPA approval or
lend to the methods any additional degree of status than they intrinsically
possess.   It should be kept in mind, however, that Associated Official
Analytical Chemists (AOAC) and Collaborative International Pesticides
Analytical Council  (CIPAC) procedures are currently the only "official"
methods available.

      Many  of the referenced methods are obsolete or will rarely find use
due  to the availability of newer and more  specific procedures, changing
pesticide  use patterns and  regulatory restrictions.  However, as many
different pesticides  and methods as possible were  listed,  as there may be
occasions,  where some other  than the usual  approaches may be necessary.
Also, to the degree possible, suspected chemical violations  should be
confirmed  by several different methods, if official methods  are not available
or applicable.

      No  attempt has been made in the index to include more  than a
minimum  number of chemical  names  in the main listing;  most of the
pesticides  are listed by their official, common, or in some  cases, trade
names.  Chemical  names may  be located and/or  verified via the cross-
reference  numbers  given with each chemical in:  "Catalog  of Pesticide
Chemical  Names and their Svnonvms. Coberly," et a/., PB86-170636,
January 1986 (available from:   NTIS, Springfield,  VA   22161).   Other
common  reference  sources such as the  Farm  Index. British  Crop
Protection Manual, and Nanogen Index may  also be consulted.

      The  primary numerical cross-reference in this edition of the Index is
now  the "Caswell Number," a  more widely used and readily available
descriptive numbering system than that used in the first two editions of the
Index. Chemical Abstract Service Registry  (CASR) numbers and the old
Index number are also included parenthetically  for each compound for

-------
ease of reference. The Caswell Numbers are available in the "Catalog of
Pesticide Chemical Names and Their Synonyms," mentioned previously.

      Copies of any  of the referenced methods  (particularly  those
designated  NEIC)  may be obtained  by request  from the  National
Enforcement Investigations Center, Denver  Federal  Center, Building 53,
Box 25227, Denver, Colorado 80225, (303) 236-7970.

      The references  cited in compiling this index are abbreviated  as
follows:

      1.    AOAC:

           Official  Methods of Analysis of the Association of Official
           Analytical Chemists. 15th  Edition,  1990.  Published by the
           Association  of Official  Analytical  Chemists, Suite  400,
           2200 Wilson  Blvd., Arlington, VA  22201.  Supplements issued
           annually.  Those AOAC methods marked with an asterisk (*)
           have been adopted as joint AOAC-CIPAC methods.

      2.    EPA:

           Manual of Chemical Methods for Pesticides and  Devices.
           Environmental Protection Agency,  Office  of Toxic Substances,
           Pesticide  Programs, Benefits and Field Studies Branch,
           Beltsville, Maryland,  First issued 1974 and  updated 4 times.
           Supplemental  methods are  noted parenthetically  by issue
           number.   Currently unavailable,  however,  specific methods
           can be requested from NEIC.

      3.    AMP:

           Analytical Methods for Pesticides. Plant Growth Regulators
           and Food  Additives. Ed.  Zweig, Academic Press, New York.
           Vols. I-XVII, various volumes also edited by J. Sherma and
           others.

-------
4.     CIPAC:
      CIPAC Handbook. Volume I and IA. through ID. Analysis of
      Technical  and  Formulated  Pesticides.  Compiled by R.D.
      Ashworth, J. Henriet and J.F. Lovett,  edited by G.R. Law.
      Collaborative International  Pesticides Analytical Council
      Limited, 1970 and 1980.  Available from:  Heffers Printers Ltd.,
      Cambridge, EB4 2PQ England.
5.     CAN:
      Pesticide Product Procedures Manual. Analytical Methodology
      for Analysis of Pesticide Formulations, compiled by B. Lee and
      R.  Hudle,  1985, Pesticide Laboratory,  Laboratory Services
      Division,  Ag  Canada, Building 22, CEF, Ottawa, Canada
      (updated July 1987).
6.     AWPA:
      American  Wood-Preserver's  Association  Standards.
      Published by the American  Wood-Preservers Association,
      1012 14th Street, NW, Washington, B.C.  20005.  Revised
      periodically.
7.     NEIC:
      These methods are various analytical procedures on file at the
      National Enforcement Investigations Center that do not fit into
      any of the previous categories.  These methods are derived
      principally from pesticide manufacturers and formulators, but
      also include EPA and State developed methods.  Journal
      methods other  than the Journal of the Association  of Official
      Analytical  Chemists  (JAOAC)  are also included in this
      category.

-------
      If any laboratory using this index has methods available that would
be useful for inclusion, please send copies to Dean F. Hill at the National
Enforcement  Investigations Center,  Building 53, P.O. Box 25227,  DFC,
Denver, Colorado  80225.  It would be particularly desirable to have methods
listed for those compounds where none are given or where only spectro
phatometric, elemental, or nonspecific methods are listed.
                       Dean F. Hill, Chief
                       Pesticide and Toxic Substances Branch, NEIC
                       June 1991

-------
                              GLOSSARY
1.     A A     =    Atomic Absorption
2.     AX     =    Anion Exchange Chromatography
3.     CAP    =    Capillary Column
4.     CX     =    Cation Exchange Chromatography
5.     EC      =    Electron Capture Detector
6.     ES      = ~   External Standard
7.     FID     =    Flame lonization Detector
8.     FPD     =    Flame Photometric Detector
9.     GC     =    Gas Chromatography
10.    HCD    =    Hall Electroconductivity Detector
11.    HPLC   =    High-Performance Liquid Chromatography
12    1C      =    Ion Chromatography
13.    IR      =    Infra-Red Spectrophotometry
14.    IS       =    Internal Standard
15.    MS     =    Mass Spectrometry
16.    NP     =    Normal Phase
17.    NPD    =    Nitrogen/Phosphorus Detector
18.    RP      =    Reverse Phase
19.    TCD     =    Thermal Conductivity Detector
20.    TLC     =    Thin-Layer Chromatography
21.    TMS    =    Trimethylsilyl
22.    UV     =    Ultra-Violet Spectrophotometry
23.    WB     =    Wide Bore Column Gas Chromatography

-------
                                                                 A-l
 Abate (see "Temephos" 845)

 Acaralate (see "Chloropropylate" 51 IB)

 Acarol (see "Bromopropylate" 511A)

 Acephate (2A/30560-19-1/3)

      1.    GC (TCD-IS)	AMP VII (p. 364)
      2.    GC  (FID-IS)	NEIC-2A-A
      3.    GC  (FID-IS)	NEIC-2A-2
      4.    GC (FED-ES, mixtures with triforine
              and dicofol	EPA-1(4)

 Acetic Acid (3/64-19-7/4)

      1.    Titrimetric (in acetates)	NEIC-3-A
      2.    Titrimetric	NEIC-3-B

 Acetic Anhydride (3A/108-24-7/5)

      1.    Titrimetric	NEIC-3A-A

 Acetochlor (3B/34256-82-1/6)

 Acetone (4/67-64-1/7)

      1.    GC  (FID-IS)	AOAC-973.69 (p. 498)
      2.    GC  (FID-IS)	AOAC-975.06 (p. 232)

 Acifluorfen, Sodium Salt (755D/62476-59-9/12.5)

      1.    GC (TCD-IS; as ethyl ester)	NEIC-755D-A
      2.    HPLC(RP-IS)	EPA-K4)

 Acrolein (9/107-02-8/14)

 Acrylonitrile (10/107-13-1/15)

Actidione (see "Cycloheximide" 270A)

Agritox  (see  "Trichloronat" 456A)

Akton (187A/1757-18-2/413)

      1.    GC (TCD-ES)	NEIC-187A-A
      2.    IR	NEIC-187A-B

-------
                                                               A-2


Alachlor (11/15972-60-8/16)
      1.    GC (FID-IS)	AOAC-985.04* (p. 174)
      2.    GC (FID-IS; microencapsulated)	AOAC-988.03 (p. 174)
      3.    GC (TCD-IS)	EPA-1
      4.    GC (FID-IS)	EPA-2
      5.    IR	NEIC-11-A
      6.    GC (FID-IS)	AMP X (p. 257)
      7.    GC (FID-IS; Microtech®)	EPA-K4)
      8.    GC (FID-ES)	CAN-AKY.G

Alanap-1 (see "Naptalam" 592)

Alar (see "Daminozide" 808)

Alcohols
      1.    GC (FID-IS)	AOAC-1973.69 (p. 498)
      2.    GC (FID-IS)	AOAC-975.06 (p. 232)

Aldicarb (HA/116-06-3/18)
      1.    IR	AOAC-974.04 (p. 212)
      2.    Colorimetric	JAOAC 49. 399(1966)

Aldoxycarb (11AA/1646-88-4/18.5)
      1.    HPLC (NP-IS)	NEIC-11AA-A
      2.    IR	NEIC-11AA-B

Aldrin (12/309-00-2/19)
      1.    Total chlorine	AOAC-961.04 (p. 175)
      2.    IR(HHDN)	AOAC-961.05 (p. 175)
      3.    GC(FED-ES)	AMP VI (p. 268)
      4.    IR	NEIC-12-A

n-Alkyl  Dimethylbenzylammonium Chloride (see "Quaternary  Ammonium
   Chlorides")

AUantoin (24/97-59-6/82)

d-trans-Alletnrin (25A/28057-48-9/84)
      1.    Titrimetric (Tech. allethrin)	AOAC-953.05 (p. 164)
      2.    GC (FID-IS)	AOAC-973.12(p. 165)
      3.    GC (Mosquito coils)	NEIC-25A-A
      4.    GC (Mosquito coils)	NEIC-25A-B
      5.    GC (Pynamin-Forte, mosquito mats)... NEIC-25A-C
      6.    GC (FID-IS; with permethrin and
             MGK-264)	CAN; ALL/PFL/OCT.G

-------
                                                                 A-3
Allidochlor (284/93-71-0/649)

      1.     GC(FID-ES)	CAN; ALO.G

AUoxydim (25AA/55635-13-7/875.5)

Allyl Alcohol (26/107-18-6/85)

      1.     IR	CIPAC-1 (p. 730)
      2.     IR (with D-D mixture	NEIC-26-A

Allyl Isothiocyanate (27/57-06-7/86)

Alphachloralose (876AA/15879-93-3/2015)

      1.     Total chlorine	NEIC-876AA-A
      2.     Titrimetric	NEIC-876AA-B
      3.     Colorimetric	NEIC-876AA-C

Alpha-Naphthylthiourea (see "Antu" 28)

Altosid (see  "Methoprene" 28AAA)

Aluminum Phosphide (31/20859-73-8/92)

      1.     Titrimetric	NEIC-31-A
      2.     GC (FPD/PH3 evol'n) see "Zinc Phosphide/EPA-2")

Amdro® (see "Hydramethylnon" 642AB)

Ametryn (431/834-12-8/94)

      1.     GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.     Non-aqueous titration	AMP IV (p. 15)
      3.     GC  (FID-IS)	NEIC-431-A

Amiben (see "Chloramben" 168A)

Amical 48 (see "Diiodomethyl-p-tolylsulfone" 353B)

Amical 77 (see "p-Chlorophenyl diiodomethylsulfone" 207AB)

Amidithion (3/919-76-6/95)

Aminobutane (see "sec-Butylamine" 125)

-------
                                                                A-4


Aminocarb (360/2032-59-9/870)

      1.     HPLC (RP-IS)	AOAC-985.02* (p.212)
      2.     IR	NEIC-360-A
      3.     HPLC (RP-ES)	AMP XII (p. 4)

4-Aminopyridine (38/504-24-5/104)

      1.     UV	EPA-1
      2.     GC (FID-ES; on sunflower seeds)	NEIC-38-A

3-Amino-s-triazole (see "Amitrole" 40)

Amitraz (374A/33089-61-1/105)

      1.     GC/IR (Cattle  dips)	JAOAC 61. 1516 (1978)
      2.     GC  (FID-IS)	NEIC-374A-A

Amitrole (40/61-82-5/106)

      1.     Titrimetric	AOAC-967.06 (p. 223)
      2.     Colorimetric	EPA-1
      3.     GC  (FID-IS)	AMP XIII (p. 192)
      4.     Colorimetric (with  simazine)	NEIC-40-A

Amizine (see Simazine" 740)

Ammate (see "Ammonium Sulfamate" 47)

Ammoniacal Copper Arsenite

      1.     Ammonia	AWPA; A2-71-1
      2.     Arsenic	AWPA; A2-71-2
      3.     Copper	AWPA; A2-71-6

Ammonium Sulfamate (47/7-773-06-0/125)

      1.     Titrimetric	EPA-1

Ammonium Sulfate (48/7783-20-2/126)

p-tert-Amylphenol (50/80-46-6/131) and Potassium Salt (50A/53404-18-5/132)

      1.     GC (see "Phenols and Chlorophenols/EPA-6-Tent. & EPA-8-Tent")
      2.     HPLC (RP-ES)	NEIC-50-A
      3.     HPLC (RP-ES)	NEIC-50-B

Anabasine (51/494-52-0/134)

-------
                                                                A-5
Ancymidol (51/12771-68-5/135)
      1.    GC  (FID-IS)	AMP VIII (p. 477)
Anethole (5 IB/104-46-1/136)
Anfor (see "Glycophene" 470A)
Anilazine (302/101-05-3/685)
      1.    HPLC(RP-IS)	AOAC; 988.04 (p. 213)
      2.    Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1")
      3.    IR	EPA-1
      4.    GC (TCD-IS)	EPA-2
      5.    Hydrolyzable Chlorine	AMP III (p. 81)
      6.    HPLC (RP-IS)	NEIC-302-A
Animert (see "Tetrasul" 213)
Anthio (see "Formothion" 366C)
Anthraquinone (52A/84-65-1/140)
Antimony Potassium Tartrate (53/28300-74-5/141)
      1.    Titrimetric (see "Zinc Phosphide/EPA-1")
Antimycin A (52B/1397-94-0/142)
      1.    UV	EPA-1 (1)
Antor (see "Diethatyl ethyl" 179D)
ANTU (28/86-88-4/1472)
      1.    UV	EPA-1 (3)
      2.    Titrimetric	CIPAC-1 (p. 16)
Aramite (131/140-57-8/307)
      1.    Total Chlorine	AMP II (p. 36)
A-rest (see "Ancymidol" 51 A)
Aromatic Naphtha (70AA/-/-)
      1.    GC (FID-ES/CAP)	CAN; HANap/POJ.G

-------
                                                                A-6
Arsenic

      1.    Titrimetric (DSMA, etc.)	EPA-1/3/4
      2.    Titrimetric (Inorganics)	EPA-2
      3.    Distillation (Inorganics)	AOAC-922.03 (p. 147)
      4.    Ion-exchange  (Inorganics)	AOAC-963.06 (p. 149)
      5.    lodometric Titration (Inorganics)	AOAC-924.04 (p. 148)

Arsenic (water soluble)

      1.    Titrimetric (Inorganic arsenicals)	AOAC; 925.02 (p. 149)

Aspon (845A/3244-90-4/1960)

      1.    GC  (FID-IS)	AMP XIII (p. 150)
      2.    IR	NEIC-845A-A
      3.    GC (TCD-ES)	NEIC-845A-B
      4.    TLC/Total P	NEIC-845A-C
      5.    IR	NEIC-845A-D

Asulam (62A/3337-71-1/154) & Na Salt (62B)

      1.    Non-aqueous Titration	AMP VII (p. 499)
      2.    HPLC (RP-ES)	AMP XIII (p. 198)
      3.    UV	EPA-l(l)

Atraton (430B/1610-17-9/1032)

      1.    Titrimetric	AMP IV (p. 28)

Atrazine (63/1912-24-9/156)

      1.    GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.    Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1")
      3.    IR	EPA-1
      4.    GC  (FID-IS	EPA-2
      5.    HPLC(RP-IS)	EPA-3(3)
      6.    HPLC (RP-IS)	EPA-4 (3)
      7.    GC (FID-IS; with metolachlor) (see "Mixed Pesticides EPA-2")
      8.    GC (FID-IS; with propachlor)	NEIC-63-A
      9.    GC (FID-IS; with metolachlor	EPA-1(4)
      10.   GC  (FID-IS)	CAN; ATR.G
      11.   GC (FID-ES; in fertilizers)	CAN; EPT.G

A--adex (see "Diallate" 299)

-------
                                                                A-7
Available Chlorine
      1.    Titrimetric (NaOCl)	AOAC; 935.07 (p. 160)
      2.    Titrimetric [(Ca(OCl)2]	AOAC; 935.09 (p. 161)
      3.    Titrimetric (Chloramine T)	AOAC; 935.10 (p. 161)
      4.    Titrimetric (Cleansers)	NEIC-AvCl-A
      5.    Titrimetric  (Cyanurates)	NEIC-AvCl-B
      6.    Titrimetric (ASTM:  Released 12)	NEIC-AvCl-C

Avenge (see "Difenzoquat methyl sulfate" 363A)

Azak (see "Terbutol" 294)

Azinphos Ethyl (344/2642-71-9/828)

      1.    GC (FID-ES)	AMP VI (p. 397)

Azinphos Methyl (374/86-50-0/899)

      1.    IR	AOAC; 980.09* (p. 197)
      2.    HPLC(RP-IS)	AOAC; 989.01 (p. 198)
      3     IR                                  EPA-1
      4.    Colorimetric	AMP II (p. 233)
      5.    GC	AMP VI (p. 397)
      6.    HPLC (NP-IS)	NEIC-374-A

Aziprotryne (63B/4658-28-0/158)

Azobenzene (64/103-33-3/159)

Azocyclotin (884AA/41083-11-8/2067)

Azodrin (see "Monocrotophos" 377/6923-22-4/901)

Azothoate (206A/5834-96-8/461)

-------
                                                                 B-l


BAAM (see "Amitraz" 374A)

Bacillus Thuringienisis (66/68038-71-1/161)

Balan (see "Benefin" 130)

Banamite (81E/25939-05-3/188)
      1.    GC  (FID-IS)	NEIC-81E-A

Bandane (673/8029-29-6/1669)

Banol (see "Carbonalate" 219)

Banvel D (see "Dicamba" 295)

Banvel T (see "Tricamba" 869)

Barban (68/101-27-9/164)
      1.    UV	AMP IV (p. 40)
      2.    HPLC (RP-ES)	AMP XII (p. 179)
      3.    HPLC (RP-ES)	NEIC-68-A

Barium Metaborate (71/13701-59-2/167)

Barthrin (71AA/70-43-9/168)

Basalin (see "Fluchloralin" 460B)

Baygon (see "Propoxur" 508)

Bayleton (see "Triadimeform" 862AA)

Bayluscide (see "Clonitralid" 314)

Baytex (see "Fenthion" 456F)

Benalaxyl (see "Galban" 471 AC

Benazolin (202A/3813-05-6/451)

Bendiocarb (360B/22781-23-3/172.5)
      1.    HPLC(RP-IS)	AOAC-986.09* (p. 214)
      2.    IR	EPA-1 (2)
      3.    UV	EPA-2(2)
      4.    HPLC(RP-IS)	EPA-3(3)
      5.    GC (FID-IS; pyrolysis)	AMP X  (p. 6)
      6.    IR (for phenolic by-product)	AMP X  (p. 8)
      7.    Preparation of analytical standard	AMP X  (p. 9)

-------
                                                               B-2
Benfluralin (130/1861-40-1/299)
      1.    GC (FID-IS)	AOAC-973.14 (p. 180)
      2.    UV	AOAC-973.13 (p. 179)
      3.    IR	EPA-1
      4.    GC (FID-IS)	EPA-2
      5.    GC (FID-IS; separation from trifluralin) NEIC-130-A
      6.    GC (FID-IS)	AMP VIII (p. 342)
      7.    GC (FID-IS; with trifluralin)	JAOAC 73. 981 (1990)

Benlate (see "Benomyl" 75A)

Benodanil (see "lodobenzanilide" 501AB)

Benomyl (75A/17804-35-2/173)

      1.    HPLC (RP-ES)	AOAC-984.09* (p. 214)
      2.    IR	EPA-1
      3.    UV	EPA-2
      4.    Colorimetric	JAOAC 58. 971 (1975)
      5.    IR	AMPX(p. 159)
      6.    Nonaqueous Titration	AMPX(p. 162)
      7.    UV (also determines MBC)	JAOAC 62. 488 (1979)
      8.    HPLC (RP-ES; with carbaryl)	CAN; BEN.L

Bensulide (357/741-58-2/862)

      1.    GC (FID-IS)	AMP VI (p.  672)
      2.    HPLC (NP-IS)	AMP XIII (p. 219)
      3.    IR	EPA-1
      4.    IR	NEIC-357-A/B
      5.    HPLC (RP-ES)	EPA-2(4)
      6.    HPLC (RP-ES)	CAN;BEL.L

Bentazon (509C/25057-89-0/174)

      1.    UV (also sodium salt)	EPA-1 (1)
      2.    GC (FID-ES; after silylation	NEIC-509C-A
      3.    HPLC (RP-IS)	EPA-2 (4)
      4.    HPLC (RP-ES)	CIPAC-IC (p. 1973)
      5.    HPLC (RP-ES)	;	CAN; BEN.L

Benthiocarb (see "Thiobencarb" 207DA)

Benzadox (75C/5251-93-4/175)

Benzaldehyde (76/100-52-7/177)

-------
                                                                 B-3
Benzene (77/71-43-2/178)
      1.     GC(FID-IS)	AOAC-975.06 (p. 232)
Benzene Hexachloride, Gamma Isomer (see "BHC, Gamma Isomer" 527)
Benzipram (79D/35256-86-1)
l,2-Benzisothiazolin-3-one (see "Proxel" 79A)
Benzocaine (430A/94-09-7/1031)
      1.     Colorimetric	AOAC-968.40 (p. 521)
      2.     UV	AOAC-968.42 (p. 522)
Benzole Acid (81/65-85-0/182)
Benzomate (see "Benzoximate" 188G)
Benzothienyl Methylcarbamate (81D/1079-33-0/187)
      1.     Hydrolysis/Distillation	NEIC-81D-A
Benzoximate (188G/29104-30-1/420)
Benzoylprop-ethyl (431AA/22212-55-1/1033)
      1.     GC  (FID-IS)	CIPAC-1B (p. 1732)
Benzthiazuran (81C/1929-88-0/186)
6-Benzyladenine(81EE/1214-39-7/1629.5)
      1.     TLC	AMP X (p. 549)
Benzyl Benzoate (82/120-51-4/191)
      1.     GC  (TCD/FID-ES)	NEIC-82-A
Benzyl Bromacetate (82A/5437-45-6/192)
      1.     GC (TCD-ES)	'.	NEIC-82A-A
o-Benzyl-p-Chlorophenol (83/120-32-1/193), K salt (83A) & Na salt (835)
      1.     GC (see "Phenols and Chlorophenols/EPA-6-Tent. and EPA-8-
            Tent.")
      2.     Total Chlorine (see Phenols and Chlorophenols/EPA-3")
      3.     HPLC  (RP-ES)	NEIC-83-A

-------
Betanal (see "Phenmedipham" 648B)

Betasan (see "Bensulide" 357)


BHC, Gamma Isomer (527/58-89-9/1282)

      1.    IR	AOAC-947.01 (p. 179)
      2.    Column Chromatography	AOAC-949.05 (p. 176)
      3.    GC (FID-IS; shampoos and lotions)	AOAC-984.05* (p. 178)
      4.    IR	EPA-1
      5.    Hydrolyzable  Chlorine	CIPAC-1 (p. 986)
      6.    Polarography	CIPAC-1 (p. 37)
      7.    GC	NEIC-527-B
      8.    IR	NEIC-1282-2 (VA)
      9.    GC (FID-IS; with maneb)	JAQAC £2, 929(1986)
      10.   GC (FID-IS; in BHC)	CIPAC-IC (p. 1977)
      11.   GC (FID-ES)	CAN; LIN.G

BHC (79/608-73-1/179)

      1.    IR	AOAC-947.01 (p. 179)

Bidisin (see "Chlorfenprop-methyl" 557A)

Bidrin (see "Dicrotophos" 376)

Bifenox (561AA/42576-02-3/200)

      1.    GC(TCD-IS)	NEIC-561AA-A

Binapacryl (86/485-31-4/201)

      1.    IR	EPA-1
      2.    Colorimetric	AMPV(p. 236)

Bioban P-1487 (601 A/2224-44-4/1489)

Biobor (627/14697-50-8/1548)

      1.    Titrimetric	NEIC-627-A

Bioquin (see "Copper 8-Quinolinolate" 253)

Bioresmethrin (see "Resmethrin" 83E)

-------
                                                                  B-5
Biphenyl (87/92-52-4/202)
      1.     UV	JAQAC4Q.282Q957)
      2.     GC  (FID-IS)	NEIC-87-A
      3.     UV (Fruit wraps	NEIC-87-B

Birlane (see "Chlorfenvinphos" 187)

Bis(tributyltin)oxLde (101/56-35-9/229)

      1.     Titrimetric (see "Organotin Compounds/EPA-1)
      2.     GC  (FID-IS)	EPA-K4)

Bithionol (852/97-18-7/1971)

      1.     UV	NEIC-852-A

Bladex (see "Cyanazine" 188C)

B-Nine (see "Daminozide" 808)

Boldo (see "Bromadialone" 486AB)

Bolero (see "Thiobencarb" 207DA)

Bolstar (see  "Sulprofos"" 453AA)

Bomyl (367/122-10-1/886)

      1.     IR	NEIC-367-A

Bone Oil (107/8001-85-2/239)

Borax (108/1303-96-4/240)

      1.     Titrimetric (see "Boron Compounds/EPA-1")

Bordeaux Mixture (-/8011-63-0/-)

      1.     Moisture	AOAC-920.25 (p. 158)
      2.     Carbon Dioxide	AOAC-920.26 (p. 158)
      3.     Copper (Electrolytic)	AOAC-920.27A (p. 158)
      4.     Copper (Titrimetric)	AOAC-920.27B (p. 158)
      5.     Mixtures with Paris Green	AOAC-920.28 (p. 158)
      6.     Mixtures with Lead Arsenate	AOAC-920.29 (p. 158)
      7.     Mixtures with Calcium Arsenate	AOAC-925.03 .(p. 159)

-------
                                                                B-6
Boron Compounds

      1.    Titrimetric	EPA-1

Botran (see "Dichloran" 311)

Bravo (see "Chlorothalonil" 215B)



Brodifacoum(114AAA/56073-10-0/242.5)

      1.    HPLC(RP-IS)	AOAC-983.11 (p. 224)
      2.    HPLC  (RP-ES)	NEIC-114AAA-A
      3.    HPLC (RP-IS)	AMP XVI (p. 136)

Bromacil (111/314-40-9/243)

      1.    GC (FID-IS)	EPA-1
      2.    IR(HyvarX)	NEIC-111-A
      3.    IR and  UV (with diuron)	NEIC-111-B
      4.    HPLC (Oil-base, with pentachlorophenol) NEIC-111-C
      5.    Non-aqueous Titration	AMP V (p. 340)
      6.    HPLC (Pentachlorophenol & 2,4-D-IOE). .NEIC-111-D
      7.    Titrimetric	CIPAC-IC (p. 1986)
      8.    GC (FID-IS/MB)	CAN; BRO.G

Bromadiolone (486AB/28772-56-7/250.1)

      1.    TLC/HPLC/IR/UV	NEIC-486AB-A
      2.    HPLC (RP-IS)	EPA-1 (4)
      3.    HPLC  (RP-ES)	CAN; BRA.L
      4.    HPLC (RP-IS; in baits, concentrates
            and wax blocks)	AMP XVI (p. 142)
      5.    HPLC (RP-ES; in baits)	JAOAC 73.429 (1990)

Bromeflor (see "Ethephon" 426A)

Bromethalin (561BB/63333-35-7/-)

Brominated Salicylanilides (863/87-10-5/863)

      1.    UV	EPA-1

Bromocyclen (116/1715-40-8/256)

2-Bromo-2-nitropropane-l,3-diol(116A/52-51-7/257)

      1.    GC (FID-IS)	NEIC-116A-A

-------
                                                                B-7


Bromophos (114E/2104-96-3/254)

      1.    IR	CIPAC-1 (p. 730)
      2.    GC  (FID-IS)	NEIC-114E-A
      3.    Titrimetric	AMP X (p. 33)

Bromophos Ethyl (114D/4824-78-6/253)

      1.    Titrimetric	AMP X (p. 43)

Bromopropylate (511A/18181-80-1/259)

      1.    GC  (FID-IS)	NEIC-511A-A

Bromoxynil (119/1689-84-5/261)

      1.    GC (FID-ES; hydrolysis/methylation)	AMP V (p. 354)
      2.    Total Bromine	AMP V (p. 353)
      3.    GC (FID-IS; methyl ester)	CIPAC-IC (p. 1990)
      4.    Reference std. (purification and purity). .CIPAC-IC (p. 2326)

Bromoxynil Octanoate (119A/1689-99-2/262)

      1.    GC  (FID-IS)	AOAC-980.05* (p. 180)
      2.    GC  (FID-IS)	CIPAC-IC (p. 2000)
      3.    Reference Std. (purification and purity). .CIPAC-IC (p. 2330)
      4.    GC  (FID-IS)	CAN; BSY.G

Bronopol (see "2-Bromo-2-nitropropane-l,3-diol" 116A)

Buctril (see "Bromoxynil" 119)

Bufencarb (454C/2282-34-0/263)

      1.    GC (TCD-ES)	AMP VII (p. 181)

Bupirimate (119AAA/41483-43-6/264)

      1.    GC  (FID-IS)	NEIC-119AAA-A
      2.    GC  (FID-IS)	CIPAC-IC (p. 2007)
      3.    Reference Std. (purification and purity). .CIPAC-IC (p. 2340)
      4.    Identification (GC/TLC/IR/NMR)	CIPAC-ID (p. 182)

Busan 72 (853A/21564-17-0/1973)

      1.    Colorimetric	JAQAC 59. 737 (1977)
      2.    IR	NEIC-853A-A

-------
                                                                   B-8


Busan 73 (195D/16008-32-5/440)

      1.     Titrimetric	NEIC-195D-A

Busan 74 (853A/21564-17-0/1210) and (495A/29803-57-4/1973)

      1.     Titrimetric and IR	NEIC-853A-A

Busan 76 (266C/27983-69-3/586)

      1.     Hydrolyzable Bromine	NEIC-266C-A
      2.     GC (FID-ES)	NEIC-266C-B

Busan 77 (678A/31512-74-0/1684)

      1.     Titrimetric (27.3% Chloride)	AOAC- 960.14A(p. 228)

Busan 90 (115/2491-38-5/255)

      1.     Hydrolyzable Bromine	NEIC-115-A

Busan 881 (402A/138-93-2/1715) and (696/137-41-7/1046)

      1.     Total Nitrogen	NEIC-402A/696-A
      2.     UV	NEIC-402A/696-B
      3.     CS2 Evolution	AOAC-965.15 (p. 217)

Butachlor (119B/23184-66-9/265)

      1.     GC (FID-IS)	AOAC-986.04* (p. 181)
      2.     GC (FID-ES)	CAN; BUH.G

Butam (83EE/35256-85-0/266)

Buthidazole (721A/55511-98-3/271)

Butocarboxim(578AAA/34681-10-2/1435)

Butonate (385A/126-22-7/914

Butoxycarboxim (120 A/34681-23-7/1432)

Butoxypropylene Glycol (122/9003-13-8/276)

Butralin (125E/33629-47-9/278)

      1.     GC (FID-IS)	NEIC-125E-A

Buturon (207E/3766-60-7/470)

-------
                                                                 B-9
sec-Butylamine (125/13952-84-6/281)

      1.    Distillation/Titration	AMP VIII (p. 253)
      2.    UV	AMP VIII (p. 255)
      3.    Colorimetric	JAOAC 61.1001(1978)

Butylate (434A/2008-41-5/1039)

      1.    GC  (FID-IS)	AOAC-974.05 (p. 221)
      2.    GC (TCD-ES)	EPA-1
      3.    HPLC (NP-ES)	EPA-2
      4.    GC  (FID-IS)	EPA-3
      5.    GC  (FID-IS)	EPA-4
      6.    GC (TCD-IS)	EPA-5
      7.    HPLC (RP-ES)	EPA-6(2)
      8.    GC  (FID-IS)	AMP XIII (p. 295)
      9.    IR	NEIC-434A-A
      10.   GC(FID-ES)	CAN; BYA.G
      11.   GC (FID-ES; in  fertilizers)	CAN; EPT.G

p-tert-Butylphenol (130E/98-54-4/304, K salt (130F/3130-29-8/305) and Na salt
   (130G/5787-50-8/306)

      1.    GC (see "Phenols and Chlorophenols/EPA-8")

Bux (see "Bufencarb" 454C)

-------
                                                                 C-l
Cacodylic Acid (133/75-60-5/310) & Na salt (133A/124-65-2/311)
      1.    Polarography	AOAC-977.28 (p. 501)
      2.    Titrimetric (see "Arsenic/EPA-4")
      3.    GC (ECD-ES; after derivitization with HI)	NEIC-133-A
      4.    1C (conductivity detector)	JAOAC 72. 994 (1989)

Cadium Chloride (135/10108-64-2/316)

      1.    A A..-	EPA-1

Calcium Arsenate (137/7778-44-1/323)

      1.    Arsenious Oxide (Titrimetric)	AOAC-921.05 (p. 154)
      2.    Total Calcium (Titrimetric)	AOAC-921.06B (p. 155)
      3.    Total Calcium (Gravimetric	AOAC-921.06C (p. 155)

Calcium Cyanide (142/592-01-8/330)

      1.    Titrimetric	AOAC-930.12 (p. 159)

Calcium Hypochlorite (145/7778-54-3/333)

      1.    Titrimetric	AOAC-935.09 (p. 161)
      2.    Titrimetric	NEIC-145-A

Calcium Polysulfide (150/1344-81-6/340)

      1.    Gravimetric (Water soluble sulfur)	AOAC-920.31 (p. 159)
      2.    Thiosulfate Sulfur (Titrimetric)	AOAC-920.32 (p. 160)
      3.    Sulfide (Gravimetric)	AOAC-920.33 (p. 160)
      4.    Calcium (Gravimetric)	AOAC-920.34 (p. 160)

Camphechlor (see "Toxaphene" 861)

Camphor (155/76-22-2/346)

Capsaicin (158/404-86-4/350)

Captafol (828/2939-80-2/351)

      1.    IR	EPA-1
      2.    GC(TCD-ES)	AMP V (p. 295)
      3.    HPLC(NP-IS)	AMP X (p. 173)
      4.    GC (FID-IS)	AMPX(p. 175)
      5.    IR	CIPAC-Kp. 730)
      6.    HPLC (NP-IS)	CAN; CAO.L

-------
                                                              C-2
Captan (159/133-06-2/352)
      1.    GC(FID-IS)	AOAC-971.05* (p. 181)
      2.    HPLC (NP-IS)	AOAC-980.06* (p. 181)
      3.    Hydrolyzable Chlorine	EPA-1
      4.    IR	EPA-2
      5.    GC (FID-IS)	EPA-3 (3)
      6.    HPLC (NP-IS)	EPA-4 (3)
      7.    GC (FID-IS; with malathion/methoxychlor)	NEIC-159-A
      8.    HPLC (NP-IS; Flowables) 	NEIC-159-B
      9.    IR	CIPAC-1 (p. 172-4)
      10.   GC (FID-IS; with carbaryl and naled)	NEIC-159-C
      11.   GC (FID-ES/MB)	CAN-CAP.G
      12.   HPLC (NP-ES; with phosalone)	CAN-PHE.L/CAP.L

Carbamate Contamination

      1.    TLC	NEIC-TLC-A

Carbaryl (160/63-25-2/353)

      1.    IR	AOAC-976.04 (p. 215)
      2.    UV	EPA-1
      3.    HPLC  (RP-ES)	EPA-2
      4.    HPLC(RP-IS)	EPA-3 (3)
      5.    HPLC (NP-IS)	JAQAC 57. 648 (1974)
      6.    Colorimetric	JAOAC 53. 896 (1970)
      7.    Near IR	JAOAC 51. 379 (1968)
      8.    Colorimetric	JAOAC 54.128 (1971)
      9.    Methylamine Distillation	NEIC-160-A
      10.   HPLC (with malathion, folpet and dicofol)	NEIC-160-B
      11.   IR	NEIC-160-C
      12.   HPLC (NP-IS)	JAQAC 63. 650 (1980)
      13.   HPLC (by-product assay)	CIPAC-1 A (p. 1112)
      14.   HPLC (RP-IS)	AMP XIII (p. 157)
      15.   GC (with captan and naled)	NEIC-160-D
      16.   HPLC (RP-ES; with carbaryl)	CAN; BEH.L
      17.   HPLC  (RP-ES)	CAN; CAV.L

Carbetamide (159B/16118-49-3/354)

      1.    Hydrolysis/Distillation	AMP VII (p. 511)

Carbofuran (160A/1563-66-2/355)

      1.    HPLC (RP-IS)	AOAC-986.10* (p. 215)
      2.    IR	EPA-1
      3.    GC(FID-IS)	NEIC-160A-A
      4.    Dimethylamine Distillation	NEIC-160A-B

-------
                                                               C-3
Carbofuran (160A/1563-66-2/355) (cont.)
      5.    HPLC(RP-IS)	NEIC-160A-C
      6.    Colorimetric	JAQAC 61.1513 (1978)
      7.    HPLC(RP-IS)	NEIC-160A-D
      8.    GC (FID-IS)	CAN-CBF.G
      9.    GC (FID-IS;  flowables)	CAN-CBF.G(a)
      10.   HPLC  (RP-ES)	CAN-CBF.L
      11.   GC (FID-ES/MB)	CAN-CBF.G(2)

Carbonalate (219/68989-02-6/507)

      1.    UV	AMP V (p. 204)

Carbon Dioxide (163/124-38-9/358)

      1.    Gravimetric (in Bordeaux mixture)	AOAC-920.26 (p. 158)

Carbon Disulfide (162/75-15-0/359)

      1.    GC (TCD/FID-ES)	AOAC-966.05 (p. 164)

Carbon Tetrachloride (164/56-23-5/360)

      1.    GC (TCD/FID-ES)	AOAC-966.05 (p. 164)
      2.    GC(FID-ES)	NEIC-FUM-A

Carbophenothion (165/786-19-6/361)

      1.    UV	AMP II (p. 548)
      2.    GC(FID-ES)	AMP VI (p. 519)
      3.    IR	NEIC-165-A

Carbosulfan (463C/55285-14-8/-)

      1.    GC/IR/HPLC	NEIC-463C-A/B/C

Carboxin (165A/5234-68-4/362)

      1.    IR	EPA-1
      2.    UV	EPA-2(2)
      3.    HPLC  (RP-ES)	NEIC-165A-A
      4.    IR	AMP VIII (p. 321)
      5.    Titrimetric	AMP VIII (p. 322)
      6.    TLC/UV	JAOAC 61.971 (1978)
      7.    GC (NPD-ES/CAP; on treated seeds)	CAN-CBX.G
      8.    HPLC (RP-ES; with thiram)	CAN-CBX.G/THR.L

-------
                                                                  C-4
Carbyne (see "Barban" 68)
Cartap (360C/15263-52-2/871)
      1.    Polarographic	AMP VII (p. 373)
      2.    Colorimetric (as hydrochloride)	CIPAC-ID (p. 25)
Carzol (see "Formetanate" 465A)
Casoron (see "Dichlobenil" 297)
CDAA (see "Allidochlor" 284))
CDEC (see "Sulfallate" 180)
Chinomethionat (see "Oxythioquinox" 2110)
Chlomethoxynil (-/        /-)
      1.    GC (FID-IS)	AMPX(p. 269)
Chloramben (168/302-17-0/374)
      1.    UV	AOAC-971.06 (p. 182)
      2.    Titrimetric	AMP V (p. 325)
Chloramine T (170/127-65-1/381)
      1.    Titrimetric	AOAC-935.10 (p. 161)
Chloranil (171/118-75-2/382)
      1.    Reduction/Titration	AMP III (p. 29)
Chlorazine (172/580-48-3/383)
Chlorbenside (173/103-17-3/384)
      1.    IR	CIPAC-1 (p. 730)
      2.    IR (as Mitox)	NEIC-173-A
Chlorbromuron (173A/13360-45-7/385)
      1.    GC(FID-ES)	EPA-1
      2.    TLC/UV	AMP VII (p. 576)

-------
                                                                C-5


Chlorbufam (575A/1967-16-14/1427)

Chlordane, AG

      1.    IR	AOAC-973.15 (p. 183)
      2.    GC (FID-ES; heptachlor content)	AOAC-973.17 (p. 184)

Chlordane, Technical (174/57-74-9/386)

      1.    Total" Chlorine
              (Sodium biphenyl reduction)	AOAC-962.05 (p. 182)
      2.    Colorimetric	AOAC-965.14 (p. 183)
      3.    Hexachlorocyclobutadiene Content (UV). AOAC-966.06 (p. 183)
      4.    Total Chlorine (Sodium)	AMP II (p. 51)
      5.    Composition	JAOAC 59. 696 (1976)
      6.    GC  (EC-CAP)	JAOAC 68.175(1985)
      7.    Qualitative  Test	NEIC-174-A
      8.    IR Characterization	CEP AC-1A (p. 1119)
      9.    GC (FID-ES)	CAN; CHD.G

Chlordecone (275/143-58-0/621)

      1.    IR	NEIC-275-A

Chlordimeform (174A/6164-98-3/387) and Chlordimeform Hydrochloride
   (174B/19750-95-9/388)

      1.    GC  (FID-IS)	AOAC-985.05 (p. 184)
      2.    GC  (FID-IS)	EPA-K3)
      3.    Titrimetric  & GC	AMP VII (p. 214/215)
      4.    GC  (FID-IS)	NEIC-174A-A
      5.    TLC	NEIC-174A-B

Chlorofenac (see  "Fenac"  882)

Chlorfenethol (310/80-06-8/702)

Chlorfenprop-methyl (557A/14437-17-3/1345)

      1.    GC (FID-ES)	NEIC-557A-A

Chlorfenson (see  "Ovex" 624)

Chlorfenvinphos (187/470-90-6/412)

      1.    GC  (FID-IS)	CIPAC-lA(p. 1132)
      2.    GC (FID-ES)	CAN; CHM.G
      3.    HPLC  (RP-ES)	CAN; CHM.L

-------
                                                                  C-6


Chlorflurazole (327A/3615-21-2/796)

Chlorflurecol (192A/2464-37-1/428)

Chlorflurecol-methyl (see "Dichlorflurenol, methyl ester" 557B)

Chloridazon (see "Pyrazon" 714C)

Chlorimuron Ethyl (1938/90982-32-4/-)

      1.    HPLC (RP-IS)	AMP XVI (p. 40)

Chlorinated Camphene (see "Toxaphene" 861)

Chlorinated Hydrocarbon Contamination

      1.    TLC	AOAC-972.05 (p. 152)
      2.    TLC	AMP VII (p. 6)
      3.    TLC	NEIC-TLC-A

Chlorinated Phenols (see "Phenols and Chlorinated Phenols")

Chlorine Dioxide (179A/10049-04-4/392)

      1.    Titrimetric	NEIC-179A-A

Chlormephos (195B/24934-91-6/439)

      1.    GC  (FID-IS)	AMPX(p. 51)

Chlormequat Chloride (191/999-81-5/425)

      1.    Chloride Titration	CIPAC ID (p. 40)
      2.    Gravimetric	AMP VII (p. 524)
      3.    Colorimetric	AMP VII (p. 525)

Chlornidine (89A/26389-78-6/207)

Chloroacetic Acid (179B/79-11-8/393)

Chlorobenzene (183A/108-98-7/402)

Chlorobenzilate (434/510-15-6/1038)

      1.    GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.    GC  (FID-IS)	EPA-1 (1)
      3.    GC  (FID-IS)	AMP VI (p. 319)
      4.    Total Chlorine	AMP II (p. 66)

-------
                                                                C-7


4-Chloro-2-cyclopentylphenol (186/13347-42-7/408) and Potassium salt (186AA)

      1.    GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.")
      2.    Total Chlorine (see "Phenols and Chlorophenols/EPA-3")
      3.    GC (TCD-ES)	NEIC-186-A
      4.    HPLC (RP-ES)	NEIC-186-B

5-Chloro-2-(2,4-dichlorophenoxy)phenol(186A/3380-34-5/411)

      1.    UV	NEIC-186A-A
      2.    Total Chlorine	NEIC-186A-B

4-Chloro-3,5-dimethylphenol (see "4-Chloro-3,5-xylenol" 218)

Chloroethylene bisthiocyanate (188D/24689-89-2/423)

Chloroform (192/67-66-3/427)

      1.    GC  (FID/TCD-ES)	AOAC-975.06 (p. 232)

a-Chlorohydrin (214 A/96-24-2/491)

      1.    GC  (FID-IS)	NEIC-214A-A

Chloroneb (198/2675-77-67446)

      1.    UV	EPA-K3)
      2.    GC (TCD-IS)	AMP VII; (p. 658)

l-Chloro-2-nitropropane (201A/2425-66-3/449)

      1.    GC (TCD-ES)	AMP V (p. 306)

Chlorophacinone(211C/3691-35-8/481)

      1.    UV	EPA-l(l)
      2.    HPLC (RP-ES)	EPA-2 (3)
      3.    UV	EPA-3(3)
      4.    HPLC (RP-ES)	JAOAC 65.927 (1982)
      5.    HPLC (RP-IS)	AMP XII (p. 230)
      6.    HPLC (RP-ES)	CAN; CJO.L
      7.    HPLC (RP-ES; in wax blocks and grain baits... AMP XVI (p. 122)

p-Chlorophenoxyacetic Acid  (204/122-88-3/454)

      1.    HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent")

-------
                                                                 C-8
Chlorophenoxy Herbicides
      1.    Definition, Structure and Tech. Data	EPA-1
      2.    UV(2,4-D and 2,4,5-T)	EPA-2
      3.    HPLC (Acids and esters)	EPA-3
      4.    GC (Butoxyethyl esters of 2,4-D and 2,4,5-T)	EPA-4
      5.    GC (2,4-D and 2,4,5-TP in fertilizers)	EPA-5
      6.    GC (as TMS ester)	AMP VI (p. 630)
      7.    HPLC (RP-ES)	AMP XII (p. 140)
      8.    Ester  Volatility	AOAC-960.10 (p. 153)
      9.    TLC	NEIC-ClPh-A
      10.   TLC	NEIC-ClPh-B
      11.   GC (FID-IS; as methyl ester)	CIPAC-IC; p. 2257
      12.   UV & GC (Use-dilutions)	NEIC-ClPh-C
      13.   HPLC(RP-IS)	NEIC-ClPh-D
      14.   Chlorophenol impurities (HPLC)	NEIC-ClPh-E
      15.   Chlorophenol impurities
              (Spectrophotometric)	CIPAC-IC (p. 2250)
      16.   HPLC (RP-IS; screening)	CAN-PHE.L
      17.   Enantiomer Resolution (GC and HPLC)... JAOAC 71. 614 (1988)

p-Chlorophenyl Diiodomethyl Sulfone (207AB/-/463)

      1.    Titrimetric	NEIC-207AB-A

5-Chloro-4-phenyl-3H- l,2-dithiol-3-one (207B/2425-05-0/465)

      1.    UV	NEIC-207B-A

2-Chloro-4-phenylphenol (209/92-04-6/471)

      1.    GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.")
      2.    Total Chlorine (see "Phenols and Chlorophenols/EPA-3")

4 & 6-Chloro-2-phenylphenol (210/607-12-5/472) (211/85-97-2/473)

      1.    GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.")
      2.    Total Chlorine (see "Phenols and Chlorophenols/EPA-3")

Chloropicrin (214/76-06-2/490)

      1.    GC (TCD-ES; with methyl bromide)	NEIC-214-A
      2.    GC (TCD-ES)	NEIC-214-B
      3.    GC (FID-IS; with 1,3-dichloropropenes)	EPA-1 (4)
      4.    GC (FID-ES/MB; with 1,3-dichloropropene).. CAN-DIR.G/CKA.G

Chloro-l,2-propanediol (see "a—Chlorohydrin" 214A)

-------
                                                                C-9
Chloropropylate (51 IB/5836-10-2/492)
      1.    GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.    IR	NEIC-511B-A
      3.    GC (see "Bromopropylate/NEIC-511A-A")

Chlorothalonil (215B/1897-45-6/497)

      1.    IR (EC and Flowable)	EPA-1
      2.    GC  (FID-IS)	EPA-2 (2)
      3.    IR (Tech. and WP)	NEIC-215B-A
      4.    GC (TCD/FID-IS)	AMP VIII (p. 266)

Chlorotriazine Herbicides

      1.    Labile Chlorine (Pot. titr'n)	EPA-1

Chloroxuron (217B/1982-47-4/505)

      1.    Dimethylamine Distillation and TLC	AOAC-977.06 (p. 216)
      2.    IR	EPA-1
      3.    GC(TCD-IS)	EPA-2

4-Chloro-3,5-xylenol (218/88-04-0/506)

      1.    Total Chlorine (see "Phenols and Chlorophenols/EPA-3")
      2.    GC (see "Phenols and Chlorophenols/EPA-7-Tent.")
      3.    UV	NEIC-218-A

Chloroxynil (309A/1891-95-8/699)

Chlorphoxim (219C/14816-20-7/465.5)

      1.    HPLC  (RP-ES)	CIPAC-ID (p. 43)

Chlorpropham (510A/101-21-3/1243)

      1.    IR	NEIC-510A-A
      2.    Hydrolysis/Titration	CIPAC-1 (p. 224)
      3.    Total Chlorine  (Sodium reduction)	AMP VI (p. 53)
      4.    GC(TCD-ES)	AMP VI (p. 612)
      5.    IR	AMP XI (p. 280)
      6.    HPLC (see "Quintex")
      7.    GC (FID-IS; with propham)	CIPAC-IC (p.  2025)
      8.    GC  (FID-IS/MB)	CAN; CLC.G

-------
                                                             C-10
Chlorpyrifos (219AA/2921-88-2/509)
      1.    HPLC (RP-IS)	AOAC-981.03* (p. 199)
      2.    GC (FID-IS)	JAQAC 56. 1093(1973)
      3.    IR	JAOAC 50. 861 (1967)
      4.    IR	EPA-K2)
      5.    UV	:	EPA-2(2)
      6.    GC (TCD-IS)	EPA-3 (2)
      7.    HPLC  (RP-ES)	EPA-4 (2)
      8.    IR..:	NEIC-219AA-A
      9.    HPLC  (RP-ES)	NEIC-219AA-B
      10.   GC (FID-IS)	NEIC-219AA-C
      11.   HPLC (NP-IS; encapsulated)	AMP XII (p. 45)
      12.   GC (FID-ES/MB)	CAN-CLD.G
      13.   HPLC  (RP-ES)	CAN-CLD.L
      14.   HPLC (RP-IS; with Diazinon)	JAOAC H, 321 (1988)

Chlorpyrifos Methyl (179AA/5598-13-0/510)

      1.    GC (FID-IS)	NEIC-179AA-A

Chlorsulfuron (654/64902-72-3A)

      1.    HPLC (RP-IS)	EPA-1 (4)
      2.    HPLC (RP-IS)	AMP XVI (p. 55)

Chlorthiamid (326B/1918-13-4/-)

      1.    Qualitative	CIPAC 1A (p. 1160)
      2.    Titrimetric	CIPAC lA(p. 1164)

Chlortoluron (216D/15545-48-9/500)

      1.    Distillation/Titration	AOAC-977.06 (p. 216)
      2.    HPLC (NP-ES)	AMP XII (p. 162)

Cholecalciferol

      1.    HPLC  (RP-ES)	JQAC 70.1058(1987)

Chromated Copper Arsenate

      1.    Total Chromium	AWPA; A2-71-5
      2.    Total  Arsenic	AWPA; A2-71-2
      3.    Total Copper	AWPA; A2-71-6

-------
                                                                C-ll
Chromated Zinc Chloride
      1.    Total Zinc	AWPA; A2-71-12
      2.    Total Chromium	AWPA; A2-71-5
      3.    Total  Chloride	AWPA; A2-71-4
Chromium (220B/ - / -)

      1.    Colorimetric	NEIC-220B-A

Cidial (see "Phenthoate" 427B)

Ciodrin (see "Crotoxyphos" 378)

CIPC (see "Chlorpropham" 510A)

Cisanalide (380A/34484-77-0/517)

Classic (see "Chlorimuron Ethyl" 193B)

Cloethocarb (73A/51487-69-5/-)

Clonitralid (314/1420-04-8/707)

      1.    Colorimetric	NEIC-314-A

Copper (227/7440-50-8/526) and Copper Compounds

      1.    Electrolytic	AOAC-922.05A (p. 149)
      2.    Titrimetric	AOAC-922.05B (p. 149)
      3.    EDTA Titration	NEIC-227-A
      4.    Colorimetric & AA (Water soluble from
              fungicides)	AOAC-981.01 (p. 156)
      5.    Colorimetric	NEIC-227-B
      6.    lon-Chromatography	EPA-1 (4)

Copper Acetoarsenite (see "Paris Green" 229A)

Copper Carbonate (235/12069-69-1/535)

      1.    Copper (Electrolytic)	AOAC-920.24A (p. 155)
      2..    Copper (Titrimetric)	AOAC-920.24B (p. 155)

Copperized  Chromated Zinc Arsenate

      1.    Total Copper	AWPA; A2-71-6
      2.    Total Chromium	AWPA; A2-71-5
      3.    Total Zinc	AWPA; A2-71-12

-------
                                                                C-12


Copperized Chromated Zinc Arsenate (cont.)

      1.    Total  Arsenic	AWPA; A2-71-2

Copper Fungicides

      1.   Water Insoluble
             (Spectrophotometric and AA)	AOAC-981.01 (p. 156)

Copper Naphthenate (245/1338-02-9/550)

      1.    Electrolytic	AOAC-964.03A (p. 155)
      2.    Titrimetric	AOAC-964.03B (p. 155)

Copper-8-quinolinolate (253/10380-28-6/560)

Co-Ral (see "Coumaphos" 335)

Cotoran (see "Fluometuron" 460A)

Coumachlor (4A/81-82-3/8)

      1.    UV	AMP III (p. 188)

Coumafuryl (5/117-52-2/9)

      1.    UV	EPA-1
      2.    UV	EPA-2
      3.    UV	NEIC-5-A

Coumaphos (335/56-72-4/814)

      1.    IR	EPA-1
      2.    HPLC  (RP-ES)	EPA-2
      3.    GC (FID-IS)	EPA-3
      4.    GC (ECD-ES)	AMP VI (p. 332)
      5.    UV (as Co-Ral)	AMP II (p. 86)

Coumatetryl (496A/5836-29-3/1213)

Counter (see "Terbufos" 131A)

Creosote (260/ - /569)

m-Cresol (261A/108-39-4/571)

-------
                                                               C-13
Crotoxyphos (378/7700-17-6/902)
      1.    GC  (FID-IS)	EPA-l(l)
      2.    GC(FID-ES)	AMP VI (p. 325)
      3.    IR	AMP V (p. 246)
      4.    IR (with  dichlorvos)	NEIC-378-A
      5.    GC (FPD-ES, with dichlorvos)	NEIC-378-B

Crufomate (263A/299-86-5/575)

      1.    IR	EPA-1
      2.    GC(TCD-IS)	EPA-2

Cryolite (264/15096-52-3/576)

Cupric Oxide (265/1317-38-0/580)

Cyanazine (188C/21725-46-2/422)

      1.    IR	EPA-1
      2.    GC  (FID-IS)	NEIC-188C-A
      3.    Labile Chlorine (see "Chlorotriazine Herbicides/EPA-1")
      4.    HPLC(NP-ES)	AMP X (p. 277)
      5.    IR (Water dispersables)	AMP X (p. 283)
      6.    HPLC (RPNH2-IS)	CIPAC-IC (p.  2040)
      7.    Reference  Std. (Purification and purity).... CIPAC-IC (p.  2335)
      8.    HPLC(NP-ES)	CAN; CUC.L
      9.    GC (FID-ES; in fertilizers	CAN; EPT.G

Cyanide

      1.    Titrimetric	AOAC-920.30 (p. 159)

Cyanuric Acid (862) (see "Available Chlorine")

Cyanophos (268A/2636-26-2/591)

Cycloate (432A/1134-23-2/1037)

      1.    GC  (FID-IS)	AOAC-974.05 (p. 221)
      2.    GC(TCD-ES)	EPA-1
      3.    GC (FID-ES)	EPA-2
      4.    GC  (FID-IS)	EPA-3
      5.    GC  (FID/TCD-ES)	AMP V (p. 492)
      6.    GC (FID-ES; in fertilizers)	CAN; EPT.G

Cycloheximide (270A/66-81-9/601)

-------
                                                                C-14


Cycloprate(271BBB/54460-46-7/1158)

      1.     GC  (FID-IS)	NEIC-271BBB-A

Cycocel (see "Chlormequat chloride" 191)

Cyfluthrin (266E/68359-37-5/-)

      1.     HPLC(NP-IS)	JAQAC 73. 595 (1990)

Cygon (see "Dimethoate" 358)

Cyhalothrin (271F/68085-85-8/-)

      1.     HPLC (RP-IS)	AMP XIII (p. 11/15)
      2.     GC (ECD-IS; cattle dips)	AMP XIII (p. 18)
      3.     HPLC (RP-IS; cattle dips)	AMP XIII (p. 21)

Cyhexatin (884A/13121-70-5/608)

      1.     HPLC (RP-IS)	AOAC-988.02* (p. 225)
      2.     Nonaqueous Titration	AMP VII (p. 419)

Cymoxanil (271K/57966-95-7/-)

Cyolane (see "Phosfolan" 268B)

Cypendazole (560/28559-00-4/1370)

      1.     UV	JAQAC 58. 971 (1975)

Cypermethrin (271DD/66841-24-5/0

      1.     HPLC (RP-IS)	AMP XIII (p. 37)
      2.     GC (FID-IS)	AMP XIII (p. 41)
      3.     GC (FID-IS, CAP)	AOAC-985.03 (p. 166)
      4.     GC (FID-IS)..	AOAC-986.02* (p. 166)
      5.     GC (FID-IS)	EPA-1 (4)
      6.     Identification (GC/HPLC/NMR/MS/IR)	CIPAC-ID (p. 180)
      7.     GC(FID-ES)	CAN; CYR.G

Cyprazine (271D/22936-86-3/611)

      1.    Labile Chlorine (see "Chlorotriazine Herbicides/EPA-1")
      2.    GC (FID-ES)	NEIC-271D-A
      3.    Non-aqueous  Titration	NEICT271D-B

Cyprazole (271L/42089-03-2/612)

-------
                                                                C-15


Cyprex (see "Dodine" 419)

Cypromid (272/2759-71-9/613)

Cyromazine (167B/66215-27-8/-)

      1.    GC (FID-IS; in Trigard®)	EPA-1 (4)
      2.    GC (FID-IS; in  Armor®)	EPA-2 (4)
      3.    GC (FID-ES; in Armor® Premix)	EPA-3 (4)

Cythioate (272B/115-93-5/614)

Cytrolane (see "Mephosfolan" 268H)

-------
                                                                 D-l
2,4-D (315/94-75-7/708)
      1.     HPLC (RP-IS; acids, esters, & amine salts)	
            	AOAC-978.05* (p. 184)
      2.     HPLC (RP-IS; with picloram)	AOAC-976.03 (p. 196)
      3.     UV (with 2,4,5-T) (see "Chlorophenoxy Herbicides/EPA-2")
      4.     HPLC (see "Chlorophenoxy Herbicides/EPA-3")
      5.     GC (Butoxyethanol ester) (see "Chlorophenoxy/
              Herbicides EPA-4")
      6.     GC (in fertilizers, with 2,4,5-T) (see "Chlorophenoxy
              Herbicides/EPA-5")
      7.     GC (FID-ES; as TMS ester)	AMP VI (p. 630)
      8.     TLC	NEIC-ClPh-A/B
      9.     IR	CIPAC-1; p. 730
      10.    HPLC (Impurities)	JAOAC 66. 804(1983)
      11.    GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      12.    Reference Std. (Purification and purity	CIPAC-IC (p. 2307)
      13.    HPLC (RP-IS; with dicamba and mecoprop)	
            	AOAC-984.07* (p. 188)
      14.    HPLC (RP-ES; with dicamba and mecoprop in
              fertilizers)	CAN; DGM.L

Daconil 2727 (see "Chlorothalonil" 215B)

Dacthal (see "DCPA" 382)

Dalapon (273/75-99-0/615) and Sodium Salt (273A/127-20-8/618)

      1.     Titrimetric (Na Salt)	AOAC-962.06 (p. 185)
      2.     HPLC (RP-ES)	AOAC-984.06* (p. 185)
      3.     IR	EPA-1
      4.     Colorimetric	CIPAC-1 (p. 274/276)
      5.     GC (FID-ES; as methyl ester)	NEIC-273-A

Daminozide (808/1596-84-5/619)

      1.     Aqueous Base Titration	AMP V (p. 501)
      2.     Non-aqueous Base Titration	NEIC-808-A
      3.     Redox Titration	NEIC-808-B

Danitol (273H/39515-41-8/-)

      1.     GC (FID-IS)	AMP XIII (p. 70)

Dasanit (see "Fensulfothion" 343)

-------
                                                                D-2
Dazomet (840/533-74-4/1952)
      1.    Hydrolysis/Titration	AMP III (p. 121)
      2.    IR	NEIC-840-A
      3.    Hydrolysis/Titration	CIPAC-IC (p. 2074)

2,4-DB (316/94-82-6/765)

      1.    Titrimetric	AMP V (p. 372)
      2.    GC (FID-ES; as TMS ester)	AMP VI (p. 630)
      3.    HPLC(RP-IS)	NEIC-316-A
      4.    GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      5.    Reference Std. (Purification and purity)	CIPAC-IC (p. 2321)

DBCP (see "l,2-Dibromo-3-chloropropane" 287)

DCPA (382/1861-32-1/911)

      1.    GC (FID-ES; with HCB)	AOAC-970.05* (p. 186)
      2.    IR	AOAC-970.06* (p. 186)

DDD (see "TDE" 307)

D-D Mixture (324/78-87-5/790)

      1.    IR (with allyl alcohol)	NEIC-324-A
      2.    GC (TCD-ES)	NEIC-324-B
      3.    GC (with chloropicrin) [see "Chloropicrin/EPA-l(4)"]

DDT (308/50-29-3/694)

      1.    Total Chlorine	AOAC-947.02 (p. 186)
      2.    IR (Dusts and granules)	AOAC-960.13 (p. 186)
      3.    IR (Emulsifiable  concentrates)	EPA-1
      4.    Hydrolyzable  Chlorine	JAOAC 29.188(1946)
      5.    IR	NEIC-308-A
      6.    GC  (FID-IS)	JAOAC 73. 744 (1990)

DDVP (see "Dichlorvos" 328)

Deet (346/134-62-3/837)

      1.    IR	EPA-1
      2.    GC(TCD-IS)	EPA-2
      3.    GC  (FID-IS)	EPA-3
      4.    HPLC (NP-ES)	EPA-4 (2)
      5.    GC (FID-IS; with MGK synergists)	NEIC-346-A
      6.    GC (FID-ES)	CAN; DEE.G

-------
                                                                D-3


DEF (864/78-48-8/1991)

      1.    IR	AMP IV (p. 90)

Dehydroabietylamine (276/1446-61-3/624)

      1.    Colorimetric	NEIC-276-A

Delachlor (278AA/24353-58-0/631)

      1.    GC(TCD-IS)	NEIC-278AA-A

Delnav (see "Dioxathion" 393)

Delphene (see "Deet" 346)

Deltamethrin (463B/52918-63-5/ -)

      1.    HPLC (NP-ES)	AMP XIII (p. 55)
      2.    HPLC (NP-ES)	CIPAC-ID (p. 59)
      3.    Characterization (TLC/HPLC/IR/NMR/MS)...CIPAC-ID (p. 57)
      4.    HPLC (NP-ES)	CAN; DBR.L
      5.    HPLC (NP-ES)	JAOAC 73. 751 (1990)

Demeton (279/8065-48-3/632)

      1.    GC(TCD-IS)	AMP VI (p. 483)
      2.    Hydrolysis/Titration	AMP II (p. 453)
      3.    IR	NEIC-279-A

Demeton-S-methyl (456/8022-00-2/1087)

Demosan (see "Chloroneb" 198)

2,4-DEP (897/94-84-8/2105)

      1.    Titrimetric	AMP IV (p. 127)

Desmedipham (447AAA/13684-56-5/633)

      1.    HPLC (NP-IS)	AMPX(p. 297)
      2.    Total Nitrogen	AMPX(p. 295)
      3.    TLC	NEIC-447AAA-A
      4.    Hydrolysis/Distillation	NEIC-447AAA-B

Desmetryne (509B/1014-69-3/1240)

      1.    GC  (FID-IS)	CIPAC-lB(p. 1765)

-------
Dessin (see "Dinobuton" 128F)

Destun (see "Perfluidone" 539C)

Devrinol (see "Napropamide" 590A)

Dexon (see "Fenaminosulf 359B)

Dialifor (280A/10311-84-9/636)

      1.    UV	NEIC-280A-A
      2.    HPLC(RP-IS)	NEIC-280A-B

Diallate (299/2303-16-4/682)

      1.    GC(TCD-IS)	NEIC-299-A

Diamidifos (654B/1754-58-1/650)

Diazinon (342/333-41-5/824)

      1.    GC (FID-IS)	AOAC-971.08 (p. 222)
      2.    GC (FID-IS; Encapsulated)	AOAC-982.06 (p. 200)
      3.    GC(TCD-ES)	EPA-1
      4.    HPLC  (RP-ES)	EPA-2
      5.    IR	EPA-3
      6.    GC (FID-IS)	EPA-4
      7.    TLC	sIAQA£53,514(1970)
      8.    Potentiometric Titration	NEIC-342-A
      9.    GC (FID-IS)	NEIC-342-B
      10.   GC (FID-IS, with PBO)	NEIC-342-C
      11.   GC (FID-ES/MB)	CAN; DFN.G
      12.   HPLC (NP-ES)	CAN; DFN.L
      13.   HPLC (RP-IS; with chlorpyrifos)	JAOAC H, 321 (1988)

Dibam (see "Sodium Dimethyldithiocarbamate" 762)

Dibrom (see "Naled" 586)

1,2-Dibromo-3-chloropropane (287/96-12-8/656)

      1.    IR	EPA-1
      2.    GC(TCD-ES)	EPA-2

2,2-Dibromo-3-nitrilopropionamide(287AA/10222-81-2/659)

      1.    Titrimetric	NEIC-287AA-A

-------
                                                                 D-5


Dibutalin (see "Butralin" 125E)

Dibutyl Phthalate (292/84-74-2/668)

Dibutyl Succinate (293/141-03-7/669)

      1.    Hydrolysis/Titration	EPA-1

Dicamba (295/1918-00-9/671)

      1.    IR	AOAC-969.07 (p. 187)
      2.    IR (with MCPA or 2,4-D)	AOAC-971.07 (p. 187)
      3.    HPLC (HPLC-RP; with 2,4-D and
              mecoprop)	AOAC-984.07* (p. 188)
      4.    GC (as TMS ester)	AMP VI (p. 630)
      5.    HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent")
      6    GC (as methyl ester)	NEIC-CIPh-A
      7.    GC (Use-dilutions, as methyl ester)	NEIC-295-A
      8.    HPLC (RP-ES; with 2,4-D and mecoprop in
              fertilizers)	CAN; DGM.L

Dicapthon (296/2463-84-5/677)

Dichlobenil (297/1194-65-6/678)

      1.    GC  (FID-IS)	AOAC-979.03 (p. 188)
      2.    IR	EPA-1
      3.    GC (TCD-ES)	NEIC-297-A
      4.    GC  (FID-IS)	AMPX(p. 313)
      5.    GC  (FID-IS)	CIPAC-lB(p. 1769)

Dichlofenthion (321/97-17-6/679)

Dichlofluanid (297A/1085-98-9/688)

      1.    HPLC (RP-ES)	CIPAC-IC (p. 2083)
      2.    Hydrolyzable Chlorine	CIPAC-1B (p. 1775)

Dichlone (298/117-80-6/680)

      1.    IR	EPA-1

Dichloran (311/99-30-9/704)

      1.    IR	EPA-1
      2.    IR	NEIC-311-A/B
      3.    GC  (FID-IS)	NEIC-311-C

-------
                                                                 D-6
Dichlorflurenol, methyl ester (557B/2536-31-4/1346)
      1.    TLC/UV	AMP X (p. 527)
      2.    GC&HPLC	JAQACfiQ, 728 (1977)
      3.    UV	EPA-K3)

Dichlormate (298A/1966-58-1/681)

o-Dichlorobenzene (301/95-50-1/684)

p-Dichlorobenzene (632/106-46-7/684.5)

      1.    IR	EPA-1
      2.    GC(TCD-IS)	EPA-2

Dichloroisocyanuric Acid (327/2782-57-2/795) (see "Available Chlorine")

Dichlorophene (563/97-23-4/1376)

      1.    GC (TMS Der.) (see "Phenols and Chlorophenols/EPA-6-Tent.")
      2.    UV	AOAC-972.48 (p. 529)
      3.    IR	NEIC-563-A
      4.    GC (HCD-ES; as methyl ester)	NEIC-563-B
      5.    HPLC (RP-ES)	CAN; DIC.L

3,6-Dichloropicolinic Acid (323H/1702-17-6/791.05)

l,3-Dichloropropene(324A/542-75-6/790.5)

      1.    GC (FID-ES)	CAN; DIR.G
      2.    GC (FID-ES/MB; with chloropicrin)	CAN; DIR.G/CKA.G

Dichlorprop (320/120-36-5/774)

      1.    IR	CIPAC-1 (p. 730)
      2.    Titration	CIPAC-1A (p. 1211)
      3.    GC Characterization	CIPAC-lA(p. 1211)
      4.    HPLC (RP-IS)	CIPAC-IC (p. 2088)
      5.    GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      6.    Reference Std. (Purification and purity)	CIPAC-IC (p. 2323)

Dichlorvos (328/62-73-7/797)

      1.    IR (Baits and EC)	AOAC-964.04 (p. 199)
      2.    IR (Sprays)	AOAC-966.07 (p. 200)
      3.    GC (FID-ES; hexane/CH3CN partitioning)	AMP VI (p. 529)
      4.    GC (FID-ES)	NEIC-328-A
      5.    GC (FID/FPD-ES; with crotoxyphos)	NEIC-328-B

-------
                                                                D-7
Dichlorvos (328/62-73-7/797) (cont.)
      6.    GC  (FPD-ES)	NEIC-328-C
      7.    GC (Chloral content)	CIPAC-1A (p. 1216)
      8.    Titrimetric	CIPAC-1A (p. 1221)

Diclofop-methyl (319A/51338-27-3/797.5)

      1.    GC  (FID-IS)	CIPAC-IC (p. 2098)
      2.    GC(FID-ES)	NEIC-319A-A
      3.    GC (FID-ES/MB)	CAN; DIB.G

Dicofol (93/115-32-2/213)

      1.    Hydrolyzable Chlorine	AOAC-976.02 (p. 189)
      2.    HPLC (RP-ES)	AOAC-986.06* (p. 190)
      3.    IR	CIPAC-1 (p. 730)
      4.    HPLC (RP-ES; with carbaryl, folpet, and malathion) NEIC-93-A
      5.    IR	NEIC-93-B
      6.    HPLC (RP-ES)	JAQAC 63.1296 (1980)
      7.    HPLC (with acephate and triforine) [see Acephate/EPA-1 (4)]

Dicrotophos (376/141-66-2/900)

      1.    IR	EPA-K3)
      2.    IR	AMP V (p. 215)
      3.    GC (FID-ES)	AMP VI (p. 290)
      4.    IR	NEIC-376-A

Dicryl (329/2164-09-2/798)

Dieldrin (333/60-57-1/806)

      1.    Total Chlorine	AOAC-961.04 (p. 175)
      2.    IR  (HEOD)	AOAC-961.05 (p. 175)
      3.    GC (FID-ES)	AMP VI (p. 271)

Dienochlor (see "Pentac" 274)

Diethatyl-ethyl(179D/38727-55-8/808.5)

      1.    HPLC(RP-IS)	NEIC-179D-A

Difenacoum (-/56073-07-5/-)

      1.    HPLC (RP-ES)	AMP XVI (p. 153)

-------
                                                                 D-8


Difenzoquat Methyl Sulfate (363A/43222-48-6/838)

      1.    UV	AMP XI (p. 292)
      2.    HPLC(RP-IS)	NEIC-363A-A
      3.    HPLC (RP-ES)	JAOAC 63. 647 (1980

Diflubenzuron(346A/35367-38-5/839)

      1.    HPLC(RP-IS)	AOAC-983.07 (p. 190)
      2.    HPLC(NP-IS)	AMPX(p. 59)
      3.    UV	AMP X (p. 62)
      4.    HPLC (NP-IS)	NEIC-346A-A
      5.    HPLC (RP-ES)	NEIC-346A-B

Difolatan (see "Captafol" 828)

Diiodomethyl-p-tolyl sulfone (353B/20018-89-1/853)

      1.    Titrimetric	NEIC-353B-A

Dilan (92A/117-26-0/212)

Dimefox (843/115-26-4/1959)

      1.    Differential  Hydrolysis	CIPAC-1 (p. 330)

Dimetan

      1.    Hydrolysis/Distillation	AMP II (p. 166)

Dimethoate (358/68-51-5/863)

      1.    GC (TCD-IS)	EPA-1 (1)
      2.    GC  (FID-IS)	EPA-2 (1)
      3.    Hydrolysis/Distillation	AMP II (p. 172)
      4.    Gravimetric	AMP II (p. 174)
      5.    GC  (FID-IS)	AMP VI (p. 357)
      6.    Byproducts (TLC/GC)	CIPAC-1A (p. 1232)
      7.    GC (FID or TSD-ES/CAP)	CAN; DME.G

Dimethrin (359/70-38-2/864)

Dimethyl Phthalate (380/131-11-3/905)

      1.    GC (FID-IS; Mosquito clothwipes)	EPA-1 (3)

Dimetilan (496B/644-64-4/1214)

-------
                                                                D-9


Dimilin (see "Diflubenzuron" 346A)

Dimite (see "Chlorfenethol" 310)

Dinitramine (335C/29091-05-2/917)

      1.    GC  (FID-IS)	EPA-1 (3)
      2.    GC (FID  or TCD-IS)	AMP VIII (p. 362)

Dinitro-o-sec-Butyl Phenol (see "Dinoseb" 392DD)

Dinobuton (128F/973-21-7/293)

      1.    Titrimetric	AMP VII (p. 277)
      2.    Colorimetric	AMP VIII (p. 278)
      3.    Non-aqueous Titration	NEIC-128F-A

Dinocap (391D/39300-45-3/927)

      1.    Total Nitrogen	EPA-1
      2.    IR	EPA-2
      3.    GC  (FID-IS)	AMP VI (p. 568)
      4.    Colorimetric	JAOAC 57.653 (1974)
      5.    HPLC (RP-ES)	NEIC-391D-A
      6.    Polarography	NEIC-391D-B

Dinoseb (392DD/88-85-7/932)

      1.    Stannous Chloride Reduction (see "Nitrophenols/EPA-1")
      2.    Total Nitrogen (see "Nitrophenols/EPA-2")
      3.    IR	EPA-1
      4.    GC(TCD-ES)	EPA-2
      5.    UV	CIPAC-1 (p. 338)
      6.    HPLC (RP-ES)	NEIC-392DD-A
      7.    UV (with  Naptalam)	NEIC-392DD-C
      8.    Redox Titration	AMP V (p. 387)
      9.    HPLC (RP-ES)	CAN; DOG.L

Dinoterb (392F/1420-07-1/291)

      1.    GC (TCD or FID-IS; as methyl ester)	CIPAC-1B; p. 1797

Dioxacarb (393A/6988-21-2/940)

Dioxathion (393/78-34-2/941)

      1.    IR	NEIC-393-A
      2.    GC (FID-ES; in formulations and dips)... JAOAC 5JJ,566 (1970)
      3.    HPLC(RP-IS)	NEIC-393-B

-------
                                                               D-10
Dioxathion (393/78-34-2/941) (cont.)
      4.    IR	NEIC-393-C
      5.    GC (NPD-IS; in cattle dips)	JAOAC 63. 33 (1980)
      6.    IR (Cattle dips)	JAOAC 65. 930 (1982)

Dioxin (393AB)

      1.    GC/MS (in 2,4-D and 2,4,5-T)	EPA-1 (3)

Diphacinone (394/82-66-6/942)
      1.    UV	EPA-1
      2.    HPLC (RP-ES)	EPA-2(2)
      3.    HPLC (RP-ES)	EPA-3(3)
      4.    HPLC (RP-ES)	JAOAC 65. 927 (1982)
      5.    UV	NEIC-394-A
      6.    UV  (0.1%)	NEIC-394-B
      7.    HPLC (RP-ES)	NEIC-394-C
      8.    HPLC (RP-ES; in cereal baits)	AMP XVI (p. 130)

Diphenamid (395/957-51-7/944)

      1.    IR	EPA-1 (3)
      2.    GC  (FID-IS)	EPA-2(3)
      3.    IR	AMP V (p. 376)
      4.    GC  (FID-IS)	AMP V (p. 376)

Diphenylacetonitrile (396/86-29-3/945)

      1.    IR	NEIC-396-A

Diphenylamine (398/122-39-4/946)

      1.    GC (TCD-ES)	EPA-1 (2)
      2.    GC  (FID-IS/MB)	CAN; DPF.G

Dipropetryn (456AA/4147-51-7/952)

Dipterex (see "Trichlorofon" 385)

Diquat Dibromide (402/85-00-7/958)

      1.    UV	AOAC-969.08 (p. 225)
      2.    HPLC (RP-IS)	EPA-1 (3)
      3.    HPLC (RP-IS)	NEIC-402-A

Disodium N-(2-Hydroxyethyl)iminodiacetate (404/135-37-5/962)

      1.    Potentiometric Titration	NEIC-404-A

-------
                                                               D-ll
Disulfoton (341/298-04-4/823)
      1.    GC (FID-IS)	AOAC-980.10* (p. 201)
      2.    IR	EPA-1
      3.    GC (FID-IS)	EPA-2
      4.    GC (FID-IS)	EPA-3 (3)
      5.    Hydrolysis/Titration	AMP II (p. 189)
      6.    IR	AMP II (p. 190)
      7.    IR	sIAQAQ 41, 257(1974)
      8.    GC(TCD-ES)	NEIC-341-A
      9.    GC (FID-IS; with fensulfothion) (see "Mixed pesticides EPA-3")
      10.   HPLC (NP-ES)	CAN; DSN.L

Di-Syston (see "Disulfoton1' 341)

Dithane M-45 (913A/8018-01-7/2134)

      1.    Titrimetric	CIPAC-1A (p  1289)

Dithianon (349B/3347-22-6/843)

      1.    IR	JAOAC 52. 659 (1969)
      2.    Colorimetric	AMPX(p. 183)
      3.    Colorimetric	NEIC-349B-A
      4.    Colorimetric	CIPAC-IC (p.  2106)

Dithiocarbamates

      1.    Carbon Disulfide Evolution	AOAC-965.15 (p. 217)
      2.    Qualitative Test	JAOAC 55. 939 (1972)
      3.    Qualitative Test	CIPAC-ID (p. 179)
      3.    Degradation Product Analyses	AMP XI (p. 197)

Diuron (410/330-54-1/975)

      1.    Hydrolysis/Distillation	EPA-1
      2.    HPLC  (RP-ES)	EPA-2
      3.    UV	EPA-3
      4.    IR	EPA-4
      5.    IR	CIPAC-1; p. 731
      6.    HPLC (Use-dilutions)	NEIC-410-A
      7.    HPLC (NP-IS)	AMP XII (p. 162)
      8.    HPLC(RP-IS)	AMP XIII (p. 227)
      9.    Tetrachloroazobenzene content (GC)	JAQAC 23, 749 (1990)

DNBP (see "Dinoseb" 392DD)

Dodemorph (268C/31717-87-0/596)

-------
                                                                 D-12


Dodine (419/2439-10-3/1000)

      1.     Non-aqueous Titration	AOAC-970.07 (p. 225)

Dowicil 100 (181/4080-31-3/397)

      1.     Titrimetric	NEIC-181-A
      2.     TLC	JAOAC 63. 864 (1980)

Dowicil S-13 (see "2,3,5,6-Tetrachloro-4-(methylsulfonyl)pyridine" 830A)

2,4-DP (see "Dichloroprop" 324)

Drazoxolon (207C/5707-69-7/466)

      1.     Colorimetric	AMP VII (p. 667)

Drepamon (see "Tiocarbenil" 82AA)

DSMA (405/144-21-8/963)

      1.     Titrimetric (see "Arsenic Compounds/EPA-3-Tent. & EPA-4")

Duraset (860/85-72-3/1985)

      1.     Titrimetric	AMP V (p. 407)

Dursban (see "Chlorpyrifos" 219AA)

Du-Ter (see "Triphenyltin Hydroxide" 896E)

Dyfonate (see "Fonofos" 454B)

Dylox (see "Trichlorofon" 385)

Dymid (see "Diphenamid" 395)

Dyrene (see  "Anilizine" 302)

-------
                                                               E-l

Edifenphos (434B/17109-49-8/1041)

      1.    GC (FID-IS)	EPA-1 (4)
      2.    GC(TCD-IS)	NEIC-434B-A
      3.    HPLC (RP-ES)	JAOACfiS, 138(1985)

EDTA (438/60-00-4/1048)

      1.    Titrimetric	NEIC-438-A
      2.    Colorimetric	NEIC-438-B
      3.    Qualitative Test	NEIC-438-C

Endosulfan (420/115-29-7/1001)

      1.    GC (FID or TCD-IS)	AOAC-983.08 (p. 191)
      2.    Hydrolysis/Titration	EPA-1
      3.    IR	EPA-2
      4.    GC (TCD-IS)	EPA-3
      5.    GC (FID-IS)	EPA-4
      6.    GC (FID-IS)	EPA-5 (2)
      7.    GC(TCD-ES)	AMP VI (p. 511)
      8.    Chromatography/IR	CIPAC-1 (p. 361)
      9.    GC (FID-IS)	CIPAC-IC (p. 2110)
      10.   GC (FID-ES/MB)	CAN; ENA.G

Endothall (421/129-67-9/1002)

      1.    Oxidation/Titration	EPA-1
      2.    GC(FID-ES)	EPA-2
      3.    GC (TCD or FID-ES)	AMP X (p. 330)
      4.    GC(TCD-ES)	NEIC-421-A
      5.    Titrimetric	NEIC-421-B

Endrin (423/72-20-8/1009)

      1.    IR	AOAC-961.05 (p. 175)
      2.    Total Chlorine	AOAC-961.04 (p. 175)
      3.    IR	NEIC-423-A
      4.    IR (with methyl parathion)	CIPAC-1B (p. 1819)

Enide (see "Diphenamid" 395)

Entex (see "Fenthion" 456F)

Epichlorohydrin (424/106-89-8/1010)

      1.    GC (FID-ES)	EPA-1 (3)

-------
                                                                E-2

EPN (454/2104-64-5/1808)

      1.    Potentiometric  Titration	NEIC-454-A
      2.    GC (FID-IS)	NEIC-454-B

Eptam (see "EPTC" 435)

EPTC (435/759-94-4/1042)

      1.    GC (FID-IS)	AOAC-974.05 (p. 221)
      2.    GC(TCD-IS)	EPA-1
      3.    HPLC(NP-ES)	EPA-2
      4.    GC (FID-IS)	EPA-3
      5.    GC (FID-IS)	EPA-4
      6.    GC(TCD-IS)	EPA-5
      7.    HPLC (RP-ES)	EPA-6 (2)
      8.    IR	NEIC-435-A

Erbon (425/136-25-4/1012)

      1.    GC (FID-IS)	JAOAC 56.1087 (1973)
      2.    Hydrolysis/Titration	NEIC-425-A

Ethafluralin (453B/55283-68-6/1015)

      1.    UV	AMP X (p. 343)
      2.    GC (FID-IS)	AMPX(p. 345)

Ethanol (430/64-17-5/17)

Ethephon (426A/16672-87-0/1018)

      1.    Titrimetric	NEIC-426A-A
      2.    GC (FID-ES; as methyl  ester)	NEIC-426A-B

Ethidimuron (902C/30043-49-3/-)

Ethiolate (434AA/2941-55-1/1019)

Ethion (427/563-12-2/1020)

      1.    HPLC(RP-IS)	AOAC-979.04 (p. 201)
      2.    IR	EPA-1
      3.    GC (TCD-ES)	EPA-2
      4.    HPLC (RP-ES)	CAN; ETI.L
      5.    HPLC (NP-ES; in oil base)	CAN; ETI.L (2)

-------
                                                                E-3

Ethirimol (128H/23947-60-6/297)

      1.    GC (FID-IS; as TMS derivative)	AMP VIII (p. 288)
      2.    UV	AMP VIII (p. 287)
      3.    TLC	AMP VIII (p. 287)
      4.    GC (FID-IS; as TMS derivative)	CIPAC-ID (p. 72)
      5.    Identification (GC/TLC/IR/NMR)	CIPAC-ID (p. 182)
      6.    Reference Std. (Purification and purity)	CIPAC-ID (p. 202)

Ethofumesate(427BB/26225-79-6/1020.5)

      1.    GC (FID-IS)	AMPX(p. 355)
      2.    GC (FID-IS)	EPA-1 (2)

Ethoprop (434C/13194-48-4/1021)

      1.    IR	EPA-1
      2.    GC(TCD-IS)	EPA-2
      3.    GC (FID-IS)	EPA-3
      4.    GC (FID-IS	NEIC-434C-A
      5.    GC (TCD-IS)	AMP XVI (p. 7)

Ethoxyquin (427D/91-53-2/1024)

      1.    Non-aqueous Titration	NEIC-427D-A
      2.    Fluorescence	NEIC-427D-B

Ethrel (see "Ethephon" 426A)

Ethylene Dibromide (439/106-93-4/1056)

      1.    GC (TCD or FID-ES)	AOAC-966.05* (p. 164)

Ethylene Dichloride (440/107-06-2/1057)

      1.    GC (TCD-ES)	AOAC-966.05* (p. 164)
      2.    GC (FID)	NEIC-FUM-A

Ethylene Glycol (441/107-21-1/1058)

      1.    GC (TCD-ES)	NEIC-441-A

Ethylene Oxide (443/75-21-8/1061)

Ethylene Thiourea (443AA/96-45-7/-)

      1.    GC (FID & TCD)	EPA-1 (1)
      2.    GC&TLC	JAOAC 55.923 (1972)
      3.    UV	NEIC-443AA-A

-------
                                                                 E-4
Ethylene Thiourea (443AA/96-45-7/-) (cont.)
      4.    TLC	NEIC-443AA-B
      5.    HPLC (RP-IS)	CIPAC-IC (p. 2298)

Ethyl Guthion (see "Azinphos ethyl" 344)

2-Ethyl-l,3-hexanediol (445/94-96-2/1064)

      1.    Acetylation	EPA-1
      2.    GC(TCD-IS)	EPA-2

Etrimfos (365AAA/38260-54-7/1091)

      1.    GC (FID-IS)	AMP XI (p. 128)

ETU (see "Ethylene Thiourea" 443AA)

-------
                                                                F-l

Falone (see "2,4-DEP" 897)

Famphur (456D/52-85-7/1093)

      1.    Colorimetric	NEIC-456D-A
      2.    IR (Encapsulated)	JAOAC 61.1526(1978)
      3.    HPLC (RP-ES)	NEIC-456D-B
      4.    GC  (FID-IS)	NEIC-456D-C

Fenac (882/85-34-7/2050)

Fenaminosulf (359B/140-56-7/866)

      1.    Colorimetric	AMP III (p. 51)

Fenarimol (207AA/60168-88-9/1097)

      1.    GC(FID-ES)	AMP XIII (p. 175)

Fenazaflor (654A/14255-88-0/1598)

      1.    UV	NEIC-654A-A

Fenbucarb (-/3766-81-2/-)

      1.    TUC/Colorimetric	CIPAC-ID (p. 87)
      2.    HPLC (NP-IS)	CIPAC-ID (p. 89)

Fenbutatin Oxide (see "Hexakis" 481DD)

Fenitrothion (373/122-14-5/897)

      1.    GC  (FID-IS)	AOAC-985.07 (p. 202)
      2.    GC  (FID-IS)	AOAC-989.02 (p. 203)
      3.    Hydrolysis/UV	AMP VII (p. 461)
      4.    GC  (FID-IS)	NEIC-373-A
      5.    Titrimetric	CIPAC-1A (p.  1255)
      6.    GC (FID-ES)	CAN; FDN.G

Fenoprop (see "Silvex" 2663)

Fenoxycarb (652C/79127-80-3/-)

      1.    HPLC(RP-IS)	AMP XVI (p. 23)

Fenpropathrin (see "Danitol" 273H)

-------
                                                                F-2

Fenson (207/80-38-6/462)

      1.    Hydrolysis/Titration	CIPAC-1 (p. 392)
      2.    IR	CIPAC-1 (p. 730)

Fensulfothion (343/115-90-2/825)

      1.    GC  (FID-IS)	AOAC-986.07* (p. 203)
      2.    HPLC(RP-IS)	AOAC-983.09* (p. 204)
      3.    GC (FID-IS, with disulfoton) (see "Mixed Pesticides EPA-3")
      4.    Titrimetric	AMP VII (p. 256)
      5.    IR	NEIC-343-A
      6.    HPLC(NP-ES)	CANjFDS.L

Fenthion (456F/55-38-9/1098)

      1.    GC(FID-ES)	NEIC-456F-A
      2.    GC (FID-IS; in oil)	NEIC-456F-B
      3.    IR	AMP II (p. 45)
      4.    GC (FID-ES; in feeds)	AMP VI (p. 301)
      5.    IR	NEIC-456F-C
      6.    Colorimetric	CIPAC-1B (p. 1831)

Fentin Acetate (896C/900-95-8/2098)

      1.    Potentiometric Titration	AOAC-979.02 (p. 156)
      2.    GC (FID-IS, with maneb)	AOAC-984.04 (p. 157)

Fentin Hydroxide (see "Triphenyltin Hydroxide" 896E)

Fenuron (457/101-42-8/1099)

      1.    Dimethylamine Distillation	NEIC-457-A
      2.    HPLC (see "Quintex")

Fenvalarate (77A/51630-58-1/590)

      1.    HPLC(RP-IS)	NEIC-77A-A
      2.    HPLC (RP-ES)	AMP XIII (p. 124)
      3.    GC  (FID-IS)	CIPAC-ID(p. 101)
      4.    Identification (GC/HPLC/IR/NMR/MS)	CIPAC-ID (p. 180)
      5.    GC (FID-ES/MB)	CAN; FEW.G
      6.    HPLC (NP-ES/chiral separation)	AMP XVI (p. 31)

Ferbam (458/14484-64-1/1100)

      1.    Carbon Disulfide Evol'n	AOAC-965.15 (p. 217)
      2.    UV	CIPAC-1 (p. 398)

-------
                                                                 F-3

Ferrous Ammonium Sulfate (459B/10045-89-3/1104)

      1.     Titrimetric	NEIC-459B-A

Ferrous Sulfate (460/7782-63-0/1105)

Ficam (see "Bendiocarb" 360B)

Flamprop-methyl(903E/52756-22-6/-)

Flammability

      1.     Flame  Projection	EPA-1 (2)
      2.     Closed Drum	EPA-2 (2)

Fluazifop-butyl(460C/69806-50-4/-)

      1.     GC  (FID-IS)	AOAC-984.08* (p. 192)
      2.     GC (FID-ES/MB)	CAN; FKA.G

Fluchloralin (460B/33245-39-5/1106)

      1.     GC(TCD-IS)	EPA-1(4)

Flucythrinate (2AA/70124-77-5/0

      1.     GC  (FID-IS)	NEIC-2AA-A

Fluenetil (462A/4301-50-2/1112)

Fluometuron (460A/2164-17-2/1107)

      1.     GC (FID-IS; TFA derivative)	AOAC-977.07 (p. 218)
      2.     IR	EPA-1
      3.     UV	EPA-2 (2)
      4.     Dimethylamine Distillation	AMP VII (p. 574)
      5.     Potentiometric Titration	NEIC-460A-A
      6.     HPLC(RP-IS)	AMP XIII (p. 241)

Fluor Chrom Arsenate Phenol

      1.    Total  Fluorine	AWPA-A2-71-8
      2.    Total Chromium	AWPA-A2-71-5
      3.    Total  Arsenic	AWPA-A2-71-2
      4.    Dinitrophenol Content	AWPA-A2-71-7
      5.    Pentachlorophenol Content	AWPA-A2-71-6

-------
                                                                 F-4

Fluoridamid (889B/47000-92-0/1108)

      1.    GC  (FID-IS)	AMPX(p. 535)
      2.    Titrimetric	NEIC-889B-A

Fluoride

      1.    Titrimetric (Travers)	AOAC-929.04 (p. 150)
      2.    Titrimetric (Mod. Travers)	AOAC-921.04 (p. 151)
      3    Distillation/Titration	AOAC-933.03 (p. 152)
      4.    Spec. Ion Electrode (Haz. substances)	AOAC-973.10 (p. 232)

Fluoroacetamide (461/640-19-7/1109)

Fluoroacetic Acid (462/144-9-0/1110) and Sodium Salt (770/62-74-8/1851)

      1.    HPLC (RP-ES; as ester)	JAOAC 67.1058 (1984)
      2.    HPLC (IC-ES; in livestock collars)	NEIC-462-A

Fluorodifen (462AA/15457-05-3/1111)

      1.    GC (TCD-ES)	NEIC-462AA-A

Fluoromidine (217AA/13577-71-4/504)

Flurecol butyl ester (130B/2314-09-2/302)

      1.    UV (as acid)	AMP XI (p. 321)
      2.    GC (FID-IS; as butyl ester)	AMP XI (p. 322)

Fluridone (130C/59756-60-4/1113.5)

      1.    HPLC(RP)	AMP XIII (p. 249)
      2.    GC  (FID-IS)	AMP XIII (p. 252)

Fluriprimidol (266D/56425-91-3/-)

Fluvalinate (934/69409-94-5/0

      1.    IR	NEIC-934-A
      2.    HPLC (RP-ES)	NEIC-934-B
      3    HPLC (RP-IS)	AMP XIII (p. 82)
      4.    HPLC (RP-IS)	CAN; FVL.L
      5.    HPLC (RP-IS)	NEIC-934-C
      6.    GC  (FID-IS/MB)	NEIC-934-D

Folcidin (see "Cypendazole" 560)

Folex (see "Merphos" 865)

-------
                                                               F-5
Folpet (464/133-07-3/1114)
      1.    HPLC (NP-IS)	AOAC-977.03 (p. 192)
      2.    IR	EPA-1
      3.    GC(FID-ES)	AMP VI (p. 546)
      4.    HPLC (RP-ES; with carbaryl, malathion and
              dicofol	NEIC-464-A
      5.    HPLC (NP-IS)	NEIC-464-B
      6.    HPLC(RP)	JAOAC 66. 789 (1983)
      7.    HPLC(NP-ES)	CAN; FOL.L

Fonofos (454B/944-22-9/1081)

      1.    IR	EPA-1 (3)
      2.    GC (FID-IS)	AMP VII (p. 270)

Formaldehyde (465/50-00-0/1115)

      1.    Oxidation/Titration	AOAC-898.01* (p. 226)
      2.    Cyanide Method (Dilute (Sol'ns)	AOAC-897.01 (p. 226)
      3.    Cyanide Method (See Disinfectants)	AOAC-931.03 (p. 226)

Formetanate (465A/22259-30-9/1116) &
      Formetanate Hydrochloride (465B/23422-53-9/1117)

      1.    Titrimetric	AMP VII (p. 281)
      2.    TLC	NEIC-465A-A

Formothion (366C/2540-82-1/884)

      1.    GC(FPD-IS)	AOAC-974.03 (p. 204)

Fosamine Ammonium (465G/25954-13-6/1117.5)

      1.    HPLC  (AX-IS)	NEIC-465G-A
      2.    HPLC(AX-ES)	NEIC-465G-B

Fospirate (465CC/5598-52-7/1118)

      1.    UV	NEIC-465CC-A

Fumaric Acid (465E/110-17-8/1119)

Fumarin (see "Coumafuryl" 5)

Fumigants

      1.    GC (TCD/FID-ES)	AOAC-966.05 (p. 164)
      2.    GC (FID)	NEIC-FUM-A

-------
                                                               F-6




Fumite (see "Tecnazene" 831)



Fundal (see "Chlordimeform" 174A)



Funginex (see "Triforine" 890AA)



Furadan (see "Carbofuran" 160A)



Furamethrin



      1.    GLC (Mosquito Coils)	NEIC-Fur-A



Furethrin (465F/17080-02-3/1121)

-------
                                                                G-l


Galban (471AC/71626-11-4/-)

Galecron (see "Chlordimeform" 174A)

Gamma BHC (see "BHC, Gamma Isomer" 527)

Gardona (see "Tetrachlorvinphos" 217A)

Genite 923 (322/97-16-5/780)

      1.    IR	NEIC-322-A

Gibberellic Acid (467/77-06-5/1123)

      1.    Fluorimetric	AMP V (p. 415)
      2.    UV	JAQA£fiO_, 859 (1977)
      3.    TLC (Gibberellins AjA?	AMP X (p. 548)

Glean (see "Chlorosulfuron" 194AA)

Glutaraldehyde (468/111-30-8/1125)

      1.    Titrimetric	NEIC-468-A
      2.    GC  (FID-IS)	NEIC-468-B

Glycerol (469/56-81-5/1126)

Glycolic Acid (470/79-14-1/1127)

Glycophene (470A/36734-19-7/782)

      1.    HPLC (NP-IS)	AMP XI (p. 250)
      2.    GC  (FID-IS)	AMP XI (p. 250)
      3.    GC  (TCD-IS)	NEIC-470A-A
      4.    GC  (FID-IS)	NEIC-470A-B
      5.    HPLC (RP-IS)	CAN;  IPO.L

Glyodin (471/556-22-9/1130)

      1.    Titrimetric	AMP  III (p. 100)

Glyphosate (661A/1071-83-6/1131)

      1.    HPLC(AX-ES)	AOAC-983.10* (p. 205)
      2.    HPLC (RP/NH2-ES)	NEIC-661A-A
      3.    UV	NEIC-661A-B
      4.    HPLC (RP/NH2-RI)	EPA-1 (4)
      5.    HPLC (AX-ES)	CAN; GLP.L
      6.    HPLC (AX-ES)	AMP XVI (p. 72)

-------
                                                                 G-2
Glyphosine (471A/2439-99-8/1133)
Goal (see "Oxyfluorfen" 1888AAA)
Gophacide (91A/4104-14-7/209)
      1.    HPLC  (RP-ES)	NEIC-91A-A
Gossyplure HF (471AAA/53042-79-8/1156)
Griseofulvin (471B/126-07-8/1134)
      1.    UV	AOAC-966.30 (p. 130)
Guthion (see "Azinphos Methyl" 374)

-------
                                                                H-l


Halazone (326/80-13-7/792)

      1.    Titrimetric	NEIC-326-A

HCB (see "Hexachlorobenzene" 477)

Heptachlor (474/76-44-8/1139)

      1.    Labile Chlorine	AOAC-962.07 (p. 193)
      2.    GC (FID-IS)	AOAC-968.04 (p. 193)
      3.    IR	EPA-1
      4.    IR	NEIC-474-A

Herban (see "Norea" 607)

Hexachlorobenzene (477/118-74-1/1149)

      1.    GC (FID-ES; in dacthal)	AOAC-970.05 (p. 186)

Hexachlorocyclopentadiene (478/77-47-4/1151)

      1.    UV (in tech. chlordane)	AOAC-966.06 (p. 183)

Hexachlorophene (566/70-30-4/1383)

      1.    UV	AOAC-974.28 (p. 363)
      2.    Total  Chlorine (see "Phenols and Chlorophenols/EPA-3")
      3.    GC (see "Phenols and  Chlorophenols/EPA-8-Tent.")
      4.    HPLC (RP-ES)	EPA-1 (3)
      5.    IR	NEIC-566-A
      6.    GC (ECD-ES; as methyl ester)	AMPX(p. 194)

Hexakis (481DD/13356-08-6/1165)

      1.    Titration	CIPAC-ID (p. 79)
      2.    IR	NEIC-481DD-A
      3.    BHTO impurity (TLC)	CIPAC-ID (p. 81)

Hexamethylene Tetramine (482/100-97-0/1169)

      1.    Distillation/Titration	NEIC-482-A

Hexazinone (271AA/51235-04-2/1172)

      1.    GC (FID-IS)	NEIC-271AA-A
      2.    HPLC (RP-IS)	EPA-1 (4)
      3.    GC (FID-IS)	EPA-2 (4)
      4.    GC (FID-ES)	CAN; HXO.G

-------
                                                                  H-2


Hinosan (see "Edifenphos" 434B)

Hormodin (see "Indole-3-butyric Acid" 499)

HPMTS (495A/29803-57-4/1210)

      1.    Titrimetric	NEIC-495A-A

Hydramethylnon (642AB/67485-29-4/1763)

Hydrochloric Acid (486/7647-01-0/1180)

      1.    Titrimetric	NEIC-486-A
      2.    Titrimetric	NEIC-486-B

Hydroprene (456H/41096-46-2/1182)

      1.    GC (FID-IS; with propetamphos)	NEIC-456H-A
      2.    GC  (FID-IS)	NEIC-456H-B

2-[(Hydroxymethyl)amino]ethanol(494C/34375-28-5/1204)

3-Hydroxy-5-methylisoxazole (-/10004-44-1/-)

      1.    GC  (FID-IS)	AMPX(p. 218)

2-(Hydroxymethyl)-2-nitro-l,2-propanediol (495/126-11-4/1207)

      1.    Colorimetric	NEIC-495-A

Hymexazol (see "3-Hydroxy-5-methylisoxazole")

Hyvar (see "Isocil" 504)

-------
                                                                   1-1


Igran (see "Terbutryn" 125D)

Imidan (see "Phosmet" 543)

Indalone (128/532-34-3/287)

Indole-3-butyric Acid (499/133-32-4/1219)

      1.     UV	EPA-1

Iodine (and Iodine Complexes) (501/7553-56-2/1222)

      1.     Potentiometric  Titration	NEIC-501-A

lodobenzanilide (501AB/15310-01-7/1223)

Iodofenphos(309B/18181-70-9/701)

loxynil (353A/1689-83-4/852)

      1.     GC (FID-ES; as methyl ester)	AMP V(p. 354/428)

IPC (see "Propham" 510)

Iprobenfos (-/26087-47-8A)

      1.     GC  (FID-IS)	CIPAC-ID(p. 112)
      2.     GC  (FID-IS)	CAN; IPR.G

Iprodione (see "Glycophene" 470A)

Irgasan DP 300 (186A/3380-34-5/411)

      1.     UV	NEIC-186 A-A
      2.     Total Chlorine	NEIC-186 A-B
      3.     HPLC (RP-IS)	NEIC-186 A-C

Isobenzan (609/297-78-9/1508)

      1.     IR	NEIC-609-A
      2.     IR	NEIC-609-B

Isotil (504/314-42-1/1232)

Isofenphos (447AB/25311-71-1/1391.3)

      1.     GC  (FID-IS)	AOAC-987.01* (p. 205)

-------
                                                                  1-2


Isolan (511D/119-38-0/1245)

      1.    Dimethylamine Distillation	AMP II (p. 258)

Isophorone (506/78-59-1/1235)

Isoprocarb (512B/2631-40-5/1250)

      1.    HPLC(NP-ES)	CIPAC-K) (p. 120)
      2.    2-Isopropyl phenol content (HPLC)	CIPAC-ID (p. 121)
      3.    HPLC(NP-ES)	CAN; ISO.L

Isopropalin (506A/33820-53-0/1236)

      1.    Colorimetric	AMP VIII (p. 371)
      2.    GC  (FID-IS)	AMP VIII (p. 373)

Isopropanol (507/67-63-0/1237)

      1.    GC  (FID-IS)	AOAC-973.69 (p. 498)
      2.    GC  (FID-IS)	AOAC-975.06 (p. 232)
      3.    GC(FID-ES)	NEIC-507-A

Isopropyl Carbanilate (see "Propham" 510)

Isoprothiolane

      1.    GC  (FID-IS)	AMPX(p. 231)

Isothioate

      1.    TLC/Total Phosphorus	AMP X (p.  76)
      2.    GC  (FID-IS)	AMP X (p.  76)

Isoxathion

      1.    GC  (FID-IS)	AMP X (p.  85)

-------
                                                                 K-l
Karathane (see "Dinocap" 391D)
Karbutilate (516A/4849-32-5/1261)
      1.    IR	EPA-1
      2.    HPLC (RP-IS; with simazine)	EPA-1 (4)
Kathon (see "2-n-Octyl-4-isothiozolinone" 613C)
Kelthane (see "Dicofol" 93)
Kepone (see "Chlordecone" 275)
Kerb (see "Pronamide" 306A)
Korlan (see "Ronnel" 724)
Krenite (see "Fosamine Ammonium" 456G)

-------
                                                                 L-l


Lamprecide (890/88-30-2/2081)

      1.     UV	EPA-K3)

Landrin (893A/2686-99-9/2093)

Lannate (see "Methomyl" 549C)

Lanstan (see "Chloro-2-nitropropane" 201A)

Larvadex (see "Cyromazine" 167B)

Lasso (see "Alachlor" 11)

Lead and Lead  Compounds

      1.     Gravimetric	AOAC-922.04 (p. 149)

Lead Arsenate (524/53404-12-9/1277)

      1.     Total  Arsenic	AOAC-920.17 (p. 154)
      2.     Total Arsenious Oxide	AOAC-920.18 (p. 154)
      3.     Total  Arsenic Oxide	AOAC-920.19 (p. 154)
      4.     Total Lead	AOAC-920.21 (p. 154)

Lenacil (525A/2164-08-1/1279)

      1.     TLC	NEIC-525A-A

Leptophos (525B/21609-90-5/1280)

      1.     GC (FID-IS)	NEIC-525B-A
      2.     IR	NEIC-525B-B

Lethane 60 (85/301-11-1/1972)

Lethane 384 (84/112-56-1/277)

      1.     IR	NEIC-84-A
      2.     GC (FID-IS; with malathion)	NEIC-84-B

Lime Sulfur (see "Calcium Polysulfide" 150)

Limonene (526/138-86-3/1281)

Lindane (see "BHC, Gamma Isomer" 527)

-------
                                                                L-2


Linuron (528/330-55-2/1284)

      1.    HPLC (NP-ES)

Linuron (528/330-55-2/1284)

      1.    HPLC (NP-ES)	EPA-1
      2.    IR	EPA-2
      3.    UV	EPA-3(1)
      4.    Hydrolysis/Distillation	AMP V (p. 434)
      5.    IR	CIPAC-1 (p. 730)
      6.    HPLC  (RP-ES)	CAN; LIU.L
      7.    Tetrachloroazobenzene content (GO	JAOAC13, 749 (1990)

Lithium Hypochlorite (528A/13840-33-0/1285)

      1.    Titrimetric	NEIC-528A-A

Lorsban (see "Chlorpyrifos" 219AA)

Lovozal (see "Fenazaflor" 654A)

-------
                                                               M-l


Maintain CF 125 (see "Dichlorflurenol, methyl ester" 557B)

Malathion (535/121-75-5/1299)

      1.    GC  (FID-IS)	AOAC-979.05 (p. 206)
      2.    HPLC (RP-ES)	EPA-1
      3.    IR	EPA-2
      4.    HPLC (RP-IS)	EPA-3 (3)
      5.    GC  (FID-IS)	AMP VI (p. 418)
      6.    HPLC (with carbaryl and dicofol	NEIC-535-A
      7.    Total Phosphorus (see "Phosphorus Compounds/EPA-1")
      8.    GC (FID-ES/MB)	CAN; MAL.G
      9.    HPLC (RP-ES)	CAN; MAL.L

Maleic Hydrazide (see "MH" 352)

Maloran (see  "Chlorbromuron" 173A)

Maneb (539/12427-38-2/1302)

      1.    Carbon  Disulfide Evolution	AOAC-965.15 (p. 217)

Matacil (see "Aminocarb" 360)

Mavrik (see "Fluvalinate" 934)

MCPA (557C/94-74-6/1347)

      1.    HPLC (RP-IS)	AOAC-980.07 (p. 194)
      2.    Titrimetric	AMP V (p. 412)
      3.    GC (FID-IS; as TMS ester)	AMP VI (p. 663/630)
      4.    IR	CIPAC-1 (p. 482)
      5.    HPLC (see  "Chlorophenoxy Herbicides/EPA-3-Tent.)
      6.    HPLC (RP-IS)	CIPAC-IC (p. 2139)
      7.    GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      8.    GC (FID-IS; with TEA as methyl esters)	
           	CIPAC-IC (p. 2148)
      9.    Characterization (IR/GC/TLC)	CIPAC-IC (p. 2137)
      10.   Reference Std. (Purification and purity)	CIPAC-IC (p. 2309)
      11.   Phenolic impurities (HPLC/Electro
              Chemical Detector)	JAQAC 71. 325(1988)

MCPA Esters

      1.    Hydrolysis/Titration	CIPAC-IC (p. 2144)

-------
                                                                M-2
MCPB (558/94-81-5/1362)
      1.     GC (FID-ES; as methyl ester)	AMP VIII (p. 403)
      2.     HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.)
      3.     GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      4.     Characterization (IR/GC/TLC)	CIPAC-IC (p. 2153)
      5.     Reference Std. (Purification and purity)	CIPAC-IC (p. 2316)

MCPP (see "Mecoprop" 559)

Mecarbam (340/2595-54-2/821)

      1.     GC  (FID-IS)	AMP VIII (p. 136)

Mecoprop (559/7085-19-0/1364)

      1.     HPLC (RP-IS; with 2,4-D and  dicamba)...AOAC-984.07* (p. 188)
      2.     HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.")
      3.     GC (FID-IS; as methyl ester)	CIPAC-IC (p. 2257)
      4.     Characterization (IR/GC)	CIPAC-IA (p. 1298)
      5.     Reference Std. (Purification and purity)	CIPAC-IA (p. 2319)
      6.     HPLC (RP-IS)	CIPAC-IC (p. 2158)

Mefiuidide (333AA/53780-36-2/3106)

      1.     GC (FID-IS; as methyl ester)	NEIC-333AA-A

Menazon (285A/78-57-9/652)

      1.     Colorimetric	AMP VII (p. 320)

Mephosfolan (268H/950-10-7/595)

      1.     UV	AMP VII (p 233)
      2.     GC  (FID-IS)	AMP VII (p. 236)

Merbac 35 (see "Benzyl Bromoacetate" 82A)

Mercaptobenzothiazole (541/149-30-4/1308) and
   Sodium Salt (541C/2492-26-4/1311)

      1.     UV	EPA-l(l)
      2.     Potentiometric Titration	EPA-2 (1)
      3.     HPLC (RP-ES)	NEIC-541-A
      4.     HPLC (RP-ES; in coolants)	NEIC-541-B

Mercaptophos (see "Fenthion" 456F)

-------
                                                                M-3


Mercurial Seed Disinfectants
      1.    Gravimetric (as mercuric sulfide)	AOAC-930.14 (p. 162)
      2.    Titrimetric	AOAC-971.04 (p. 162)
      3.    Gravimetric (1,3-Propanediamine prec'n)...AOAC-973.11 (p. 163)

Mercury (546/7439-97-6/1316) and Mercury Compounds

      1.    Titrimetric (Thiocyanate)	NEIC-546-A
      2.    Titrimetric  (Dithizone)	NEIC-546-B
      3.    AA  (in paints)	NEIC-546-C

Merphos (865/150-50-5/1992)

      1.    GC  (FID-IS)	EPA-1 (4)
      2.    IR	NEIC-865-A

Mesityl Oxide (547/141-79-7/1321)

Mestranol (547A/72-33-3/1322)

      1.    Colorimetric	NEIC-547A-A

Mesurol (see "Methiocarb" 578B)

Metalaxyl (375AA/57837-19-1/899.5)

      1.    GC  (FID-IS)	EPA-1 (4)

Metaldehyde (548/108-62-3/1323)

      1.    Titrimetric	EPA-1
      2.    GC(TCD-IS)	EPA-2
      3.    IR	EPA-3
      4.    GC(TCD)	EPA-4

Metamitron (-/41394-05-2/-)

      1.    HPLC (RP-ES)	CIPAC-ID(p. 125)

Metam-Sodium (780/6734-80-1/1865)

      1.    Carbon Disulfide Evolution	AMP III (p. 180)
      2.    Colorimetric	AMP III (p. 180)
      3.    TLC (Qualitative)	CIPAC-1B (p. 1863)

Meta-Systox (see  "Demeton-methyl" 456)

Meta-Systox R (see "Oxydemeton-methyl" 455)

-------
                                                              M-4


Methabenzthiazuron (8 IB/18691-97-9/185)

Methalpropalin (548A/ - /1324.5)

Methamidophos(378A/10265-92-6/1325)

      1.    GC (TCD-ES)	AMP VII (p. 341)
      2.    IR	NEIC-378A-A

Methanol (552/67-56-1/1338)

      1.    GC (FID-ES)	AOAC-971.03 (p. 233)
      2.    GC (FID-IS)	AOAC-975.06 (p. 232)

Methazole (549AA/20354-26-1/3326)

      1.    IR	AOAC-982.03 (p. 194)
      2.    IR	EPA-K3)

Methidathion (378B/950-37-8/1327)

      1.    GC (FID-IS)	EPA-1
      2.    GC (FID-IS)	EPA-2 (3)
      3.    GC (FID-IS)	AMP VIII (p. 147)

Methiocarb (578B/2032-65-7/1436)

      1.    HPLC(RP-IS)	AOAC-984.10*(p.218)
      2.    IR	EPA-1
      3.    HPLC(RP-IS)	JAQAC £2, 5(1979)
      4.    GC (TCD-IS; as trifluoroacetyl der.)	NEIC-578B-A

Methomyl (549C/16752-77-5/1328)

      1.    HPLC (NP-IS)	AMP VII (p. 333)
      2.    HPLC  (RP-ES)	EPA-1 (2)
      3.    HPLC(RP-IS)	NEIC-549C-A
      4.    IR	NEIC-549C-B
      5.    HPLC(RP-IS)	NEIC-549C-C
      6.    HPLC  (RP-ES)	CAN; MER.L

Methoprene (28AAA/40596-69-8/1329)

      1.    GC (FID-IS)	EPA-1 (3)
      2.    GC (FID-IS)	AMPX(p. 96)
      3.    GC (FID-IS)	NEIC-28AAA-A
      4.    GC (FID-ES; on treated grain)	NEIC-28AAA-B
      5.    IR (Encapsulated)	JAOAC 63.879 (1980)
      6.    GC (FID-IS; with propetamphos)	NEIC-28AAA-C

-------
                                                               M-5


Methoprotryne (509A/841-06-5/1239)
      1.    Titrimetric	CIPAC-1A (p. 1302)
      2.    GC (FID-IS)	CIPAC-lB(p. 1864)

Methoxychlor (550/72-43-5/3133)

      1.    IR	EPA-1
      2.    GC (FID-IS)	EPA-2
      3.    HPLG	EPA-3 (2)
      4.    GC (FID-ES; with captan and malathion)	NEIC-550-A
      5.    IR	CIPAC-1 (p. 730)
      6.    Characterization (GC/MS)	JAOAC 63.1007 (1980)
      7.    IR	NEIC-550-B
      8.    GC (FID-IS)	NEIC-550-C
      9.    Characterization (HPLC)	JAOAC 65.1457(1982)
      10.   GC (FID-ES/MB)	CAN; MEY.G

Methyl Bromide (555/74-83-9/1341)

      1.    GC (FID-ES; with chloropicrin)	NEIC-555-A

Methylenebis (thiocyanate) (565/6317-18-6/1382)

      1.    GC (FID-ES)	NEIC-565-A
      2.    Hydrolysis/Titration	NEIC-565-B
      3.    IR	NEIC-565-C
      4.    HPLC(RP-IS)	NEIC-565-D
      5.    HPLC  (RP-ES)	NEIC-565-E

Methylene Chloride (568/75-89-2/1387)

Methyl Isothiocyanate (573/556-61-6/3198)

      1.    Potentiometric Titration	AMPX(p. 565)
      2.    GC (FID-IS)	AMPX(p. 566)

Methyl Nonyl Ketone (5730/112-12-9/1418)

      1.    GC (FID-IS)	EPA-1 (3)
      2.    Titrimetric	NEIC-5730-A
      3.    HPLC  (RP-ES)	JAOAC 73. 743 (1990)

Methyl Parathion (372/298-00-0/896)

      1.    GC (FID-IS)	AOAC-977.04 (p. 208)
      2.    HPLC (NP-IS)	AOAC-977.05 (p. 209)
      3.    GC (FID-IS; microencapsulated)	AOAC-980.11 (p. 209)
      4.    HPLC  (RP-ES)	EPA-1

-------
                                                              M-6
Methyl Parathion (372/298-00-0/896) (cont.)
      5.    IR	EPA-2
      6.    Colorimetric	EPA-3
      7.    GC (FID-IS	EPA-5
      8.    HPLC  (RP-ES)	EPA-6(3)
      9.    Electrometric Titration	NEIC-372-A
      10.   GC (FID-IS; with parathion)	NEIC-372-B

Methyl Salicylate (577/119-36-8/1430)

      1.    HPLC  (RP-ES)	NEIC-577-A
      2.    GC(FID-ES)	NEIC-577-B

Methyl Trithion (212/953-17-3/484)

      1.    IR	NEIC-212-A
      2.    GC (FID-IS)	AMP II (p. 315)
      3.    UV	AMP II (p. 315)

Metobromuron (579A/3060-89-7/1439)

      1.    IR	EPA-1
      2.    GC (FID-ES)	EPA-2
      3.    GC (FID-IS)	EPA-3
      4.    UV	AMP VII (p. 574)

Metolachlor (188DD/51218-45-2/4140)

      1.    GC (FID-IS)	AOAC-985.06* (p. 195)
      2.    GC (FID-IS; with atrazine) [see "Atrazine EPA-1(4)"]
      3.    GC (FID-IS)	NEIC-188DD-A
      4.    HPLC  (RP-ES)	NEIC-188DD-B
      5.    GC (FID-ES)	CAN; MHR.G
      6.    GC (FID-ES; in  fertilizers)	CAN; EPT.G

Metoxuron (194B/19937-59-8/436)

      1.    Dimethylamine Distillation and TLC	AOAC-977.06 (p. 216)
      2.    HPLC/TLC	NEIC-194B-A
      3.    By-product (TLC)	CIPAC-lA(p. 1306)

Metribuzin (33D/21087-64-9/100)

      1.    GC (FID-IS)	AOAC-984.11* (p. 219)
      2.    GC, IR and HPLC	sIAQAG52,278(1976)
      3.    GC (FID-IS)	NEIC-33D-A
      4.    GC(TCD-IS)	NEIC-33D-B
      5.    HPLC  (RP-ES)	CAN; MGZ.L

-------
                                                               M-7


Metsulfuron Methyl (419H/74223-64-6/-)

      1.    HPLC(RP-IS)	AMP XVI (p. 85)
      2.    HPLC (NP-IS)	AMP XVI (p. 87)

Mevinphos (160B/7786-34-7/356)

      1.    GC (FID-ES)	AMP VI (p. 450)
      2.    IR	AMP II (p. 360)
      3.    Hydrolysis/Titration	AMP II (p. 356)
      4.    GC (FID-ES; separates isomers)	NEIC-160B-A

Mexacarbate (579B/315-18-4/1441)

      1.    GC (TCD-IS)	EPA-1 (2)
      2.    GC  (FID-IS)	NEIC-579B-A
      3.    IR	NEIC-579B-B

MGKR-11 (89/126-15-8/206)

      1.    Titrimetric	NEIC-89-A
      2.    GC  (FID-IS)	NEIC-89-B

MGK-264 (613/113-48-4/1512)

      1.    GC  (FID-IS)	AOAC-980.04* (p. 172)
      2.    GC (see "Pyrethrins/EPA-2")
      3.    GC  (FID-IS)	JAOAC 58. 845 (1975)
      4.    GC(FID)	NEIC-613-A
      5.    GC (Pet shampoos) [see "Pyrethrins/EPA-1 (4)"]	
      6.    GC (FID-IS; with allethrin and MGK-264). CAN;  ALL/PFL/OCT.G
      7.    GC (FID-ES/CAP; with PBO and pyrethrins)	CAN; OCT.G
      8.    GC (FID-IS/MB; with PBO and pyrethrins in pet shampoos)....
           	CAN; OCT.G/OCT.L  (2)

MGK-326 (400/136^5-8/954)

      1.    UV	NEIC-400-A
      2.    GC  (FID-IS)	NEIC-400-B

MGK R-874 (489B/3547-33-9/1194)

MH (352/123-33-1/847)

      1.    UV	EPA-1
      2.    Titrimetric	AMP IV (p. 149)
      3.    HPLC (RP-ES)	NEIC-352-A
      4.    UV	CAN; MHY

-------
                                                                M-8
Mineral Oils (580/ - /1443)
      1.    Unsulfonated Residue	AOAC-927.01 (p. 161)
      2.    Gravimetric	JAOAC 56. 14(1973)
      3.    Gravimetric	CIPAC-1A (p.  1320)

Mineral Oil - Soap Emulsions

      1.    Water	AOAC-926.02A (p. 162)
      2.    Total-Oil	AOAC-926.02B (p. 162)
      3.    Soap	AOAC-926.02C (p. 162)
      4.    Unsulfonated Residue	AOAC-926.02D (p. 162)
      5.    Ash	AOAC-926.02E (p. 162)

Mirex (411/2385-85-5/976)

      1.    GC (EC-IS)	NEIC-411-A

Mitox (see "Chlorbenside" 173)

Mobam (see "Benzothienyl Methylcarbamate" 8 ID)

Moisture (in  Inorganic Arsenicals)	AOAC-920.12 (p. 147)

Mocap (see "Ethoprop" 434C)

Modown (see "Bifenox" 561AA)

Molinate (444/2212-67-1/1063)

      1.    GC (FID-IS)	AOAC-974.05 (p. 221)

Monitor (see "Methamidophos" 378A)

Monocrotophos (377/6923-22-4/901)

      1.    IR	EPA-1
      2.    GC (FID-IS)	EPA-2
      3.    GC (FID-IS)	EPA-3 (1)
      4.    GC (FID-ES)	AMP VI (p. 287)
      5.    IR	AMPV(p. 194)

Monolinuron (207D/1746-81-2/467)

Monuron (583/150-68-5/1450)

      1.    Dimethylamine Distillation	EPA-1
      2.    UV	EPA-2
      3.    IR	EPA-3

-------
                                                                M-9
Monuron (583/150-68-5/1450) (cont.)
      4.    HPLC (RP-ES)	NEIC-583-A
      5.    IR	CIPAC-1 (p. 730)
      6.    HPLC (NP-IS)	AMP XII (p. 162)

Monuron Trichloroacetate (583A/140-41-0/1451)

Morestan (see "Oxythioquinox" 576)

MSMA (582/2163-80-6/1448)

      1.    Titrimetric (see "Arsenic Compounds/EPA-3-Tent. & EPA-4")
      2.    1C (Conductivity detector)	JAOAC 72. 994 (1989)

Murfotox (see "Mecarbam" 340)

Muscalure [see "(z)-9-Tricosene" 883C

Mylone (see "Dazomet" 840)

-------
                                                                N-l


Nabam (585/142-59-6/1456)

      1.    Carbon Disulfide Evolution	AOAC-965.15 (p. 217)

Naled (586/300-76-5/1457)

      1.    GC (TCD-ES)	AMP VI (p. 350)
      2.    IR	NEIC-586-A
      3.    GC  (FID-IS)	JAOAC 58. 1162(1975)
      4.    GC (with captan and carbaryl)	NEIC-586-B
      5.    GC (FID-ES/MB; in pet collars with
              propoxur)	CAN; NAD.G/PPO.G

Naphthalene (587/91-20-3/1458)

      1.    Sublimation	NEIC-587-A
      2.    GC  (FID-IS)	NEIC-587-B

1-Naphthaleneacetamide (588/86-86-2/1459)

1-Naphthaleneacetic Acid (589/86-87-3/1460)

      1.    HPLC (RP-ES)	EPA-1 (3)
      2.    Titrimetric	AMP V (p. 457)
      3.    IR	NEIC-589-A
      4.    HPLC (RP-ES)	CAN; NAP.L

1,8-Naphthalic Anhydride (see "Protect")

2-Naphthol (590/135-19-3/1467)

      1.    Colorimetric	AOAC-950.70 (p. 1126)

2-Naphthoxyacetic Acid (590B/120-23-0/1468)

      1.    UV (Aqueous Sol'ns)	NEIC-590B-A
      2.    UV (Alcohol Sol'ns)	NEIC-590B-B

Napropamide (590A/15299-99-7/827)

      1.    GC  (FID-IS)	AMP VIII (p. 349)
      2.    GC  (FID-IS/MB)	CAN; NBE.G

Naptalam (592/132-66-1/1470)

      1.    UV	EPA-1 (3)
      2.    Gravimetric (with DNSBP)	NEIC-592-A
      3.    Titrimetric	NEIC-592-B
      4.    HPLC (RP-IS; with DNSBP)	NEIC-592-C

-------
                                                                 N-2
Naptalam (592/132-66-1/1470) (cont.)
      5.     HPLC (RP-ES; with DNSBP)	NEIC-592-D
      6.     HPLC  (RP-ES)	CAN; NBL.L

Neburon (594/555-37-3/4173)

      1.     IR	EPA-1
      2.     UV	EPA-2(3)
      3.     Hydrolysis/Distillation	AMP IV (p. 159)

Neguvon (see "Trichlorofon" 385)

Nellite (see "Diamidofos" 654B)

Nemacur (453A/22224-92-6/1079)

      1.     GC(TCD-IS)	NEIC-453A-A

Nemagon (see "l,2-Dibromo-3-chloropropane" 287)

Neopynamin (see "Tetramethrin" 844)

Neotran (91/555-89-5/208)

Niclosamide (see "Clonitralid" 314)

Nicotine (597/54-11-5/1479) and Nicotine Sulfate (597A/65-30-5/1480)

      1.     Gravimetric	AOAC-920.35 (p. 173)
      2.     HPLC (RP)	EPA-1 (3)
      3.     UV	NEIC-597-A
      4.     HPLC  (RP-ES)	NEIC-597-B
      5.     HPLC(RP-IS)	NEIC-597-C

Nitralin (578/4726-14-1/1433)

      1.     IR	AMP VII (p. 628)
      2.     GC (FID-ES)	AMP VII (p. 630)
      3.     IR	NEIC-578-A

Nitrapyrin (217/1929-82-4/1482)

      1.     GC(TCD-IS)	NEIC-217-A

Nitrofen (323D/1836-75-5/786)

      1.     GC (FID-IS)	AMPX(p.405)

-------
                                                               N-3


Nitrophenols

      1.    Stannous Chloride Reduction	EPA-1
      2.    Total Nitrogen	EPA-2

Nitroso Compounds

      1.    Description and Analysis (GO	AMP XI (p. 363)
      2.    In Dimethyldithiocarbamates (GC)	JAOAC 22, 663 (1989)
      3.    In 2,4-D and MCPA (GC)	JAOAC 72. 508 (1989)
      4.    In dinoseb (GC)	JAOAC 70. 792 (1987)

Norbormide (606/991-42-4/1502)

      1.    UV	EPA-1

Norea (607/18530-56-8/1503)

      1.    IR	NEIC-607-A

Norflurazon (195AA/27314-13-2/1504)

      1.    GC (FID-IS)	AMPX(p. 417)
      2.    TLC/UV	AMP X (p. 419)

Nortron (see "Ethofumesate" 427BB)

Nuarimol (419G/63284-71-9/1505)

      1.    GC(FID-ES)	AMP XIII (p. 185)

-------
                                                                 0-1
OCS-21693 (578A/ - /1434)

      1.     IR	NEIC-578A-A

Octhilinone (613C/26530-20-1/1510.5)

      1.     GC  (FID-IS)	NEIC-613C-A

Oil of Citronella (618/8000-29-1/1526)

Oil of Lemongrass (618DA/ - /1530)

      1.     GC(TCD-ES)	EPA-1

Omite (see "Propargite" 1301)

Ordram (see "Molinate" 444)

Organophosphates

      1.     TLC with carbamates (cross-contamination)	NEIC-TLC-A
      2.     GC (FID-IS/MS;  screening)	CAN; OP1.G/OP2.G

Organotin Compounds

      1.     Titrimetric	EPA-1

Ornitrol (286A/1249-84-9/655)

      1.     Total Chlorine	NEIC-286A-A

Orthene (see "Acephate" 2A)

Oryzalin (623A/19044-88-3/1539)

      1.     Colorimetric	AMP VIII (p. 435)
      2.     Colorimetric	EPA-1 (2)
      3.     HPLC (RP-IS)	AMP XII (p. 208)

OUST (see "Sulfometuron Methyl" 56ID)

Outfox (see "Cyprazine" 27 ID)

Ovex (624/80-33-1/1540)

      1.     IR	 EPA-1
     2.     Hydrolysis/Titration	CIPAC-1 (p. 214)
     3.     IR	CIPAC-1 (p. 730)

-------
                                                                O-2


Oxadiazon (624A/19666-30-9/1541)

      1.    GC (TCD-IS)	AMP VII (p. 597)

Oxalic Acid (625/144-62-7/1542)

      1.    Titrimetric	NEIC-625-A

Oxamyl (561A/23135-22-0/1543)

      1.    HPLC(NP-IS)	AMPX(p. 113)
      2.    HPLC (RP-IS)	EPA-1 (4)

Oxycarboxin (627A/5259-88-1/1549)

      1.    IR	NEIC-627A-A
      2.    HPLC  (RP-ES)	NEIC-627A-B

Oxydemeton-methyl (455/301-12-2/1084)

      1.    GC (FID-IS)	JAQAC 61. 500 (1978)
      2.    Hydrolysis/Titration	AMP II (p. 300)
      3.    Redox Titration	AMP II (p. 300)
      4.    IR	NEIC-455-A
      5.    TLC/total Phosphorus	CIPAC-1B (p. 1872)
      6.    GC (FID/ES/MB; after oxidation)	CAN; OXM.G
      7.    HPLC (RP-IS)	JAQAQ13,431(1990)

Oxyfluorfen (188AAA/42874-03-3/1551)

      1.    GC (FID-IS)	AMP XI (p. 332)

Oxythioquinox (576/2439-01-2/1428)

      1.    HPLC (RP-IS)	AOAC-986.08 (p. 226)
      2.    UV	AMP V (p. 279)
      3.    HPLC  (RP-ES)	CIPAC-IC (p. 2021)
      4.    IR	CIPAC-IC (p. 2022)

-------
                                                                p-1


Paarlan (see "Isopropalin" 506A)

Padan (see "Cartap" 360C)

Panogen (268) (see "Mercury")

Paradichlorobenzene (see "p-Dichlorobenzene" 632)

Paraformaldehyde (see "Formaldehyde" 633)

Paraquat Bichloride (634/1910-42-5/1555) and
   bis(Methylsulfate) (635/2074-50-2/1556)

      1.    Colorimetric	AOAC-969.09 (p. 227)
      2.    HPLC (RP-ES)	EPA-1 (3)
      3.    HPLC (CX-ES)	AMP XII (p. 211)
      4.    HPLC (RP-ES)	NEIC-634-A
      5.    GC (NPD-ES; reduction with NaBH4))	CAN; PAQ.G

Parathion (637/56-38-2/1558)

      1.    GC (FID-IS)	AOAC-978.06 (p. 207)
      2.    HPLC(NP-IS)	AOAC-978.07 (p. 208)
      3.    Titrimetric	AOAC-978.08 (p. 207)
      4.    Colorimetric	AOAC-978.09 (p. 207)
      5.    GC (Encapsulated)	AOAC-978.11 (p. 209)
      6.    HPLC (RP-ES)	EPA-1
      7.    GC (FID-IS)	EPA-2
      8.    GC (FID-IS)	EPA-3 (2)
      9.    HPLC (RP-IS)	EPA-4 (2)
      10.   IR	NEIC-637-A
      11.   GC (FID-ES; use-dilutions)	NEIC-637-B
      12.   GC (FID-ES/MB)	CAN; PAR.G

Parinol (637A/17781-31-6/1559)

      1.    GC (FID-IS)	NEIC-637A-A

Paris Green (229A/12002-03-8/529)

      1.    Total Arsenic	AOAC-920.13 (p. 153)
      2.    Total  Arsenious Oxide	AOAC-920.14 (p. 153)
      3.    Total Copper (Electrolytic)	AOAC-920.15A(p. 154)
      4.    Total  Copper (Titrimetric)	AOAC-920.15B (p. 154)

Parnon (see "Parinol"  637A)

Patoran (see "Metobromuron"  579A)

-------
                                                                P-2


Pay-off (see "Flucythrinate" 2AA)

PBO (see "Piperonyl Butoxide" 670)

PCNB (see "Pentachloronitrobenzene" 640)

PGP (see "Pentachlorophenol" 641)

Pebulate (710/1114-71-2/1746)

      1.    GC  (FID-IS)	AOAC-974.05 (p. 221)
      2.    GC(TCD-ES)	EPA-1
      3.    GC  (FID-IS)	EPA-2
      4.    GC  (FID-IS)	EPA-3

Pendimethalin (454BB/40487-42-1/1559.5)

      1.    GC (TCD-IS)	EPA-1 (3)
      2.    GC  (FID-IS)	AMPX(p. 463)

Pentac (274/2227-17-0/620)

      1.    GC (TCD-IS)	NEIC-274-A
      2.    HPLC (RP-IS)	NEIC-274-B

Pentachloronitrobenzene (640/82-68-8/1563)

      1.    GC  (FID-IS)	AOAC-982.04* (p. 195)
      2.    IR	AMP III (p. 129)
      3.    GC  (FID-IS)	AMP VI (p. 577)
      4.    GC (FID-IS; in fertilizer mixtures)	JAQAC 55. 657 (1972)
      5.    Colorimetric	NEIC-640-A

Pentachlorophenol (641/87-86-5/1564) and Sodium Salt (784/131-52-2/1566)

      1.    HPLC (see "Phenols and Chlorophenols/EPA-5-Tent.")
      2.    GC (FID-ES; as  methyl ester)	NEIC-641-A
      3.    HPLC (with bromacil in oil sprays)	NEIC-641-B
      4.    GC (FID-IS,  TMS derivative)	EPA-1 (3)
      5.    HPLC (RP-IS)	EPA-2 (3)
      6.    UV	AMP V (p. 314)
      7.    IR	CIPAC-1 (p. 730)
      8.    Total Chlorine (see "Phenols  and Chlorophenols/EPA-3")
      9.    Total Acidity	AWPA; A5-74-1
      10.   Colorimetric	AWPA; A5-74-6
      11.   GC and TLC (in paints)	JAOAC 58.19(1975)
      12.   HPLC  (RP-ES)	JAOAC 62. 1004(1979

-------
                                                                P-3


Perfluidone (539C/37924-13-3/1575)

      1.    GC  (FID-IS)	AMPXCp. 437)

Permethrin (652BB/52645-53-1/1575.5)

      1.    GC  (FID-IS)	AOAC-986.03* (p. 167)
      2.    GC (FID-ES; aqueous formulations)	JAOAC 60. 9 (1977)
      3.    GC  (FID-IS)	NEIC-652BB-A
      4.    GC  (FID-IS)	NEIC-652BB-B
      5.    GC  (FID-IS)	AMP XIII (p. 106)
      6.    Identification (GC/HPLC/IR/NMR/MS)	CIPAC-ID (p. 180)
      7.    GC (FID-IS; with allethrin/MGK-264)	CAN: ALL/PFL/OCT.G

Perthane (337/72-56-0/220)

      1.    IR	NEIC-337-A

Petroleum Oils (817A/ - /1583)

      1.    Gravimetric  (Neutral Oil Content)	CIPAC-1 (p. 583)

Phaltan (see "Folpet" 464)

Phenkapton (335B/2275-14-1/816)

Phenmedipham (648B/13684-63-4/1588)

      1.    TLC	AMP VII (p. 615)
      2.    Hydrolysis/Titration	NEIC-648B-A
      3.    Redox Titration	NEIC-648B-B
      4.    Titrimetric	CIPAC-IC (p.  2181)
      5.    HPLC (RP-IS)	CIPAC-IC (p.  2184)

Phenol (649/108-95-2/1589)

Phenols and Chlorophenols

      1.    Definition, Structure, and Tech. Data	EPA-1
      2.    UV (o-Phenylphenol	EPA-2
      3.    Total Chlorine (Lime fusion)	!	EPA-3
      4.    Bromination/Titration (o-phenylphenol	EPA-4
      5.    HPLC  (Pentachlorophenol)	EPA-5
      6.    GC (FID-ES)	EPA-6
      7.    GC (FID/TCD; 4-chloro-3,5-xylenol)	EPA-7
      8.    GC (TCD-IS/TMS Der.)	...EPA-8
      9.    HPLC  (RP-ES)	NEIC-Phenols-A

-------
                                                               P-4
Phenothizine (652/92-84-2/1591)
      1.    Colorimetric	AOAC-967.37 (p. 106)
      2.    GC (FID-IS)	AOAC-968.47 (p. 574)
      3.    IR	EPA-1-Tent.
      4.    HPLC  (RP-ES)	JAOAC 59. 693 (1976)
      5.    GC (FID-IS)	NEIC-652-A
      6.    GC (FID-IS; in feeds)	NEIC-652-B
      7.    GC (FID-IS)	NEIC-652-C

Phenothrin (652B/26002-80-2/1595)

      1.    GC (FID-IS)	NEIC-652B-A
      2.    GC (FID-IS)	AMP XIII (p. 134)
      3.    GC [see "Tetramethrin/EPA-l(4)"]
      4.    HPLC(RP-IS)	NEIC-652B-B
      5.    GC (FID-ES; separates isomers)	JAQAC 68. 911 (1985)

Phenoxy Herbicides (see "Chlorophenoxy Herbicides")

Phenthoate (427B/2597-03-7/1040)

      1.    GC (TCD-IS)	AMP VIII (p. 161)
      2.    TLC	AMP VIII (p. 164)
      3.    GC (FID-IS)	NEIC-427B-A

Phenylmercuric Acetate (656/62-38-4/1606)

o-Phenylphenol (623AA/90-43-7/1631) and
   Sodium Salt (787/132-27-4/1636)

      1.    UV (see "Phenols and Chlorophenols/EPA-2")
      2.    Bromination/Titr'n (see "Phenols and Chlorophenols/EPA-4")
      3.    GC (see "Phenols and  Chlorophenols/EPA-6 and EPA-8-Tent.")
      4.    HPLC  (RP-ES)	NEIC-623AA-A

Phorate (660/298-02-2/1639)

      1.    IR	AOAC-964.05 (p. 210)
      2.    IR	EPA-1
      3.    GC (FID-IS)	AMP VI (p. 493)
      4.    GC (FID-IS)	NEIC-660-A

Phosalone (660A/2310-17-0/1640)
      1.    GC (TCD-IS)	AMP VII (p. 387)
      2.    GC (FID-IS)	CIPAC-ID(p. 142)
      3.    HPLC (NP-ES; with captan)	CAN; PHE.L/CAP.L
      4.    GC (FID-ES/MB)	CAN; PHE.G

-------
                                                                 P-5


Phosdrin (see "Mevinphos" 160B)

Phosfolan (268B/947-02-4/594)

      1.     UV	AMP VII (p. 419)
      2.     GC  (FID-IS)	AMP VII (p. 236)

Phosmet (543/732-11-6/1312)

      1.     IR	AMP V (p. 261)
      2.     GC  (FID-IS)	AMP VI (p. 408)
      3.     IR, GC and  Colorimetric	JAQAC 52,1017 (1969)
      4.     HPLC(NP-ES)	CAN;  PHI.L

Phosnichlor (see "Dicapthon" 296)

Phosphamidon (661/13171-21-6/1641)

      1.     Titrimetric	AMP II (p. 377)
      2.     GC  (FID-IS)	NEIC-661-A
      3.     IR	NEIC-661-B

Phosphoric Acid (662/7664-38-2/1642)

      1.     Potentiometric Titration (also with HC1)	NEIC-662-A

Phosphorus (Total)

      1.     Gravimetric	EPA-1

Phosphorus Paste (663/7723-14-0/1644)

      1.     Gravimetric (see "Phosphorus/EPA-1")

Phostoxin (see "Aluminum Phosphide" 31)

Phosvel (see "Leptophos" 525B)

Phoxim (902IV14186-18-3/1603)

      1.     HPLC (NP-ES)	CIPAC-IC (p. 2188)

Phthalthrin (see "Tetramethrin" 844)

Phygon (see "Dichlone" 298)

-------
                                                                 P-6
Picloram (39/1918-02-1/1645)
      1.    HPLC (RP-IS; with 2,4-D)	AOAC-976.03 (p. 196)
      2.    HPLC (RP-ES)	EPA-1
      3.    IR	AMP V (p. 512)
      4.    GC (FID-ES; as methyl ester)	NEIC-39-A
      5.    UV	NEIC-39-B
      6.    HPLC(AX-ES)	CAN; PIC.L

Pindone (671/83-26-1/1661)

      1.    UV (Ether extraction)	EPA-1
      2.    UV (Pyrophosphate extraction)	EPA-2
      3.    UV (Water soluble formulations)	EPA-3
      4.    HPLC (RP-ES)	EPA-4 (4)

Pine Oil (665/8002-09-3/1651)

      1.    Gravimetric	NEIC-665-A
      2.    Fatty or Rosin Acid Content	NEIC-665-B
      3.    Water/Alcohol Content	NEIC-665-C

Piperalin (575/3478-94-2/1424)

Piperonal (669/5281-13-0/1656)

      1.    GC  (FID-IS)	NEIC-669-A

Piperonyl Butoxide (670/51-03-6/1657)

      1.    Colorimetric	AOAC-960.11 (p. 170)
      2.    GC  (FID-IS)	AOAC-982.02* (p. 172)
      3.    Qualitative Test	EPA-1
      4.    GC  (FID-IS)	EPA-2
      5.    GC (see "Pyrethrins/EPA-2")
      6.    IR	NEIC-670-A
      7.    IR	CIPAC-1 (p. 730)
      8.    TLC (Semi-quantitative)	NEIC-670-B
      9.    GC (FID-IS; with Diazinon)	NEIC-670-C
      10.   HPLC (RP-ES; with folpet/pyrethrins)	JAOAC fig, 789 (1983)
      11.   HPLC (Pet Shampoos) [see Pyrethrins/EPA-1 (4)]
      12.   GC (FID-ES/CAP; with MGK-264/pyrethrins)	CAN; OCT.G
      13.   GC (FID-ES/MB; with MGK-264/pyrethrins)	
                 	CAN; OCT.G/OCT.L(2)

Pirimicarb (359C/23103-98-2/1658)

      1.    GC  (FID-IS)	AOAC-982.08
      2.    Titrimetric	AMP VII (p. 401)

-------
                                                                 P-7
Pirimicarb (359C/23103-98-2/1658) (cont.)
      3.    Colorimetric	AMP VII (p. 401)
      4.    UV	EPA-K2)
      5.    Identification (GC/TLC/IR/NMR)	CIPAC-ID (p. 182)
      6.    Reference Std. (Purification and purity)	CIPAC-ID (p. 197)

Pirimiphos Ethyl (334A/23505-41-1/1659)

      1.    GC  (FID-IS)	AMP VIII (p. 174)
      2.    TLC/UV	AMP VIII (p. 177)
      3.    Hydrolysis/UV	AMP VIII (p. 179)
      4.    GC  (FID-IS)	EPA-1 (4)
      5.    GC  (FID-IS)	CIPAC-ID (p. 147)
      6.    Identification (GC/TLC/IR/NMR)	CIPAC-ID (p. 182)
      7.    Reference Std. (Purification and purity)	CIPAC-ID (p. 199)

Pirimiphos Methyl (334B/29232-93-7/1660)

      1.    GC  (FID-IS)	AMP VIII (p. 189)
      2.    TLC/UV	AMP VIII (p. 190)
      3.    Hydrolysis/UV	AMP VIII (p. 190)
      4.    HPLC (RP-IS)	JAOAC 60. 14(1977)
      5.    GC  (FID-IS)	EPA-1 (4)
      6.    GC  (FID-IS)	CIPAC-IC (p. 2193)
      7.    Reference Std. (Purification and purity)	CIPAC-IC (p. 2337)
      8.    Identification (GC/TLC/IR/NMR)	CIPAC-ID (p. 182)

Pival (see "Pindone" 671)

Planavin (see "Nitralin" 578)

Plantvax (see "Oxycarboxin" 627A)

Plictran (see "Cyhexatin" 884A)

PMP (515/83-28-3/1257)

      1.    UV (Ether extraction	EPA-1
      2.    UV (Pyrophosphate extraction)	EPA-2
      3.    UV (Aqueous formulations)	EPA-3

Polaris (see "Glyphosine" 471A)

Polychlorinated Biphenyls (672A/1336-36-3/1666)

      1.    GC (EC-ES; in  oils, soils, and wipes)	NEIC-672A-1

-------
                                                                  P-8


Polyram (41A/9006-42-2/108)

      1.     Carbon Disulfide Evolution	NEIC-41A-A

Potassium Azide (682B/20762-60-1/1695)

      1.     GC(ES)	NEIC-682B-A

Potassium Bisulfate (682C/7646-93-7/1692)

Potassium Chromate (687/7789-00-6/1700)

      1.     Titrimetric	NEIC-687-A

Potassium Cyanate (688/590-28-3/1701)

      1.     Gravimetric	AOAC-952.01* (p. 159)

Potassium Cyanide (688A/151-50-8/1702)

      1.     Titrimetric	AOAC-920.30 (p. 159)

Potassium Dichloro-s-triazinethone (689) (see "Available Chlorine")

Potassium-N-methyldithiocarbamate (696/137-41-7/1715)

Potassium Permanganate (699/7722-64-7/1719)

      1.     Titrimetric	NEIC-699-A

Potassium Persulfate (700/7727-21-1/1721)

      1.     Titrimetric	NEIC-700-A

Pramitol  (see "Prometone" 96)

Prefar (see "Bensulide" 357)

Preforan  (see "Fluorodifen" 462AA)

Pressurized  Containers

      1.     Nonvolatiles (High-pressure)	NEIC-PC-A
      2.     Nonvolatiles (Refillable High-pressure)	NEIC-PC-B
      3.     Non-volatiles (Low-pressure)	NEIC-PC-C
      4.     Flame Projection Test	NE1C-PC-D
      5.     Drum Test (Flammability-	NEIC-PC-E
      6.     Total Container	NEIC-PC-F
      7.     Direct. Sampling	NEIC-PC-G

-------
                                                                 P-9


Primidophos (5C/39247-96-6/12)

Princep (see "Simazine" 740)

Probe (see "Methazole" 549AA)

Procyazine(186ABC/32889-49-9/1733)

      1.     GC  (FID-IS)	NEIC-186ABC-A

Profluralin (271BB/54460-46-7/1734)

      1.     GC  (FID-IS)	AMP X (p. 453)

Promacyl

      1.     GC  (FID-IS)	AMP VIII (p. 209)
      2.     GC  (FID-IS)	AMP XI (p. 141)
      3.     GC (FID-IS; in cattle dips)	AMP XI (p. 144)

Promecarb (271C/2631-37-0/609)

Prometon (see "2,4-Prometone" 96)

2,4-Prometone (96/1610-18-0/1735)

      1.     GC  (FID-IS)	AOAC-971.08* (p. 222)
      2.     GC(TCD-IS)	EPA-1
      3.     GC  (FID-IS)	EPA-2
      4.     GC (FID-IS; with simazine)	EPA-1 (4)
      5.     Nonaqueous Titration	AMP IV (p. 173)

Prometryn (97/7287-19-6/1736)

      1.     GC  (FID-IS)	AOAC-971.08* (p. 222)
      2.     Nonaqueous Titration	AMP IV (p. 181)

Pronamide (see "Propyzamide" 306A)

Propachlor (194/1918-16-7/432)

      1.     GC  (FID-IS)	AOAC-986.05* (p. 196)
      2.     GC  (FID-IS)	NEIC-194-A
      3.     GC (FID, with atrazine)	NEIC-194-B
      4.     Labile Chlorine (Titration)	NEIC-194-C
      5.     GC  (FID-IS)	CAN; POE.G

-------
                                                              P-10
Propanil (325/709-98-8/791)
      1.    Total Chlorine	AMP IV (p. 326)
      2.    GC  (FID-IS)	NEIC-325-A
      3.    GC (TCD-IS)	AMP XIII (p. 282)

Propargite (130i;2312-35-8/1737)

      1.    IR	EPA-1
      2.    GC (TCD-IS)	EPA-2
      3.    HPLC  (RP-ES)	CAN; POT.L

Propazine (184/139-40-2/1740)

      1.    GC  (FID-IS)	AOAC-971.08* (p. 222)
      2.    Labile Chlorine	AMP IV (p. 188)

Propetamphos(706A/31218-83-4/1741.5)

      1.    GC  (FID-IS)	NEIC-706A-A
      2.    GC (FID-IS; with hydroprene)	NEIC-706A-B
      3.    GC (FID-IS; with methoprene)	NEIC-706A-C

Propham (510/122-42-9/1241)

      1.    Hydrolysis/Titration	CIPAC-1 (p. 593)
      2.    HPLC (see "Quintex")
      3.    GC (see "Chlorpropham/CIPAC-IC; p. 2025")

Prophos (see "Propham" 510)

Propionic Acid (707/79-9-4/1742)

      1.    GC(FID-ES)	EPA-1 (3)

Propoxur (508/114-26-1/1238)
      1.    HPLC (RP-IS)	AOAC-984.12* (p. 220)
      2.    IR	AMP VII (p. 165)
      3.    Colorimetric	NEIC-508-A
      4.    IR (bait formulations)	NEIC-508-B
      5.    HPLC (RP-ES; oil sprays)	NEIC-508-C
      6.    GC (FID-IS; as TFA derivative)	NEIC-508-D
      7.    IR	NEIC-508-E
      8.    HPLC (RP-IS)	NEIC-508-F
      9.    HPLC(NP-ES)	AMP XII  (p. 7)
      10.   GC (FID-ES/MB; in pet collars)	CAN; NAD.G/PPO.G
      11.   GC (FID-ES)	CAN; PRO.G
      12.   HPLC  (RP-ES)	CAN; PRO.L

-------
                                                                p-11


Propylene Glycol (713/57-55-6/1749)

      1.    GC (TCD-IS)	EPA-1 (1)
      2.    GC  (FID-IS)	AOAC-970.61 (p. 360)
      3.    GC (FID-IS/CAP; with aromatic naphtha)	
                 	CAN; HAN/POJ.G

n-Propyl Isome (401/83-59-0/955)

Propyzamide (306A/23950-58-5/690)

      1.    GC  (FID-IS)	AMP VIII (p. 445)
      2.    GC  (FID-IS)	NEIC-306A-B

Prosulfalin (399D A/51528-03-1/1754)

Protect (-/81-84-5/-)

      1.    IR	AMP VIII (p. 484)
      2.    GC(FID-ES)	NEIC-Protect-A

Prothoate (344B/2275-18-5/832)

      1.    GC (TCD-IS)	AMP VIII (p. 215)
      2.    TLC/Totar Phosphorus	AMP VIII (p. 217)

Prowl (see "Pendimethalin" 454BB)

Proxel (79A/ - /181)

Pydrin (see "Fenvalarate" 77A)

Pyrazon (714C/1698-60-8/1756)

      1.    HPLC  (RP-ES)	CIPAC-ID (p. 35)
      2.    IR	EPA-1 (2)
      3.    HPLC  (RP-ES)	JAQAQ1L 1064 (1988)

Pyrazophos (714D/13457-18-6/1070)

      1.    TLC/Total Sulfur	AMP X (p. 239)
      2.    HPLC (NP-IS)	CIPAC-IC (p. 2206)

Pyrethrins (715/121-21-1/1757)

      1.    Titrimetric (Deniges)	AOAC-936.05 (p. 170)
      2.    GC  (FID-IS)	AOAC-982.02* (p. 172)
      3.    Description	EPA-1
      4.    GC(FID-ES)	EPA-2

-------
                                                                P-12


Pyrethrins (715/121-21-171757) (cont.)

      5.    Titrimetric (Sell)	EPA-3
      6.    HPLC (RP-ES)	EPA-4(3)
      7.    TLC  (with  PBO)	NEIC-715-A
      8.    GC (FED-IS; with PBO and MGK-264)	AMP VIII (p. 232)
      9.    HPLC (RP-ES)	NEIC-715-B
      10.   HPLC(RP-IS)	JAQAC 66. 789 (1983)
      11.   HPLC (RP-IS; in pet shampoos)	EPA-1 (4)
      12.   GC (FID-ES/CAP; with PBO and MGK-264)	CAN; OCT.G
      13.   HPLC (NP-IS; with MGK-264 and PBO in pet shampoos	
                 	CAN; OCT.G/OCT.L (2)

Pyridine (717/110-86-1/1759)

      1.    Distillation/Titration	NEIC-717-A

Pyrinuron (718B/53558-25-1/1763.5)

      1.    HPLC (NP-IS)	AMP XII (p. 233)

Pyrolan (574A/87-47-8/1422)

      1.    Hydrolysis/Distillation	AMP II (p. 416)

Pyroxychlor (194C/7159-34-4/1764)

-------
                                                                Q-l
Quaternary Ammonium Compounds
      1.    Chloride Titration (Potentiometric)	AOAC-960.14A (p. 228)
      2.    Chloride Titration (Absorption indicator)AOAC-960.14B (p. 228)
      3.    Conversion Factors	EPA-1
      4.    Auerbach Qualitative Test	EPA-2
      5.    Ferricyanide Method	EPA-3
      6.    Epton Titration	EPA-4
      7.    Chloride/Bromide (Potentiometric titr'n)	EPA-5
      8.    Colorimetric	NEIC-Quat-A
      9.    Titrimetric	NEIC-Quat-B
      10.   Gravimetric	NEIC-Quat-C
      11.   Titrimetric	CAN; QA7.P

Quinalphos (662A/ 13593-03-8/835)

      1.    TLC/UV	AMP XI (p. 149)
      2.    GC  (FID-IS)	AMP XI (p. 151)

8-Quinolinol Sulfate (719B/134-31-6/1768)

      1.    UV	NEIC-719B-A

Quintex® (Fenuron + Propham + Chlorpropham)

      1.    HPLC  (RP-ES)	AMP XI (p. 344)

Quintiofos (454D/ - /1083)

      1.    GC (FID-ES; Dip washes)	NEIC-454D-A

Quintozine (see "Pentachloronitrobenzene" 2328)

-------
                                                                R-l


Rabon (see "Tetrachlorvinphos" 217A)

Ramrod (see "Propachlor" 194)

Randox  (see  "Allidochlor" 284)

Raticate (see Norbormide" 606)

Red SquiU (722/507-60-8/1772)

      1.    Paper Chromatography/Fluorescence	NEIC-722-A
      2.    General Description	NEIC-722-B

Resmethrin (83E/10453-86-8/1773.5)

      1.    IR	EPA-1
      2.    GC(TCD-ES)	EPA-2
      3.    GC (TCD-IS)	EPA-3
      4.    HPLC  (RP-ES)	EPA-4
      5.    GC  (FID-IS)	EPA-5
      6.    GC  (FID-IS)	AMP VII (p. 445)
      7.    GC (separates isomers)	AMP VII (p. 447)
      8.    Colorimetric	AMP VII (p. 448)
      9.    HPLC(RP-IS)	AMP XII (p. 70)

RH-787 (see "Pyrinuron" 718B)

Rogor (see "Dimethoate" 358)

Rogue (see "Propanil" 325)

Ro-Neet (see  "Cycloate" 432A)

Ronnel (724/299-84-3/1775)

      1.    GC (FID-IS; in feeds)	AOAC-969.56 (p. 108)
      2.    IR	EPA-1
      3.    GC  (FID-IS)	EPA-2
      4.    IR (Korlan, smears, etc)	NEIC-724-A
      5.    GC  (FID-IS)	NEIC-724-B
      6.    Colorimetric (Feeds and dips)	NEIC-724-C
      7.    IR	CIPAC-1 (p. 730)

Rotenone (725/83-79-4/1776)

      1.    Crystallization	AOAC-938.01 (p. 168)
      2.    Total Ether Extract	AOAC-940.04 (p. 169)
      3.    IR	AOAC-961.03 (p. 169)
     4.    HPLC  (RP-ES)	AOAC-983.06* (p. 169)

-------
                                                              R-2
Rotenone (725/83-79-4/1776) (cont.)
      5.    Qualitative Test	EPA-1
      6.    HPLC  (RP-ES)	EPA-2 (3)
      7     TLC                                        NEIC-725-A
      8.    GC (Reduction with NaBH4).....!..........."."...........! NEIC-725-B
      9.    Colorimetric	CIPAC-1 (p. 611)
      10.   GC(FID-ES)	sIAQAQSfi, 1342(1973)
      11.   HPLC(NP-ES)	51^0^052,958(1975)
      12.   UV and IR (Effects of other rotenoids)	JAOAC 59. 703 (1976)
      13.   HPLC  (RP-ES)	JAOAC 66. 783 (1983)
      14.   HPLC  (RP-ES)	CAN; ROT.L
      15.   HPLC  (RP-ES)	JAOAC 71. 323 (1988)

Round-Up (see "Glyphosate" 661 A)

Rowmate (see "Dichlormate" 298A)

Rowtate (see "Cisanilide" 380A)

Rozol (see "Chlorophacinone" 211C)

Ruelene (see "Crufomate" 263A)

Ryanodine (727/15662-33-6/1777)

      1.    UV	NEIC-727-A

-------
                                                                   S-l


Sabadilla Alkaloid (728/8051-02-3/1778)

      1.     Gravimetric	AOAC-960.12 (p. 173)

Safrole (729/94-59-7/1779)

Salicylanilide (730/87-17-2/1780)

      1.     UV	EPA-1

Salithion (549D/3811-49-2/1330)

      1.     Colorimetric	AMP VII (p. 433)
      2.     GC (FID-IS)	AMP VII (p. 435)

Sampling

      1.     Solids and Liquids	AOAC-935.06 (p. 147)

Saturn (see "Benthiocarb" 207DA)

SBP-1382 (see "Resmethrin" 83E)

Schraden (610/152-16-9/1509.5)

      1.     Differential  Hydrolysis	CIPAC-1 (p. 621)
      2.     Hydrolysis/Titration	NEIC-610-A

Secbumaton (125C/26259-45-0/1783)

      1.     Potentiometric  Titration	NEIC-125C-A

Sector (see "Butralin" 125E)

Selenium (732/7782-49-2/1784)

      1.     Gravimetric	NEIC-732-A
      2.     Gravimetric	NEIC-732-B

Sencor (see "Metribuzin" 33D)

Sendran (see "Propoxur" 508)

Sesame Oil (733/8008-74-0/1786)

      1.     Qual. Test	AOAC-893.01 (p. 979)

-------
                                                                   S-2


Sesone (319/136-78-7/772)

      1.     Hydrolysis/Titration	AMP IV (p. 201)

Sethoxydim (72A/74051-80-2/174)

      1.     HPLC (NP-ES)	NEIC-72A-A

Sevin (see "Carbaryl" 160)

Siduron (733A/1982-49-6/1787)

      1.     UV	EPA-1
      2.     Hydrolysis/Distillation	NEIC-733A-A

Silica Gel (734/1343-98-2/1788)

      1.     Gravimetric	NEIC-734-A

Silver (735/7440-22-4/1790)

Silvex (739/93-72-1/1795)

      1.     HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.")
      2.     GC (see "Chlorophenoxy Herbicides/EPA-5-.")
      3.     GC (as TMS ester)	AMP VI (p. 688)
      4.     Titration	CIPAC-IC (p. 2121)
      5.     GC (FID-IS; as methyl ester)
      6.     Reference Std. (Purification and purity)	CIPAC-IC (p. 2333)

Silvex, Propylene Glycol Butyl Ester Ester (739N/53466-84-5/1798)

      1.     Hydrolysis/Titration	NEIC-1798-1

Simazine (740/122-34-9/1816)

      1.     GC (FID-IS)	AOAC-971.08* (p. 222)
      2.     Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1")
      3.     UV (0.1% Aqueous Suspension)	EPA-1
      4.     GC [see " Prometone/EPA-1 (4)"]
      5.     HPLC [see "Karbutilate/EPA-1 (4)"]
      6.     Non-aqueous Titration	AMP IV (p. 217)

Simetryn (94B/1014-70-6/218)

      1.     GC (FID-IS)	CIPAC-lB(p. 1895)

-------
                                                                  S-3
Soap (741/68952-95-4/1817)
      1.     Moisture by Distillation	AOAC-926.01A (p. 162)
      2.     Sodium and Potassium	AOAC-926.01B (p. 162)

Sodium Arsenate (743/13464-38-5/1822)

Sodium Arsenite (744/7784-46-5/1823)

Sodium Benzoate (746/532-32-1/1825)

      1.     Titrimetric  	NEIC-746-A

Sodium Bisulfate (742/7681-38-1/1819)

Sodium Carbonate (752/497-19-8/1832)

      1.     Titrimetric	AOAC-911.01 (p. 232)

Sodium Chlorate (753/7775-09-9/1833)

      1.     Titrimetric	EPA-1
      2.     Titrimetric	CIPAC-1 (p. 626)
      3.     Titrimetric (with Sodium Metaborate)	EPA-1 (4)

Sodium Cyanide (758/143-33-9/1843)

      1.     Titrimetric	AOAC-920.30 (p. 159)
      2.     Titrimetric	NEIC-758-A

Sodium Diacetate (758C/ - /1844)

      1.     Titration	NEIC-758C-A

Sodium Dichloro-s-triazinetrione (759) (see "Available Chlorine")

Sodium Dimethyldithiocarbamate (762/128-04-1/1846)

Sodium Fluoride (769/7681-49-4/1850)

      1.     Total  Fluorine	AOAC-929.04 (p. 150)
      2.     Titrimetric	NEIC-769-A
      3.     Ion  Chromatography	EPA-1 (4)

Sodium Fluoroacetate (770/62-74-8/1851)

      1.     GC (Derivitization)	JAOAC 63.49 (1980)
      2.     HPLC (NP-ES)	NEIC-770-A

-------
                                                                   S4


Sodium Fluosilicate (771/16893-85-9/1852)

      1.    Total Fluorine	AOAC-945.05 (p. 152)

Sodium Hydroxide (773/1310-73-2/1854)
      1.    Titrimetric	AOAC-911.01 (p. 232)

Sodium Hypochlorite (776/7681-52-9/1856)

      1.    Titrimetric	AOAC-935.07 (p. 160)
      2.    Chloride Content	AOAC-935.08B (p. 160)
      3.    Sodium  Hydroxide Content	AOAC-935.08C (p. 160)
      4.    Titrimetric (Rel. Iodine)	NEIC-776-A

Sodium Metaborate (779AA/7775-19-1/1863)

      1.    Titrimetric [see "Sodium Chlorate/EPA-1 (4)"]

Sodium Selenate (791/13410-01-0/1880)

Sodium Trichloroacetate (797/650-51-1/1888)

      1.    Titrimetric	AOAC-962.08 (p. 197)
      2.    Decarboxylation/Titration	CIPAC-1 (p. 691)

Solan (800/2307-68-8/1892)

      1.    Total Chlorine	NEIC-800-A

Sorbic Acid (801/110-44-1/1893) and Potassium Salt (80 LA/ - /1894)

Spectracide (see "Diazinon" 342)

Spergon (see "Chloranil" 171)

Spike (see "Tebuthiuron" 366AA)

Stabilene (see "Butoxypropylene Glycol" 122)

Stam (see "Propanil" 325)

Starlicide (216A/7745-89-3/499)

      1.    Colorimetric	NEIC-216A-A

Streptomycin (804/57-92-1/1898) and Sulfate (804A/298-39-5/1899)

      1.    UV	EPA-1

-------
                                                                  S-5


Strobane (822/8001-50-1/1927)

Strychnine Alkaloid (805/57-24-9/1900) and Sulfate (806/60-41-3/1901)

      1.     Gravimetric	EPA-1
      2.     UV	EPA-2
      3.     HPLC	EPA-3(2)

Strychnine Alkaloid (805/57-24-9/1900) and Sulfate (806/60-41-3/1901) (cont.)

      4.     HPLC  (RP-ES)	NEIC-805-A
      5.     GC (FID-ES)	JAOAC 58. 961 (1975)
      6.     HPLC  (RP-ES)	JAQAC 58. 957 (1975)
      7.     UV	NEIC-805-B
      8.     HPLC(RP)	JAQA£fil, 612 (1978)
      9.     HPLC (RP-IS)	EPA-4 (3)

Sulfallate (180/95-06-7/396)

      1.     Total chlorine	AMP IV (p. 249)

Sulfamic Acid (809/5329-14-6/1904)

      1.     Titrimetric	NEIC-809-A

Sulfanilamide (809A/63-74-1/1905)

Sulfaquinoxaline (721/59-40-5/1771)

      1.     Colorimetric	AOAC-963.35 (p. 112)
      2.     HPLC (with warfarin)	EPA-MP-1 (2)

Sulfometuron Methyl (561D/74222-97-2A)

      1.     HPLC (RP-IS)	AMP XVI (p. 108)

Sulfotepp (837/3689-24-5/1948)

      1.     GC (TCD-IS)	AMP VI (p. 483)

Sulfoxide (615/120-62-7/1522)

      1.     UV	AOAC-968.05 (p. 230)

Sulfur (812/7704-34-9/1911)

      1.     Gravimetric (Water soluble sulfur)	AOAC-920.31 (p. 159)
      2.     Gravimetric (CS2 extraction)	EPA-1
      3.     Gravimetric (Nitric acid oxidation)	EPA-2

-------
                                                                  S-6
Sulfur (812/7704-34-9/1911) (cont.)
      4.     Gravimetric (Acetone method)	EPA-3
      5.     Titrimetric	CIPAC-1 (p. 632)
      6.     HPLC  (RP-ES)	JAQAC 71. 617 (1988)

Sulfur Dioxide (813/7446-09-5/1912)

      1.     Titrimetric (Fumigants)	EPA-1

Sulfuric Acid (815/7664-93-9/1914)

      1.     Titrimetric	NEIC-815-A

Sulfuryl Fluoride (816A/2699-79-8/1916)

Sulphenone (211D/80-00-2/482)

Sulprofos (453AA/35400-43-2/1078)

      1.     GC  (FID-IS)	AOAC-980.12 (p. 210)

Sumithion (see "Fenitrothion" 373)

Supona (see "Chlorfenvinphos" 187)

Supracide (see "Methadathion" 378B)

Surflan (see "Oryzalin" 623A)

Sustar (see "Fluridamid" 889B)

Sutan (see "Butylate" 434A)

Swep (818/1918-18-9/1917)

Systox (see "Demeton" 279)

-------
                                                                 T-l
2,4,5-T (881/93-76-5/2024)
      1.     HPLC (RP-IS)	AOAC-980.08* (p 196)
      2.     UV (with 2,4-D) (see "Chlorophenoxy Herbicides/EPA-2")
      3.     HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.")
      4.     Extraction/Titration	CIPAC-1 (p. 642)
      5.     GC (FID-ES; as methyl ester)	NEIC-881-A
      6.     HPLC  (RP-ES)	NEIC-881-B
      7.     GC (as TMS ester)	AMP VI (p. 630)
      8.     GC (as TMS ester, on-column)	NEIC-881-C
      9.     GC (FID-IS; as methyl ester)	CIPAC-IC (p.  2257)
      10.    Characterization (IR/GC/TLC)	CIPAC-IC (p.  2220)
      11.    Reference Std. (Purification and purity)	CIPAC-IC (p.  2312)
      12.    TCDD content (GC-MS)	CIPAC-IC (p.  2284)

2,4,5-T, Butoxyethanol Ester (881N/2545-59-7/2039)

      1.     GC (see "Chlorophenoxy Herbicides/EPA-4-Tent.")
      2.     Hydrolysis/Titration	CIPAC-1 (p. 646)

2,4,5-T, 2-Ethylhexyl Ester (881R/1928-47-8/2043)

Tabutrex (see "Dibutyl Succinate" 293)

Tackle (see "Aciflurfen Sodium Salt"  755D)

Talon (see "Brodifacoum" 114AAA)

Tandex (see "Karbutylate" 516A)

2,4,5-TB (881/93-80-1/2048)

2,3,6-TBA (873/3426-62-8/2008)

      1.     Characterization (IR/MP)	CIPAC-IC (p.  2226)
      2.     GC (FID-IS; as methyl ester)	CIPAC-IC (p.  2227)
      3.     Reference Std. (Purification and purity)	CIPAC-IC (p.  2314)

TCA (see "Trichloroacetic Acid" 870)

TCC (874/101-20-2/2011)

TCNB (see "Tecnazine" 831)

TDE (307/72-54-8/693)

      1.     IR	NEIC-307-A

-------
                                                                T-2
Tebuthiuron (366AA/34014-18-1/1920)
      1.    UV	EPA-K3)
      2.    GC  (FID-IS)	AMP XI (p. 355)
      3.    HPLC (Silica)	AMP XI (p. 353)
      4.    HPLC (RP-ES)	CAN; TDU.L

Tecnazene (831/117-18-0/1934)

      1.    Polarography	CIPAC-1 (p. 663)
      2.    GC  (FID-IS)	EPA-1 (3)

Tedion (see "Tetradifon" 836)

Telodrin (see "Isobenzan" 609)

Telone (see "D-D Mixture" 324)

Telvar (see "Monuron" 583)

Temephos (845/3383-96-8/1921)

      1.    HPLC (NP-IS)	AOAC-982.07* (p. 211)
      2.    UV	AMP VII (p. 121)
      3.    GC  (FID-IS)	AMP VII (p. 125)
      4.    HPLC(NP-ES)	CANjTEF.L

Temik (see "Aldicarb" 11A)

Tenoran (see "Chloroxuron" 217B)

TEPP (838/107-49-3/1949)

      1.    Titrimetric	AOAC-949.06 (p. 211)
      2.    Hydrolysis/Titration	CIPAC-1 (p. 667)

Terbacil (821A/5902-51-2/1922)

      1.    HPLC (NP-IS)	AMPX(p.485)
      2.    IR	AMP X (p. 486)
      3.    UV	;	EPA-1 (3)
      4.    HPLC (RP-ES)	CAN;  TELL

Terbucarb (see "Terbutol" 294)

Terbufos (131A/13071-79-9/1924)

      1.    GC  (FID-IS)	AMP XI (p. 166)
      2.    HPLC (NP-ES)	CAN; TDS.G

-------
                                                                 T-3


Terbut (see "Secbumeton" 125C)

Terbuthylazine (125B/5915-41-3/1925)

      1.     GC  (FID-IS)	AOAC-981.04 (p. 220)

Terbutol (294/1918-11-2/670)

      1.     IR	EPA-1
      2.     GC  (FID-IS)	EPA-2
      3.     UV	NEIC-294-A

Terbutryn (125D/886-50-0/1926)

      1.     GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.     IR	NEIC-125D-A

Terpene Polychlorinates (see "Strobane" 822)

Terraclor (see "Pentachloronitrobenzene" 640)

Terramytin (628/2058-46-0/1552)

Terrazole (428/2593-15-9/1029)

      1.     GC (TCD-ES)	NEIC-428-A
      2.     IR (with PCNB)	NEIC-428-B
      3.     GC (FID-ES; with PCNB)	NEIC-428-C

2,3,5,6-Tetrachloro-4-(methylsulfonyl)pyridine(830A/13108-52-6/1933)

      1.     GC (TCD-IS)	NEIC-830A-A
      2.     UV	NEIC-830A-B

Tetrachlorophenols (832/25167-83-3/1935) and salts

      1.     IR	CIPAC-1 (p. 730)
      2.     Titrimetric	NEIC-832-A
      3.     IR	NEIC-832-B
      5.     GC (see "Pentachlorophenol/NEIC-1564-2")
      6.     HPLC (see "Pentachlorophenol/NEIC-1564-4")

Tetrachlorothiophene (834/6012-97-1/1943)

Tetrachlorvinphos (217A/961-11-5/503)
      1.     GC  (FID-IS)	EPA-1 (3)
      2.     GC (FID-ES)	AMP VII (p. 299)
      3.     IR	AMP VII (p. 302)
      4.     GC (Premixes)	NEIC-217A-A

-------
                                                                  T-4
Tetradifon (836/116-29-0/1946)
      1.     GC  (FID-IS)	AOAC-981.02 (p. 197)
      2.     GC  (FID-IS)	AMPX(p. 121)
      3.     Total Chlorine (Na reduction)	AMP II (p. 475)
      4.     IR	CIPAC-1 (p. 730)

Tetralin (842A/119-64-2/1953.5)

Tetraethylpyrophosphate (see "TEPP" 838)

Tetramethrin (844/7696-12-0/1957)

      1.     GC  (FID-IS)	AMP VII (p.349)
      2.     TLC/UV	AMP VII (p. 347)
      3.     GC (TCD-IS; with resmethrin)	NEIC-844-A
      4.     GC (FID-IS; with synergists)	NEIC-844-B
      5.     GC (FID-IS; with d-phenothrin)	EPA-1 (4)

Tetrasul (213/2227-13-6/487)

TFM (see "Lamprecide" 890)

Thallium Sulfate (849/7446-18-6/1964)

      1.     Gravimetric	AOAC-939.01* (p. 163)
      2.     A A	NEIC-849-A

Thanite (503/115-31-1/1227)

      1.     Total Nitrogen	AOAC-951.02 (p. 228)

Thiabendazole (849A/148-79-8/1965)

      1.     Colorimetric	AOAC-966.28 (p. 114)
      2.     Titrimetric	NEIC-849A-A
      3.     UV	AMP VIII (p. 301)
      4.     Colorimetric	JAOAC 58. 971 (1975)

Thimet (see "Phorate" 660)

Thiobencarb (207DA/28249-77-6/1968)

      1.     GC  (FID-IS)	EPA-1 (4)
      2.     GC  (FID-IS)	CIPAC-ID(p. 160)

-------
                                                               T-5
Thiocarbamate Herbicides
      1.    GO (FID-IS)	AOAC-974.05 (p. 221)
      2.    GC (GC-ES)	CAN; EPT.G

Thiocyanates

      1.    Total Nitrogen	AOAC-951.02 (p. 228)

Thiocyclam-Hydrogen Oxalate (853F/-/-)

      1.    HPLC (RP-IS)	AMP XI (p. 187)

Thiodan (see "Endosulfan" 420)

Thiodicarb (900AA/59669-26-0/911.5)

      1.    HPLC (RP-IS)	NEIC-900AA-A

Thiofanox (368BB/39196-18-4/1974)

Thiometon (455B/640-15-3/1086)

      1.    IR	CIPAC-1 (p. 730)
      2.    GC (FID-IS)	AMP VIII (p. 242)
      3.    GC (FID-IS)	NEIC-455B-A

Thiophanate (344A/23564-06-9/829)

      1.    UV	EPA-K3)
      2.    HPLC (RP-ES; with thiram)	NEIC-344A-A

Thiophanate-Methyl(375A/23564-05-8/1975)

      1.    UV	EPA-K3)
      2.    Colorimetric	NEIC-375A-A
      3.    HPLC (RP-IS)	CIPAC-ID (p. 163)

Thiourea (855/62-56-6/1977)

Thiram (856/137-26-8/1978)
      1.    CS2 Evolution	AOAC-966.08 (p. 222)
      2.    UV	EPA-1
      3.    IR	EPA-2
      4.    IR	CIPAC-1 (p. 730)
      5.    HPLC (RP-ES; with thiophanate)	NEIC-856-A
      6.    HPLC (RP-IS)	EPA-3 (4)
      7.    HPLC (NP-IS)	CIPAC-ID (p. 169)
      8.    HPLC (RP-ES; with carborin)	CAN;  CBX.L/THR.L

-------
                                                                  T-6


Thymol (856A/89-83-8/1979)

      1.     Titrimetric	AOAC-929.12 (p. 552)

TIBA (890A/88-82-4/2084)

Tiguvon (see "Fenthion" 456F)

Tillam (see "Pebulate" 710)

Tin & Tin Compounds

      1.     Titrimetric [see "Bis(tributyltin)oxide/EPA-l"]

Tiocarbenil (82AA/36756-79-3/1629.3)

      1.     GC (FID-IS)	AMP XI (p. 309)
      2.     TLC	AMP XI (p. 311)

Tirpate (364/26419-73-8/878)

TOK (see "Nitrofen" 323D)

Tolban (see "Profluralin" 27IBB)

Toluene (859/108-88-3/1982)

      1.     GC (FID-IS)	AOAC-975.06 (p. 232)

Topcide (see "Benzadox" 75C)

Topsin (see "Thiophanate" 344A)

Topsin M (see "Thiophanate-Methyl" 375A)

Torak (see  "Dialifor" 280A)

Tordon (see "Picloram" 39)

Toxaphene (861/8001-35-2/1986)

      1.     IR	AMP II (p. 531)
      2.     Total Chlorine	AMP II (p. 525)
      3.     IR	CIPAC-1 (p. 730)
      4.     IR	NEIC-861-A

2,4,5-TP (see "Silvex" 739)

Treflan (see "Trifluralin" 889)

-------
                                                                 T-7
Triadimeform (862AA/43121-43-3/457)
      1.    HPLC (NP-IS)	AOAC-985.08 (p. 228)
      2.    HPLC(RP-IS)	NEIC-862AA-A
      3.    HPLC (RP-IS)	CIPAC-IC (p. 2236)

Triallate (870A/2303-17-5/2006)

      1.    GC  (FID-IS)	EPA-1 (4)
      2.    GC (FID-ES/MB)	CAN; TQA.G
      3.    GC (FID-ES; in fertilizers)	CAN; TQA.G (2)

Triamiphos (37A/1031-47-6/103)

Triarimol (861A/26766-27-8/1987)

      1.    GC	JAOAC 56. 11 (1973)

Triazine Herbicides

      1.    GC  (FID-IS)	AOAC-971.08 (p. 222)
      2.    Titrimetric	JAQACM, 4, (1971)
      3.    GC  (FID-IS)	AMPX(p. 513)
      4.    HPLC (RP-ES)	CAN;ATR/.../CUC.L

s-Triazinetriol (862/108-80-5/593) (see "Available Chlorine")

Triazophos (344G/24017-47-8/831)

      1.    TLC/Total Sulfur	AMPX(p. 129)

3,4,5-Tribromosalicylanilide (863/87-10-5/1989)

      1.    UV (see "Brominated Salicylanilides/EPA-1")

Tributyltin Fluoride (867C/1983-10-4/1997) (see "Tin" and "Fluorine")

Tributyltin Oxide (see "Bis(tributyltin)oxide" 101)

Tricamba (869/2307-49-5/2004)

Trichlorfon (385/52-68-6/913)

      1.    IR	EPA-1 (1)
      2.    GC  (FID-IS)	EPA-2 (1)
      3.    GC (FID-IS; TMS Der.)	EPA-3 (3)
      4.    HPLC (RP-IS)	EPA-4 (3)
      5.    Hydrolyzable Chlorine	AMP II (p. 201)
      6.    Dehydrohalogenation	AMP II (p. 202)

-------
                                                                   T-8
Trichlorfon (385/52-68-6/913) (cont.)
      7.     GC(NPD-ES)	  AMP VI (p. 387)
      8.     HPLC(RP-IS)	NEIC-385-A
      9.     HPLC (RP-IS)	JAOAC 71. 317 (1988)
      10.    GC  (Impurities)	JAQAQIi, 440 (1988)

Trichlormethylfos (see "Chlorpyriphos Methyl" 179AA)

Trichloroacetic Acid (870/76-03-9/2005)

      1.     Decarboxylation/Titration	CIPAC-1 (p. 691)

2,3,6-Trichlorobenzoic Acid (873/3426-62-8/2008)

3,4,4'-Trichlorocarbanilide (874/101-20-2/2011)

      1.     UV	EPA-1

1,1,1-Trichloroethane (875/71-55-6/2103)

Trichloroethylene (876/79-01-6/2014)

Trichloromelamine (877/7673-09-8/2016) (see "Available Chlorine")

Trichloronitromethane (see "Chloropicrin" 214)

Trichloronat (456A/327-98-0/1090)

2,4,5-Trichlorophenol (879/95-95-4/2020) and Potassium Salt

Trichloro-s-triazinetrione (883/ - /2060) (see "Available Chlorine")

Triclopyr, butoxyethyl ester (8821/55335-06-3/2062)

      1.     HPLC (RP-IS)	EPA-1 (4)

(Z>9-Tricosene (883C/27519-02-4/2064)

      1.     GC  (FID-IS)	NEIC-883C-A
      2.     GC  (FID-IS)	NEIC-883C-B

Tricresyl Phosphate (884/1330-78-5/2065)

Tricyclazole (884C/41814-78-2/2066)

      1.     GC  (FID-IS)	AMP XI (p. 265)
      2.     HPLC (RP-IS)	AMP XI (p. 267)

-------
                                                                T-9


Tridemorph (386/24602-86-6/915)

Triethanolamine (886/102-71-6/2070)

Triethylene Glycol (888/112-27-6/2078)

      1.    GC (TCD-IS)	EPA-1 (1)

Trifenofos (888D/38524-82-2/2080)

Trifenson (see "Sulphenone" 211D)

Trifluralin (889/1582-09-8/2082)

      1.    UV	AOAC-973.13(p. 179)
      2.    GC  (FID-IS)	AOAC-973.14(p. 180)
      3.    GC  (FID-IS)	EPA-1
      4.    IR	EPA-2
      5.    GC (Separation from benefin)	NEIC-889-A
      6.    GC (FID-ES/WB)	CAN; TSU.G
      7.    GC (FID-ES/CAP; in fertilizers)	CAN; TSU.G (2)
      8.    GC (FID-IS; with benfluralin)	JAOAC 73. 981 (1990)

Triforine (890AA/26644-46-2/2083)

      1.    TLC/Densitometry	AMP X (p. 245)
      2.    Total Chlorine	AMPX(p. 247)
      3.    Non-aqueous Titration	NEIC-890AA-A
      4.    HPLC (NP-ES)	NEIC-890AA-B
      5.    HPLC  (RP-ES)	NEIC-890AA-C
      6.    HPLC (with acephate and dicofol) [see "Acephate/EPA-1 (4)"]

Triphenyltin Acetate (896C/900-95-8/2098)

      1.    Potentiometric Titration	AOAC-979.02 (p. 156)
      2.    GC (with dithiocarbamates)	AOAC-984.04 (p. 157)

Triphenyltin Hydroxide (896E/76-87-9/2101)

      1.    Potentiometric Titration	AOAC-979.02 (p. 156)
      2.    GC (with dithiocarbamates)	AOAC-984.04 (p. 157)
      3.    UV	NEIC-896E-A
      4.    GC	JAOAC 61.1507 (1978)

Triprene (896J/2103)

Tris-Nitro (see "2-Hydroxymethyl-2-nitro-l,3-propanedior 495)

Trithion (see "Carbophenothion" 165)

-------
                                                                  T-10
4-Tritylmorpholine (898A/1420-6-0/2108)



Tropital (see "Piperonal" 669)



Troysan 174 [see "2-((Hydroxymethyl)amino)ethanol" 494C]



Trysben (see "TEA" 873)



Tunic (see"Methazole" 549AA)



Tupersan (see "Siduron" 733A)



Turkey Red Oil (899/8002-33-3/2109)



Turpentine (900/8006-64-2/2111)



Tyrothricin (900A/1404-88-2/2112)

-------
                                                                U-l
Urea (902/57-13-6/2114)
Ureas, Substituted
      1.    HPLCCNP&RP)	NEIC-SU-A
Urox (see "Monuron Trichloroacetate" 583A)

-------
                                                               V-l
Vacor (718B/53558-25-i;i763.5)
      1.    UV	EPA-l(l)
      2.    HPLC (RP-ES)	EPA-2 (1)
      3.    HPLC (NP-IS)	JAOAC 60. 1375(1977)
      4.    Potentiometric Titration	NEIC-718B-B

Valone (see "PMP" 515)

Vamidothion (379A/2275-23-2/904)

      1.    Titrimetric	AMP VII (p. 483)
      2.    GC (TCD-IS)	AMP VII (p. 481)

Vapam (see Metam-Sodium, 780)

Vapona (see "DDVP" 328)

VBT (see "Vinylene Bisthiocyanate" 902A)

Vegadex (see "CDEC" 180)

Vendex (see "Hexakis" 481DD)

Venzar (see "Lenacil" 525A)

Vernolate (711/1929-77-7/1747)

      1.    GC (FID-IS)	AOAC-974.05 (p. 221)
      2.    IR	EPA-1
      3.    GC (FID-IS)	EPA-2
      4.    GC (TCD-IS)	EPA-3
      5.    HPLC (RP-ES)	EPA-4 (2)
      6.    GC (FID-IS)	NEIC-711-A

Vikane (see "Sulfuryl Fluoride" 816A)

Vinclozolin (323C/50471-44-8/ -)

      1.    GC (FID-IS)	CIPAC-ID(p. 174)

Vinyl Chloride (902B/75-01-4A)

      1.    GC (Qual. test)	NEIC-VCM-A
      2.    IR (Qual. test)	NEIC-VCM-B
      3.    GC/IR (Qual. test, also other propellants)	NEIG-VCM-C

-------
                                                                 V-2





Vinylene Bisthiocyanate (902A/14150-71-1/2116)



      1.    Polarographic	NEIC-902A-A



Vitavax (see "Carboxin" 165A)



Vydate (see "Oxamyl" 561A)

-------
                                                                W-l
Warfarin (903/81-81-2/2117)
      1.    UV (Ether Extraction)	AOAC-960.15 (p. 229)
      2.    HPLC (RP-ES)	EPA-1
      3.    UV (Pyrophosphate extraction)	EPA-2
      4.    HPLC (Sodium salt)	EPA-3
      5.    HPLC (RP-ES)	EPA-4 (3)
      6.    UV (Silicic acid clean-up)	AMP III (p. 203)
      7.    UV (Ether/hexane extraction)	AMP VII (p. 678)
      8.    HPLC (RP-ES)	JAOAC 59.1104(1976)
      9.    HPLC (RP-ES with sulfaquinoxaline)	EPA-MP-1 (2)
      10.   HPLC (RP-ES with sulfaquinoxaline)	NEIC-903-A
      11.   HPLC (RP-ES)	CAN; WAR.L
      12.   HPLC (RP-ES; with sulfoquinoxaline in concentrates)	
                 	AMP XVI (p. 155)
      13.   HPLC (RP-ES; with sulfoquinoxaline in wheat baits)	
                 	AMP XVI (p. 156)

Water (903B/ - / -)

      1.    Distillation (Soap)	AOAC-14; 6.123
      2.    Distillation (Pine oils)	NEIC-903B-A
      3.    Distillation (Phenolic or coal-tar creosote)	NEIC-903B-B
      4.    Distillation (Liquor creosolis saponatus)	NEIC-903B-C
      5.    Isopropanol Conversion Table	NEIC-903B-D

Wepsyn (see "Triamiphos" 37A)

-------
                                                                       X-l




Xylene (906/1330-20-7/2121)

-------
                                                                  Z-l


Zectran (see "Mexacarbate" 579B)

Zinc and Zinc Compounds

      1.     Gravimetric	AOAC-918.01 (p. 150)
      2.     Titrimetric	NEIC-ZN-A

Zinc Arsenite (909/28837-97-0/2126)

      1.     Total  Arsenic	AOAC-920.22B (p. 155)
      2.     Water Soluble Arsenic	AOAC-920.22C (p. 155)
      3.     Total Zinc	AOAC-920.22D (p. 155)
      4.     Total Arsenious Oxide	AOAC-920.23 (p. 155)

Zinc Fluosilicate (914/16871-71-9/2131)

Zinc Naphthenate (919/1338-02-9/2137)

      1.     Gravimetric	AOAC-918.01 (p. 150)

Zinc Phosphide (922/1314-84-7/2141)

      1.     Phosphine Evolution (KMn04 oxidation)	EPA-1
      2.     Phosphine Evolution (GLC-FPD)	EPA-2
      3.     Phosphine Evolution (lodometric Titration).... CIPAC-1 (p. 703)

Zineb (930/12122-67-7/2151)

      1.     Carbon Bisulfide Evolution	AOAC-965.15 (p. 217)

Ziram (931/137-30-4/2153)

      1.     Carbon Bisulfide Evolution	AOAC-965.15 (p. 217)
      2.     UV	EPA-1 (3)

Zolone (see "Phosalone" 660A)

Zytron (323/299-85-4/783)

      1.     IR	NEIC-323-A

-------