UNITED STATES ENVIRONMENTAL PROTECTION AGENCY OFFICE OF ENFORCEMENT EPA-33019-83-001R PESTICIDE FORMULATION METHODS INDEX FOURTH EDITION June 1991 Dean F. Hill NATIONAL ENFORCEMENT INVESTIGATIONS CENTER Denver, Colorado ------- FOREWORD This fourth edition of the NEIC Pesticide Formulation Methods Index is intended solely as a guide to the published and other available methods for pesticide formulations and related analyses. Listing of the methods or their order of appearance does not imply any degree of EPA approval or lend to the methods any additional degree of status than they intrinsically possess. It should be kept in mind, however, that Associated Official Analytical Chemists (AOAC) and Collaborative International Pesticides Analytical Council (CIPAC) procedures are currently the only "official" methods available. Many of the referenced methods are obsolete or will rarely find use due to the availability of newer and more specific procedures, changing pesticide use patterns and regulatory restrictions. However, as many different pesticides and methods as possible were listed, as there may be occasions, where some other than the usual approaches may be necessary. Also, to the degree possible, suspected chemical violations should be confirmed by several different methods, if official methods are not available or applicable. No attempt has been made in the index to include more than a minimum number of chemical names in the main listing; most of the pesticides are listed by their official, common, or in some cases, trade names. Chemical names may be located and/or verified via the cross- reference numbers given with each chemical in: "Catalog of Pesticide Chemical Names and their Svnonvms. Coberly," et a/., PB86-170636, January 1986 (available from: NTIS, Springfield, VA 22161). Other common reference sources such as the Farm Index. British Crop Protection Manual, and Nanogen Index may also be consulted. The primary numerical cross-reference in this edition of the Index is now the "Caswell Number," a more widely used and readily available descriptive numbering system than that used in the first two editions of the Index. Chemical Abstract Service Registry (CASR) numbers and the old Index number are also included parenthetically for each compound for ------- ease of reference. The Caswell Numbers are available in the "Catalog of Pesticide Chemical Names and Their Synonyms," mentioned previously. Copies of any of the referenced methods (particularly those designated NEIC) may be obtained by request from the National Enforcement Investigations Center, Denver Federal Center, Building 53, Box 25227, Denver, Colorado 80225, (303) 236-7970. The references cited in compiling this index are abbreviated as follows: 1. AOAC: Official Methods of Analysis of the Association of Official Analytical Chemists. 15th Edition, 1990. Published by the Association of Official Analytical Chemists, Suite 400, 2200 Wilson Blvd., Arlington, VA 22201. Supplements issued annually. Those AOAC methods marked with an asterisk (*) have been adopted as joint AOAC-CIPAC methods. 2. EPA: Manual of Chemical Methods for Pesticides and Devices. Environmental Protection Agency, Office of Toxic Substances, Pesticide Programs, Benefits and Field Studies Branch, Beltsville, Maryland, First issued 1974 and updated 4 times. Supplemental methods are noted parenthetically by issue number. Currently unavailable, however, specific methods can be requested from NEIC. 3. AMP: Analytical Methods for Pesticides. Plant Growth Regulators and Food Additives. Ed. Zweig, Academic Press, New York. Vols. I-XVII, various volumes also edited by J. Sherma and others. ------- 4. CIPAC: CIPAC Handbook. Volume I and IA. through ID. Analysis of Technical and Formulated Pesticides. Compiled by R.D. Ashworth, J. Henriet and J.F. Lovett, edited by G.R. Law. Collaborative International Pesticides Analytical Council Limited, 1970 and 1980. Available from: Heffers Printers Ltd., Cambridge, EB4 2PQ England. 5. CAN: Pesticide Product Procedures Manual. Analytical Methodology for Analysis of Pesticide Formulations, compiled by B. Lee and R. Hudle, 1985, Pesticide Laboratory, Laboratory Services Division, Ag Canada, Building 22, CEF, Ottawa, Canada (updated July 1987). 6. AWPA: American Wood-Preserver's Association Standards. Published by the American Wood-Preservers Association, 1012 14th Street, NW, Washington, B.C. 20005. Revised periodically. 7. NEIC: These methods are various analytical procedures on file at the National Enforcement Investigations Center that do not fit into any of the previous categories. These methods are derived principally from pesticide manufacturers and formulators, but also include EPA and State developed methods. Journal methods other than the Journal of the Association of Official Analytical Chemists (JAOAC) are also included in this category. ------- If any laboratory using this index has methods available that would be useful for inclusion, please send copies to Dean F. Hill at the National Enforcement Investigations Center, Building 53, P.O. Box 25227, DFC, Denver, Colorado 80225. It would be particularly desirable to have methods listed for those compounds where none are given or where only spectro phatometric, elemental, or nonspecific methods are listed. Dean F. Hill, Chief Pesticide and Toxic Substances Branch, NEIC June 1991 ------- GLOSSARY 1. A A = Atomic Absorption 2. AX = Anion Exchange Chromatography 3. CAP = Capillary Column 4. CX = Cation Exchange Chromatography 5. EC = Electron Capture Detector 6. ES = ~ External Standard 7. FID = Flame lonization Detector 8. FPD = Flame Photometric Detector 9. GC = Gas Chromatography 10. HCD = Hall Electroconductivity Detector 11. HPLC = High-Performance Liquid Chromatography 12 1C = Ion Chromatography 13. IR = Infra-Red Spectrophotometry 14. IS = Internal Standard 15. MS = Mass Spectrometry 16. NP = Normal Phase 17. NPD = Nitrogen/Phosphorus Detector 18. RP = Reverse Phase 19. TCD = Thermal Conductivity Detector 20. TLC = Thin-Layer Chromatography 21. TMS = Trimethylsilyl 22. UV = Ultra-Violet Spectrophotometry 23. WB = Wide Bore Column Gas Chromatography ------- A-l Abate (see "Temephos" 845) Acaralate (see "Chloropropylate" 51 IB) Acarol (see "Bromopropylate" 511A) Acephate (2A/30560-19-1/3) 1. GC (TCD-IS) AMP VII (p. 364) 2. GC (FID-IS) NEIC-2A-A 3. GC (FID-IS) NEIC-2A-2 4. GC (FED-ES, mixtures with triforine and dicofol EPA-1(4) Acetic Acid (3/64-19-7/4) 1. Titrimetric (in acetates) NEIC-3-A 2. Titrimetric NEIC-3-B Acetic Anhydride (3A/108-24-7/5) 1. Titrimetric NEIC-3A-A Acetochlor (3B/34256-82-1/6) Acetone (4/67-64-1/7) 1. GC (FID-IS) AOAC-973.69 (p. 498) 2. GC (FID-IS) AOAC-975.06 (p. 232) Acifluorfen, Sodium Salt (755D/62476-59-9/12.5) 1. GC (TCD-IS; as ethyl ester) NEIC-755D-A 2. HPLC(RP-IS) EPA-K4) Acrolein (9/107-02-8/14) Acrylonitrile (10/107-13-1/15) Actidione (see "Cycloheximide" 270A) Agritox (see "Trichloronat" 456A) Akton (187A/1757-18-2/413) 1. GC (TCD-ES) NEIC-187A-A 2. IR NEIC-187A-B ------- A-2 Alachlor (11/15972-60-8/16) 1. GC (FID-IS) AOAC-985.04* (p. 174) 2. GC (FID-IS; microencapsulated) AOAC-988.03 (p. 174) 3. GC (TCD-IS) EPA-1 4. GC (FID-IS) EPA-2 5. IR NEIC-11-A 6. GC (FID-IS) AMP X (p. 257) 7. GC (FID-IS; Microtech®) EPA-K4) 8. GC (FID-ES) CAN-AKY.G Alanap-1 (see "Naptalam" 592) Alar (see "Daminozide" 808) Alcohols 1. GC (FID-IS) AOAC-1973.69 (p. 498) 2. GC (FID-IS) AOAC-975.06 (p. 232) Aldicarb (HA/116-06-3/18) 1. IR AOAC-974.04 (p. 212) 2. Colorimetric JAOAC 49. 399(1966) Aldoxycarb (11AA/1646-88-4/18.5) 1. HPLC (NP-IS) NEIC-11AA-A 2. IR NEIC-11AA-B Aldrin (12/309-00-2/19) 1. Total chlorine AOAC-961.04 (p. 175) 2. IR(HHDN) AOAC-961.05 (p. 175) 3. GC(FED-ES) AMP VI (p. 268) 4. IR NEIC-12-A n-Alkyl Dimethylbenzylammonium Chloride (see "Quaternary Ammonium Chlorides") AUantoin (24/97-59-6/82) d-trans-Alletnrin (25A/28057-48-9/84) 1. Titrimetric (Tech. allethrin) AOAC-953.05 (p. 164) 2. GC (FID-IS) AOAC-973.12(p. 165) 3. GC (Mosquito coils) NEIC-25A-A 4. GC (Mosquito coils) NEIC-25A-B 5. GC (Pynamin-Forte, mosquito mats)... NEIC-25A-C 6. GC (FID-IS; with permethrin and MGK-264) CAN; ALL/PFL/OCT.G ------- A-3 Allidochlor (284/93-71-0/649) 1. GC(FID-ES) CAN; ALO.G AUoxydim (25AA/55635-13-7/875.5) Allyl Alcohol (26/107-18-6/85) 1. IR CIPAC-1 (p. 730) 2. IR (with D-D mixture NEIC-26-A Allyl Isothiocyanate (27/57-06-7/86) Alphachloralose (876AA/15879-93-3/2015) 1. Total chlorine NEIC-876AA-A 2. Titrimetric NEIC-876AA-B 3. Colorimetric NEIC-876AA-C Alpha-Naphthylthiourea (see "Antu" 28) Altosid (see "Methoprene" 28AAA) Aluminum Phosphide (31/20859-73-8/92) 1. Titrimetric NEIC-31-A 2. GC (FPD/PH3 evol'n) see "Zinc Phosphide/EPA-2") Amdro® (see "Hydramethylnon" 642AB) Ametryn (431/834-12-8/94) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. Non-aqueous titration AMP IV (p. 15) 3. GC (FID-IS) NEIC-431-A Amiben (see "Chloramben" 168A) Amical 48 (see "Diiodomethyl-p-tolylsulfone" 353B) Amical 77 (see "p-Chlorophenyl diiodomethylsulfone" 207AB) Amidithion (3/919-76-6/95) Aminobutane (see "sec-Butylamine" 125) ------- A-4 Aminocarb (360/2032-59-9/870) 1. HPLC (RP-IS) AOAC-985.02* (p.212) 2. IR NEIC-360-A 3. HPLC (RP-ES) AMP XII (p. 4) 4-Aminopyridine (38/504-24-5/104) 1. UV EPA-1 2. GC (FID-ES; on sunflower seeds) NEIC-38-A 3-Amino-s-triazole (see "Amitrole" 40) Amitraz (374A/33089-61-1/105) 1. GC/IR (Cattle dips) JAOAC 61. 1516 (1978) 2. GC (FID-IS) NEIC-374A-A Amitrole (40/61-82-5/106) 1. Titrimetric AOAC-967.06 (p. 223) 2. Colorimetric EPA-1 3. GC (FID-IS) AMP XIII (p. 192) 4. Colorimetric (with simazine) NEIC-40-A Amizine (see Simazine" 740) Ammate (see "Ammonium Sulfamate" 47) Ammoniacal Copper Arsenite 1. Ammonia AWPA; A2-71-1 2. Arsenic AWPA; A2-71-2 3. Copper AWPA; A2-71-6 Ammonium Sulfamate (47/7-773-06-0/125) 1. Titrimetric EPA-1 Ammonium Sulfate (48/7783-20-2/126) p-tert-Amylphenol (50/80-46-6/131) and Potassium Salt (50A/53404-18-5/132) 1. GC (see "Phenols and Chlorophenols/EPA-6-Tent. & EPA-8-Tent") 2. HPLC (RP-ES) NEIC-50-A 3. HPLC (RP-ES) NEIC-50-B Anabasine (51/494-52-0/134) ------- A-5 Ancymidol (51/12771-68-5/135) 1. GC (FID-IS) AMP VIII (p. 477) Anethole (5 IB/104-46-1/136) Anfor (see "Glycophene" 470A) Anilazine (302/101-05-3/685) 1. HPLC(RP-IS) AOAC; 988.04 (p. 213) 2. Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1") 3. IR EPA-1 4. GC (TCD-IS) EPA-2 5. Hydrolyzable Chlorine AMP III (p. 81) 6. HPLC (RP-IS) NEIC-302-A Animert (see "Tetrasul" 213) Anthio (see "Formothion" 366C) Anthraquinone (52A/84-65-1/140) Antimony Potassium Tartrate (53/28300-74-5/141) 1. Titrimetric (see "Zinc Phosphide/EPA-1") Antimycin A (52B/1397-94-0/142) 1. UV EPA-1 (1) Antor (see "Diethatyl ethyl" 179D) ANTU (28/86-88-4/1472) 1. UV EPA-1 (3) 2. Titrimetric CIPAC-1 (p. 16) Aramite (131/140-57-8/307) 1. Total Chlorine AMP II (p. 36) A-rest (see "Ancymidol" 51 A) Aromatic Naphtha (70AA/-/-) 1. GC (FID-ES/CAP) CAN; HANap/POJ.G ------- A-6 Arsenic 1. Titrimetric (DSMA, etc.) EPA-1/3/4 2. Titrimetric (Inorganics) EPA-2 3. Distillation (Inorganics) AOAC-922.03 (p. 147) 4. Ion-exchange (Inorganics) AOAC-963.06 (p. 149) 5. lodometric Titration (Inorganics) AOAC-924.04 (p. 148) Arsenic (water soluble) 1. Titrimetric (Inorganic arsenicals) AOAC; 925.02 (p. 149) Aspon (845A/3244-90-4/1960) 1. GC (FID-IS) AMP XIII (p. 150) 2. IR NEIC-845A-A 3. GC (TCD-ES) NEIC-845A-B 4. TLC/Total P NEIC-845A-C 5. IR NEIC-845A-D Asulam (62A/3337-71-1/154) & Na Salt (62B) 1. Non-aqueous Titration AMP VII (p. 499) 2. HPLC (RP-ES) AMP XIII (p. 198) 3. UV EPA-l(l) Atraton (430B/1610-17-9/1032) 1. Titrimetric AMP IV (p. 28) Atrazine (63/1912-24-9/156) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1") 3. IR EPA-1 4. GC (FID-IS EPA-2 5. HPLC(RP-IS) EPA-3(3) 6. HPLC (RP-IS) EPA-4 (3) 7. GC (FID-IS; with metolachlor) (see "Mixed Pesticides EPA-2") 8. GC (FID-IS; with propachlor) NEIC-63-A 9. GC (FID-IS; with metolachlor EPA-1(4) 10. GC (FID-IS) CAN; ATR.G 11. GC (FID-ES; in fertilizers) CAN; EPT.G A--adex (see "Diallate" 299) ------- A-7 Available Chlorine 1. Titrimetric (NaOCl) AOAC; 935.07 (p. 160) 2. Titrimetric [(Ca(OCl)2] AOAC; 935.09 (p. 161) 3. Titrimetric (Chloramine T) AOAC; 935.10 (p. 161) 4. Titrimetric (Cleansers) NEIC-AvCl-A 5. Titrimetric (Cyanurates) NEIC-AvCl-B 6. Titrimetric (ASTM: Released 12) NEIC-AvCl-C Avenge (see "Difenzoquat methyl sulfate" 363A) Azak (see "Terbutol" 294) Azinphos Ethyl (344/2642-71-9/828) 1. GC (FID-ES) AMP VI (p. 397) Azinphos Methyl (374/86-50-0/899) 1. IR AOAC; 980.09* (p. 197) 2. HPLC(RP-IS) AOAC; 989.01 (p. 198) 3 IR EPA-1 4. Colorimetric AMP II (p. 233) 5. GC AMP VI (p. 397) 6. HPLC (NP-IS) NEIC-374-A Aziprotryne (63B/4658-28-0/158) Azobenzene (64/103-33-3/159) Azocyclotin (884AA/41083-11-8/2067) Azodrin (see "Monocrotophos" 377/6923-22-4/901) Azothoate (206A/5834-96-8/461) ------- B-l BAAM (see "Amitraz" 374A) Bacillus Thuringienisis (66/68038-71-1/161) Balan (see "Benefin" 130) Banamite (81E/25939-05-3/188) 1. GC (FID-IS) NEIC-81E-A Bandane (673/8029-29-6/1669) Banol (see "Carbonalate" 219) Banvel D (see "Dicamba" 295) Banvel T (see "Tricamba" 869) Barban (68/101-27-9/164) 1. UV AMP IV (p. 40) 2. HPLC (RP-ES) AMP XII (p. 179) 3. HPLC (RP-ES) NEIC-68-A Barium Metaborate (71/13701-59-2/167) Barthrin (71AA/70-43-9/168) Basalin (see "Fluchloralin" 460B) Baygon (see "Propoxur" 508) Bayleton (see "Triadimeform" 862AA) Bayluscide (see "Clonitralid" 314) Baytex (see "Fenthion" 456F) Benalaxyl (see "Galban" 471 AC Benazolin (202A/3813-05-6/451) Bendiocarb (360B/22781-23-3/172.5) 1. HPLC(RP-IS) AOAC-986.09* (p. 214) 2. IR EPA-1 (2) 3. UV EPA-2(2) 4. HPLC(RP-IS) EPA-3(3) 5. GC (FID-IS; pyrolysis) AMP X (p. 6) 6. IR (for phenolic by-product) AMP X (p. 8) 7. Preparation of analytical standard AMP X (p. 9) ------- B-2 Benfluralin (130/1861-40-1/299) 1. GC (FID-IS) AOAC-973.14 (p. 180) 2. UV AOAC-973.13 (p. 179) 3. IR EPA-1 4. GC (FID-IS) EPA-2 5. GC (FID-IS; separation from trifluralin) NEIC-130-A 6. GC (FID-IS) AMP VIII (p. 342) 7. GC (FID-IS; with trifluralin) JAOAC 73. 981 (1990) Benlate (see "Benomyl" 75A) Benodanil (see "lodobenzanilide" 501AB) Benomyl (75A/17804-35-2/173) 1. HPLC (RP-ES) AOAC-984.09* (p. 214) 2. IR EPA-1 3. UV EPA-2 4. Colorimetric JAOAC 58. 971 (1975) 5. IR AMPX(p. 159) 6. Nonaqueous Titration AMPX(p. 162) 7. UV (also determines MBC) JAOAC 62. 488 (1979) 8. HPLC (RP-ES; with carbaryl) CAN; BEN.L Bensulide (357/741-58-2/862) 1. GC (FID-IS) AMP VI (p. 672) 2. HPLC (NP-IS) AMP XIII (p. 219) 3. IR EPA-1 4. IR NEIC-357-A/B 5. HPLC (RP-ES) EPA-2(4) 6. HPLC (RP-ES) CAN;BEL.L Bentazon (509C/25057-89-0/174) 1. UV (also sodium salt) EPA-1 (1) 2. GC (FID-ES; after silylation NEIC-509C-A 3. HPLC (RP-IS) EPA-2 (4) 4. HPLC (RP-ES) CIPAC-IC (p. 1973) 5. HPLC (RP-ES) ; CAN; BEN.L Benthiocarb (see "Thiobencarb" 207DA) Benzadox (75C/5251-93-4/175) Benzaldehyde (76/100-52-7/177) ------- B-3 Benzene (77/71-43-2/178) 1. GC(FID-IS) AOAC-975.06 (p. 232) Benzene Hexachloride, Gamma Isomer (see "BHC, Gamma Isomer" 527) Benzipram (79D/35256-86-1) l,2-Benzisothiazolin-3-one (see "Proxel" 79A) Benzocaine (430A/94-09-7/1031) 1. Colorimetric AOAC-968.40 (p. 521) 2. UV AOAC-968.42 (p. 522) Benzole Acid (81/65-85-0/182) Benzomate (see "Benzoximate" 188G) Benzothienyl Methylcarbamate (81D/1079-33-0/187) 1. Hydrolysis/Distillation NEIC-81D-A Benzoximate (188G/29104-30-1/420) Benzoylprop-ethyl (431AA/22212-55-1/1033) 1. GC (FID-IS) CIPAC-1B (p. 1732) Benzthiazuran (81C/1929-88-0/186) 6-Benzyladenine(81EE/1214-39-7/1629.5) 1. TLC AMP X (p. 549) Benzyl Benzoate (82/120-51-4/191) 1. GC (TCD/FID-ES) NEIC-82-A Benzyl Bromacetate (82A/5437-45-6/192) 1. GC (TCD-ES) '. NEIC-82A-A o-Benzyl-p-Chlorophenol (83/120-32-1/193), K salt (83A) & Na salt (835) 1. GC (see "Phenols and Chlorophenols/EPA-6-Tent. and EPA-8- Tent.") 2. Total Chlorine (see Phenols and Chlorophenols/EPA-3") 3. HPLC (RP-ES) NEIC-83-A ------- Betanal (see "Phenmedipham" 648B) Betasan (see "Bensulide" 357) BHC, Gamma Isomer (527/58-89-9/1282) 1. IR AOAC-947.01 (p. 179) 2. Column Chromatography AOAC-949.05 (p. 176) 3. GC (FID-IS; shampoos and lotions) AOAC-984.05* (p. 178) 4. IR EPA-1 5. Hydrolyzable Chlorine CIPAC-1 (p. 986) 6. Polarography CIPAC-1 (p. 37) 7. GC NEIC-527-B 8. IR NEIC-1282-2 (VA) 9. GC (FID-IS; with maneb) JAQAC £2, 929(1986) 10. GC (FID-IS; in BHC) CIPAC-IC (p. 1977) 11. GC (FID-ES) CAN; LIN.G BHC (79/608-73-1/179) 1. IR AOAC-947.01 (p. 179) Bidisin (see "Chlorfenprop-methyl" 557A) Bidrin (see "Dicrotophos" 376) Bifenox (561AA/42576-02-3/200) 1. GC(TCD-IS) NEIC-561AA-A Binapacryl (86/485-31-4/201) 1. IR EPA-1 2. Colorimetric AMPV(p. 236) Bioban P-1487 (601 A/2224-44-4/1489) Biobor (627/14697-50-8/1548) 1. Titrimetric NEIC-627-A Bioquin (see "Copper 8-Quinolinolate" 253) Bioresmethrin (see "Resmethrin" 83E) ------- B-5 Biphenyl (87/92-52-4/202) 1. UV JAQAC4Q.282Q957) 2. GC (FID-IS) NEIC-87-A 3. UV (Fruit wraps NEIC-87-B Birlane (see "Chlorfenvinphos" 187) Bis(tributyltin)oxLde (101/56-35-9/229) 1. Titrimetric (see "Organotin Compounds/EPA-1) 2. GC (FID-IS) EPA-K4) Bithionol (852/97-18-7/1971) 1. UV NEIC-852-A Bladex (see "Cyanazine" 188C) B-Nine (see "Daminozide" 808) Boldo (see "Bromadialone" 486AB) Bolero (see "Thiobencarb" 207DA) Bolstar (see "Sulprofos"" 453AA) Bomyl (367/122-10-1/886) 1. IR NEIC-367-A Bone Oil (107/8001-85-2/239) Borax (108/1303-96-4/240) 1. Titrimetric (see "Boron Compounds/EPA-1") Bordeaux Mixture (-/8011-63-0/-) 1. Moisture AOAC-920.25 (p. 158) 2. Carbon Dioxide AOAC-920.26 (p. 158) 3. Copper (Electrolytic) AOAC-920.27A (p. 158) 4. Copper (Titrimetric) AOAC-920.27B (p. 158) 5. Mixtures with Paris Green AOAC-920.28 (p. 158) 6. Mixtures with Lead Arsenate AOAC-920.29 (p. 158) 7. Mixtures with Calcium Arsenate AOAC-925.03 .(p. 159) ------- B-6 Boron Compounds 1. Titrimetric EPA-1 Botran (see "Dichloran" 311) Bravo (see "Chlorothalonil" 215B) Brodifacoum(114AAA/56073-10-0/242.5) 1. HPLC(RP-IS) AOAC-983.11 (p. 224) 2. HPLC (RP-ES) NEIC-114AAA-A 3. HPLC (RP-IS) AMP XVI (p. 136) Bromacil (111/314-40-9/243) 1. GC (FID-IS) EPA-1 2. IR(HyvarX) NEIC-111-A 3. IR and UV (with diuron) NEIC-111-B 4. HPLC (Oil-base, with pentachlorophenol) NEIC-111-C 5. Non-aqueous Titration AMP V (p. 340) 6. HPLC (Pentachlorophenol & 2,4-D-IOE). .NEIC-111-D 7. Titrimetric CIPAC-IC (p. 1986) 8. GC (FID-IS/MB) CAN; BRO.G Bromadiolone (486AB/28772-56-7/250.1) 1. TLC/HPLC/IR/UV NEIC-486AB-A 2. HPLC (RP-IS) EPA-1 (4) 3. HPLC (RP-ES) CAN; BRA.L 4. HPLC (RP-IS; in baits, concentrates and wax blocks) AMP XVI (p. 142) 5. HPLC (RP-ES; in baits) JAOAC 73.429 (1990) Bromeflor (see "Ethephon" 426A) Bromethalin (561BB/63333-35-7/-) Brominated Salicylanilides (863/87-10-5/863) 1. UV EPA-1 Bromocyclen (116/1715-40-8/256) 2-Bromo-2-nitropropane-l,3-diol(116A/52-51-7/257) 1. GC (FID-IS) NEIC-116A-A ------- B-7 Bromophos (114E/2104-96-3/254) 1. IR CIPAC-1 (p. 730) 2. GC (FID-IS) NEIC-114E-A 3. Titrimetric AMP X (p. 33) Bromophos Ethyl (114D/4824-78-6/253) 1. Titrimetric AMP X (p. 43) Bromopropylate (511A/18181-80-1/259) 1. GC (FID-IS) NEIC-511A-A Bromoxynil (119/1689-84-5/261) 1. GC (FID-ES; hydrolysis/methylation) AMP V (p. 354) 2. Total Bromine AMP V (p. 353) 3. GC (FID-IS; methyl ester) CIPAC-IC (p. 1990) 4. Reference std. (purification and purity). .CIPAC-IC (p. 2326) Bromoxynil Octanoate (119A/1689-99-2/262) 1. GC (FID-IS) AOAC-980.05* (p. 180) 2. GC (FID-IS) CIPAC-IC (p. 2000) 3. Reference Std. (purification and purity). .CIPAC-IC (p. 2330) 4. GC (FID-IS) CAN; BSY.G Bronopol (see "2-Bromo-2-nitropropane-l,3-diol" 116A) Buctril (see "Bromoxynil" 119) Bufencarb (454C/2282-34-0/263) 1. GC (TCD-ES) AMP VII (p. 181) Bupirimate (119AAA/41483-43-6/264) 1. GC (FID-IS) NEIC-119AAA-A 2. GC (FID-IS) CIPAC-IC (p. 2007) 3. Reference Std. (purification and purity). .CIPAC-IC (p. 2340) 4. Identification (GC/TLC/IR/NMR) CIPAC-ID (p. 182) Busan 72 (853A/21564-17-0/1973) 1. Colorimetric JAQAC 59. 737 (1977) 2. IR NEIC-853A-A ------- B-8 Busan 73 (195D/16008-32-5/440) 1. Titrimetric NEIC-195D-A Busan 74 (853A/21564-17-0/1210) and (495A/29803-57-4/1973) 1. Titrimetric and IR NEIC-853A-A Busan 76 (266C/27983-69-3/586) 1. Hydrolyzable Bromine NEIC-266C-A 2. GC (FID-ES) NEIC-266C-B Busan 77 (678A/31512-74-0/1684) 1. Titrimetric (27.3% Chloride) AOAC- 960.14A(p. 228) Busan 90 (115/2491-38-5/255) 1. Hydrolyzable Bromine NEIC-115-A Busan 881 (402A/138-93-2/1715) and (696/137-41-7/1046) 1. Total Nitrogen NEIC-402A/696-A 2. UV NEIC-402A/696-B 3. CS2 Evolution AOAC-965.15 (p. 217) Butachlor (119B/23184-66-9/265) 1. GC (FID-IS) AOAC-986.04* (p. 181) 2. GC (FID-ES) CAN; BUH.G Butam (83EE/35256-85-0/266) Buthidazole (721A/55511-98-3/271) Butocarboxim(578AAA/34681-10-2/1435) Butonate (385A/126-22-7/914 Butoxycarboxim (120 A/34681-23-7/1432) Butoxypropylene Glycol (122/9003-13-8/276) Butralin (125E/33629-47-9/278) 1. GC (FID-IS) NEIC-125E-A Buturon (207E/3766-60-7/470) ------- B-9 sec-Butylamine (125/13952-84-6/281) 1. Distillation/Titration AMP VIII (p. 253) 2. UV AMP VIII (p. 255) 3. Colorimetric JAOAC 61.1001(1978) Butylate (434A/2008-41-5/1039) 1. GC (FID-IS) AOAC-974.05 (p. 221) 2. GC (TCD-ES) EPA-1 3. HPLC (NP-ES) EPA-2 4. GC (FID-IS) EPA-3 5. GC (FID-IS) EPA-4 6. GC (TCD-IS) EPA-5 7. HPLC (RP-ES) EPA-6(2) 8. GC (FID-IS) AMP XIII (p. 295) 9. IR NEIC-434A-A 10. GC(FID-ES) CAN; BYA.G 11. GC (FID-ES; in fertilizers) CAN; EPT.G p-tert-Butylphenol (130E/98-54-4/304, K salt (130F/3130-29-8/305) and Na salt (130G/5787-50-8/306) 1. GC (see "Phenols and Chlorophenols/EPA-8") Bux (see "Bufencarb" 454C) ------- C-l Cacodylic Acid (133/75-60-5/310) & Na salt (133A/124-65-2/311) 1. Polarography AOAC-977.28 (p. 501) 2. Titrimetric (see "Arsenic/EPA-4") 3. GC (ECD-ES; after derivitization with HI) NEIC-133-A 4. 1C (conductivity detector) JAOAC 72. 994 (1989) Cadium Chloride (135/10108-64-2/316) 1. A A..- EPA-1 Calcium Arsenate (137/7778-44-1/323) 1. Arsenious Oxide (Titrimetric) AOAC-921.05 (p. 154) 2. Total Calcium (Titrimetric) AOAC-921.06B (p. 155) 3. Total Calcium (Gravimetric AOAC-921.06C (p. 155) Calcium Cyanide (142/592-01-8/330) 1. Titrimetric AOAC-930.12 (p. 159) Calcium Hypochlorite (145/7778-54-3/333) 1. Titrimetric AOAC-935.09 (p. 161) 2. Titrimetric NEIC-145-A Calcium Polysulfide (150/1344-81-6/340) 1. Gravimetric (Water soluble sulfur) AOAC-920.31 (p. 159) 2. Thiosulfate Sulfur (Titrimetric) AOAC-920.32 (p. 160) 3. Sulfide (Gravimetric) AOAC-920.33 (p. 160) 4. Calcium (Gravimetric) AOAC-920.34 (p. 160) Camphechlor (see "Toxaphene" 861) Camphor (155/76-22-2/346) Capsaicin (158/404-86-4/350) Captafol (828/2939-80-2/351) 1. IR EPA-1 2. GC(TCD-ES) AMP V (p. 295) 3. HPLC(NP-IS) AMP X (p. 173) 4. GC (FID-IS) AMPX(p. 175) 5. IR CIPAC-Kp. 730) 6. HPLC (NP-IS) CAN; CAO.L ------- C-2 Captan (159/133-06-2/352) 1. GC(FID-IS) AOAC-971.05* (p. 181) 2. HPLC (NP-IS) AOAC-980.06* (p. 181) 3. Hydrolyzable Chlorine EPA-1 4. IR EPA-2 5. GC (FID-IS) EPA-3 (3) 6. HPLC (NP-IS) EPA-4 (3) 7. GC (FID-IS; with malathion/methoxychlor) NEIC-159-A 8. HPLC (NP-IS; Flowables) NEIC-159-B 9. IR CIPAC-1 (p. 172-4) 10. GC (FID-IS; with carbaryl and naled) NEIC-159-C 11. GC (FID-ES/MB) CAN-CAP.G 12. HPLC (NP-ES; with phosalone) CAN-PHE.L/CAP.L Carbamate Contamination 1. TLC NEIC-TLC-A Carbaryl (160/63-25-2/353) 1. IR AOAC-976.04 (p. 215) 2. UV EPA-1 3. HPLC (RP-ES) EPA-2 4. HPLC(RP-IS) EPA-3 (3) 5. HPLC (NP-IS) JAQAC 57. 648 (1974) 6. Colorimetric JAOAC 53. 896 (1970) 7. Near IR JAOAC 51. 379 (1968) 8. Colorimetric JAOAC 54.128 (1971) 9. Methylamine Distillation NEIC-160-A 10. HPLC (with malathion, folpet and dicofol) NEIC-160-B 11. IR NEIC-160-C 12. HPLC (NP-IS) JAQAC 63. 650 (1980) 13. HPLC (by-product assay) CIPAC-1 A (p. 1112) 14. HPLC (RP-IS) AMP XIII (p. 157) 15. GC (with captan and naled) NEIC-160-D 16. HPLC (RP-ES; with carbaryl) CAN; BEH.L 17. HPLC (RP-ES) CAN; CAV.L Carbetamide (159B/16118-49-3/354) 1. Hydrolysis/Distillation AMP VII (p. 511) Carbofuran (160A/1563-66-2/355) 1. HPLC (RP-IS) AOAC-986.10* (p. 215) 2. IR EPA-1 3. GC(FID-IS) NEIC-160A-A 4. Dimethylamine Distillation NEIC-160A-B ------- C-3 Carbofuran (160A/1563-66-2/355) (cont.) 5. HPLC(RP-IS) NEIC-160A-C 6. Colorimetric JAQAC 61.1513 (1978) 7. HPLC(RP-IS) NEIC-160A-D 8. GC (FID-IS) CAN-CBF.G 9. GC (FID-IS; flowables) CAN-CBF.G(a) 10. HPLC (RP-ES) CAN-CBF.L 11. GC (FID-ES/MB) CAN-CBF.G(2) Carbonalate (219/68989-02-6/507) 1. UV AMP V (p. 204) Carbon Dioxide (163/124-38-9/358) 1. Gravimetric (in Bordeaux mixture) AOAC-920.26 (p. 158) Carbon Disulfide (162/75-15-0/359) 1. GC (TCD/FID-ES) AOAC-966.05 (p. 164) Carbon Tetrachloride (164/56-23-5/360) 1. GC (TCD/FID-ES) AOAC-966.05 (p. 164) 2. GC(FID-ES) NEIC-FUM-A Carbophenothion (165/786-19-6/361) 1. UV AMP II (p. 548) 2. GC(FID-ES) AMP VI (p. 519) 3. IR NEIC-165-A Carbosulfan (463C/55285-14-8/-) 1. GC/IR/HPLC NEIC-463C-A/B/C Carboxin (165A/5234-68-4/362) 1. IR EPA-1 2. UV EPA-2(2) 3. HPLC (RP-ES) NEIC-165A-A 4. IR AMP VIII (p. 321) 5. Titrimetric AMP VIII (p. 322) 6. TLC/UV JAOAC 61.971 (1978) 7. GC (NPD-ES/CAP; on treated seeds) CAN-CBX.G 8. HPLC (RP-ES; with thiram) CAN-CBX.G/THR.L ------- C-4 Carbyne (see "Barban" 68) Cartap (360C/15263-52-2/871) 1. Polarographic AMP VII (p. 373) 2. Colorimetric (as hydrochloride) CIPAC-ID (p. 25) Carzol (see "Formetanate" 465A) Casoron (see "Dichlobenil" 297) CDAA (see "Allidochlor" 284)) CDEC (see "Sulfallate" 180) Chinomethionat (see "Oxythioquinox" 2110) Chlomethoxynil (-/ /-) 1. GC (FID-IS) AMPX(p. 269) Chloramben (168/302-17-0/374) 1. UV AOAC-971.06 (p. 182) 2. Titrimetric AMP V (p. 325) Chloramine T (170/127-65-1/381) 1. Titrimetric AOAC-935.10 (p. 161) Chloranil (171/118-75-2/382) 1. Reduction/Titration AMP III (p. 29) Chlorazine (172/580-48-3/383) Chlorbenside (173/103-17-3/384) 1. IR CIPAC-1 (p. 730) 2. IR (as Mitox) NEIC-173-A Chlorbromuron (173A/13360-45-7/385) 1. GC(FID-ES) EPA-1 2. TLC/UV AMP VII (p. 576) ------- C-5 Chlorbufam (575A/1967-16-14/1427) Chlordane, AG 1. IR AOAC-973.15 (p. 183) 2. GC (FID-ES; heptachlor content) AOAC-973.17 (p. 184) Chlordane, Technical (174/57-74-9/386) 1. Total" Chlorine (Sodium biphenyl reduction) AOAC-962.05 (p. 182) 2. Colorimetric AOAC-965.14 (p. 183) 3. Hexachlorocyclobutadiene Content (UV). AOAC-966.06 (p. 183) 4. Total Chlorine (Sodium) AMP II (p. 51) 5. Composition JAOAC 59. 696 (1976) 6. GC (EC-CAP) JAOAC 68.175(1985) 7. Qualitative Test NEIC-174-A 8. IR Characterization CEP AC-1A (p. 1119) 9. GC (FID-ES) CAN; CHD.G Chlordecone (275/143-58-0/621) 1. IR NEIC-275-A Chlordimeform (174A/6164-98-3/387) and Chlordimeform Hydrochloride (174B/19750-95-9/388) 1. GC (FID-IS) AOAC-985.05 (p. 184) 2. GC (FID-IS) EPA-K3) 3. Titrimetric & GC AMP VII (p. 214/215) 4. GC (FID-IS) NEIC-174A-A 5. TLC NEIC-174A-B Chlorofenac (see "Fenac" 882) Chlorfenethol (310/80-06-8/702) Chlorfenprop-methyl (557A/14437-17-3/1345) 1. GC (FID-ES) NEIC-557A-A Chlorfenson (see "Ovex" 624) Chlorfenvinphos (187/470-90-6/412) 1. GC (FID-IS) CIPAC-lA(p. 1132) 2. GC (FID-ES) CAN; CHM.G 3. HPLC (RP-ES) CAN; CHM.L ------- C-6 Chlorflurazole (327A/3615-21-2/796) Chlorflurecol (192A/2464-37-1/428) Chlorflurecol-methyl (see "Dichlorflurenol, methyl ester" 557B) Chloridazon (see "Pyrazon" 714C) Chlorimuron Ethyl (1938/90982-32-4/-) 1. HPLC (RP-IS) AMP XVI (p. 40) Chlorinated Camphene (see "Toxaphene" 861) Chlorinated Hydrocarbon Contamination 1. TLC AOAC-972.05 (p. 152) 2. TLC AMP VII (p. 6) 3. TLC NEIC-TLC-A Chlorinated Phenols (see "Phenols and Chlorinated Phenols") Chlorine Dioxide (179A/10049-04-4/392) 1. Titrimetric NEIC-179A-A Chlormephos (195B/24934-91-6/439) 1. GC (FID-IS) AMPX(p. 51) Chlormequat Chloride (191/999-81-5/425) 1. Chloride Titration CIPAC ID (p. 40) 2. Gravimetric AMP VII (p. 524) 3. Colorimetric AMP VII (p. 525) Chlornidine (89A/26389-78-6/207) Chloroacetic Acid (179B/79-11-8/393) Chlorobenzene (183A/108-98-7/402) Chlorobenzilate (434/510-15-6/1038) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. GC (FID-IS) EPA-1 (1) 3. GC (FID-IS) AMP VI (p. 319) 4. Total Chlorine AMP II (p. 66) ------- C-7 4-Chloro-2-cyclopentylphenol (186/13347-42-7/408) and Potassium salt (186AA) 1. GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.") 2. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") 3. GC (TCD-ES) NEIC-186-A 4. HPLC (RP-ES) NEIC-186-B 5-Chloro-2-(2,4-dichlorophenoxy)phenol(186A/3380-34-5/411) 1. UV NEIC-186A-A 2. Total Chlorine NEIC-186A-B 4-Chloro-3,5-dimethylphenol (see "4-Chloro-3,5-xylenol" 218) Chloroethylene bisthiocyanate (188D/24689-89-2/423) Chloroform (192/67-66-3/427) 1. GC (FID/TCD-ES) AOAC-975.06 (p. 232) a-Chlorohydrin (214 A/96-24-2/491) 1. GC (FID-IS) NEIC-214A-A Chloroneb (198/2675-77-67446) 1. UV EPA-K3) 2. GC (TCD-IS) AMP VII; (p. 658) l-Chloro-2-nitropropane (201A/2425-66-3/449) 1. GC (TCD-ES) AMP V (p. 306) Chlorophacinone(211C/3691-35-8/481) 1. UV EPA-l(l) 2. HPLC (RP-ES) EPA-2 (3) 3. UV EPA-3(3) 4. HPLC (RP-ES) JAOAC 65.927 (1982) 5. HPLC (RP-IS) AMP XII (p. 230) 6. HPLC (RP-ES) CAN; CJO.L 7. HPLC (RP-ES; in wax blocks and grain baits... AMP XVI (p. 122) p-Chlorophenoxyacetic Acid (204/122-88-3/454) 1. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent") ------- C-8 Chlorophenoxy Herbicides 1. Definition, Structure and Tech. Data EPA-1 2. UV(2,4-D and 2,4,5-T) EPA-2 3. HPLC (Acids and esters) EPA-3 4. GC (Butoxyethyl esters of 2,4-D and 2,4,5-T) EPA-4 5. GC (2,4-D and 2,4,5-TP in fertilizers) EPA-5 6. GC (as TMS ester) AMP VI (p. 630) 7. HPLC (RP-ES) AMP XII (p. 140) 8. Ester Volatility AOAC-960.10 (p. 153) 9. TLC NEIC-ClPh-A 10. TLC NEIC-ClPh-B 11. GC (FID-IS; as methyl ester) CIPAC-IC; p. 2257 12. UV & GC (Use-dilutions) NEIC-ClPh-C 13. HPLC(RP-IS) NEIC-ClPh-D 14. Chlorophenol impurities (HPLC) NEIC-ClPh-E 15. Chlorophenol impurities (Spectrophotometric) CIPAC-IC (p. 2250) 16. HPLC (RP-IS; screening) CAN-PHE.L 17. Enantiomer Resolution (GC and HPLC)... JAOAC 71. 614 (1988) p-Chlorophenyl Diiodomethyl Sulfone (207AB/-/463) 1. Titrimetric NEIC-207AB-A 5-Chloro-4-phenyl-3H- l,2-dithiol-3-one (207B/2425-05-0/465) 1. UV NEIC-207B-A 2-Chloro-4-phenylphenol (209/92-04-6/471) 1. GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.") 2. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") 4 & 6-Chloro-2-phenylphenol (210/607-12-5/472) (211/85-97-2/473) 1. GC (see "Phenols and Chlorophenols/EPA-6 & EPA-8-Tent.") 2. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") Chloropicrin (214/76-06-2/490) 1. GC (TCD-ES; with methyl bromide) NEIC-214-A 2. GC (TCD-ES) NEIC-214-B 3. GC (FID-IS; with 1,3-dichloropropenes) EPA-1 (4) 4. GC (FID-ES/MB; with 1,3-dichloropropene).. CAN-DIR.G/CKA.G Chloro-l,2-propanediol (see "a—Chlorohydrin" 214A) ------- C-9 Chloropropylate (51 IB/5836-10-2/492) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. IR NEIC-511B-A 3. GC (see "Bromopropylate/NEIC-511A-A") Chlorothalonil (215B/1897-45-6/497) 1. IR (EC and Flowable) EPA-1 2. GC (FID-IS) EPA-2 (2) 3. IR (Tech. and WP) NEIC-215B-A 4. GC (TCD/FID-IS) AMP VIII (p. 266) Chlorotriazine Herbicides 1. Labile Chlorine (Pot. titr'n) EPA-1 Chloroxuron (217B/1982-47-4/505) 1. Dimethylamine Distillation and TLC AOAC-977.06 (p. 216) 2. IR EPA-1 3. GC(TCD-IS) EPA-2 4-Chloro-3,5-xylenol (218/88-04-0/506) 1. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") 2. GC (see "Phenols and Chlorophenols/EPA-7-Tent.") 3. UV NEIC-218-A Chloroxynil (309A/1891-95-8/699) Chlorphoxim (219C/14816-20-7/465.5) 1. HPLC (RP-ES) CIPAC-ID (p. 43) Chlorpropham (510A/101-21-3/1243) 1. IR NEIC-510A-A 2. Hydrolysis/Titration CIPAC-1 (p. 224) 3. Total Chlorine (Sodium reduction) AMP VI (p. 53) 4. GC(TCD-ES) AMP VI (p. 612) 5. IR AMP XI (p. 280) 6. HPLC (see "Quintex") 7. GC (FID-IS; with propham) CIPAC-IC (p. 2025) 8. GC (FID-IS/MB) CAN; CLC.G ------- C-10 Chlorpyrifos (219AA/2921-88-2/509) 1. HPLC (RP-IS) AOAC-981.03* (p. 199) 2. GC (FID-IS) JAQAC 56. 1093(1973) 3. IR JAOAC 50. 861 (1967) 4. IR EPA-K2) 5. UV : EPA-2(2) 6. GC (TCD-IS) EPA-3 (2) 7. HPLC (RP-ES) EPA-4 (2) 8. IR..: NEIC-219AA-A 9. HPLC (RP-ES) NEIC-219AA-B 10. GC (FID-IS) NEIC-219AA-C 11. HPLC (NP-IS; encapsulated) AMP XII (p. 45) 12. GC (FID-ES/MB) CAN-CLD.G 13. HPLC (RP-ES) CAN-CLD.L 14. HPLC (RP-IS; with Diazinon) JAOAC H, 321 (1988) Chlorpyrifos Methyl (179AA/5598-13-0/510) 1. GC (FID-IS) NEIC-179AA-A Chlorsulfuron (654/64902-72-3A) 1. HPLC (RP-IS) EPA-1 (4) 2. HPLC (RP-IS) AMP XVI (p. 55) Chlorthiamid (326B/1918-13-4/-) 1. Qualitative CIPAC 1A (p. 1160) 2. Titrimetric CIPAC lA(p. 1164) Chlortoluron (216D/15545-48-9/500) 1. Distillation/Titration AOAC-977.06 (p. 216) 2. HPLC (NP-ES) AMP XII (p. 162) Cholecalciferol 1. HPLC (RP-ES) JQAC 70.1058(1987) Chromated Copper Arsenate 1. Total Chromium AWPA; A2-71-5 2. Total Arsenic AWPA; A2-71-2 3. Total Copper AWPA; A2-71-6 ------- C-ll Chromated Zinc Chloride 1. Total Zinc AWPA; A2-71-12 2. Total Chromium AWPA; A2-71-5 3. Total Chloride AWPA; A2-71-4 Chromium (220B/ - / -) 1. Colorimetric NEIC-220B-A Cidial (see "Phenthoate" 427B) Ciodrin (see "Crotoxyphos" 378) CIPC (see "Chlorpropham" 510A) Cisanalide (380A/34484-77-0/517) Classic (see "Chlorimuron Ethyl" 193B) Cloethocarb (73A/51487-69-5/-) Clonitralid (314/1420-04-8/707) 1. Colorimetric NEIC-314-A Copper (227/7440-50-8/526) and Copper Compounds 1. Electrolytic AOAC-922.05A (p. 149) 2. Titrimetric AOAC-922.05B (p. 149) 3. EDTA Titration NEIC-227-A 4. Colorimetric & AA (Water soluble from fungicides) AOAC-981.01 (p. 156) 5. Colorimetric NEIC-227-B 6. lon-Chromatography EPA-1 (4) Copper Acetoarsenite (see "Paris Green" 229A) Copper Carbonate (235/12069-69-1/535) 1. Copper (Electrolytic) AOAC-920.24A (p. 155) 2.. Copper (Titrimetric) AOAC-920.24B (p. 155) Copperized Chromated Zinc Arsenate 1. Total Copper AWPA; A2-71-6 2. Total Chromium AWPA; A2-71-5 3. Total Zinc AWPA; A2-71-12 ------- C-12 Copperized Chromated Zinc Arsenate (cont.) 1. Total Arsenic AWPA; A2-71-2 Copper Fungicides 1. Water Insoluble (Spectrophotometric and AA) AOAC-981.01 (p. 156) Copper Naphthenate (245/1338-02-9/550) 1. Electrolytic AOAC-964.03A (p. 155) 2. Titrimetric AOAC-964.03B (p. 155) Copper-8-quinolinolate (253/10380-28-6/560) Co-Ral (see "Coumaphos" 335) Cotoran (see "Fluometuron" 460A) Coumachlor (4A/81-82-3/8) 1. UV AMP III (p. 188) Coumafuryl (5/117-52-2/9) 1. UV EPA-1 2. UV EPA-2 3. UV NEIC-5-A Coumaphos (335/56-72-4/814) 1. IR EPA-1 2. HPLC (RP-ES) EPA-2 3. GC (FID-IS) EPA-3 4. GC (ECD-ES) AMP VI (p. 332) 5. UV (as Co-Ral) AMP II (p. 86) Coumatetryl (496A/5836-29-3/1213) Counter (see "Terbufos" 131A) Creosote (260/ - /569) m-Cresol (261A/108-39-4/571) ------- C-13 Crotoxyphos (378/7700-17-6/902) 1. GC (FID-IS) EPA-l(l) 2. GC(FID-ES) AMP VI (p. 325) 3. IR AMP V (p. 246) 4. IR (with dichlorvos) NEIC-378-A 5. GC (FPD-ES, with dichlorvos) NEIC-378-B Crufomate (263A/299-86-5/575) 1. IR EPA-1 2. GC(TCD-IS) EPA-2 Cryolite (264/15096-52-3/576) Cupric Oxide (265/1317-38-0/580) Cyanazine (188C/21725-46-2/422) 1. IR EPA-1 2. GC (FID-IS) NEIC-188C-A 3. Labile Chlorine (see "Chlorotriazine Herbicides/EPA-1") 4. HPLC(NP-ES) AMP X (p. 277) 5. IR (Water dispersables) AMP X (p. 283) 6. HPLC (RPNH2-IS) CIPAC-IC (p. 2040) 7. Reference Std. (Purification and purity).... CIPAC-IC (p. 2335) 8. HPLC(NP-ES) CAN; CUC.L 9. GC (FID-ES; in fertilizers CAN; EPT.G Cyanide 1. Titrimetric AOAC-920.30 (p. 159) Cyanuric Acid (862) (see "Available Chlorine") Cyanophos (268A/2636-26-2/591) Cycloate (432A/1134-23-2/1037) 1. GC (FID-IS) AOAC-974.05 (p. 221) 2. GC(TCD-ES) EPA-1 3. GC (FID-ES) EPA-2 4. GC (FID-IS) EPA-3 5. GC (FID/TCD-ES) AMP V (p. 492) 6. GC (FID-ES; in fertilizers) CAN; EPT.G Cycloheximide (270A/66-81-9/601) ------- C-14 Cycloprate(271BBB/54460-46-7/1158) 1. GC (FID-IS) NEIC-271BBB-A Cycocel (see "Chlormequat chloride" 191) Cyfluthrin (266E/68359-37-5/-) 1. HPLC(NP-IS) JAQAC 73. 595 (1990) Cygon (see "Dimethoate" 358) Cyhalothrin (271F/68085-85-8/-) 1. HPLC (RP-IS) AMP XIII (p. 11/15) 2. GC (ECD-IS; cattle dips) AMP XIII (p. 18) 3. HPLC (RP-IS; cattle dips) AMP XIII (p. 21) Cyhexatin (884A/13121-70-5/608) 1. HPLC (RP-IS) AOAC-988.02* (p. 225) 2. Nonaqueous Titration AMP VII (p. 419) Cymoxanil (271K/57966-95-7/-) Cyolane (see "Phosfolan" 268B) Cypendazole (560/28559-00-4/1370) 1. UV JAQAC 58. 971 (1975) Cypermethrin (271DD/66841-24-5/0 1. HPLC (RP-IS) AMP XIII (p. 37) 2. GC (FID-IS) AMP XIII (p. 41) 3. GC (FID-IS, CAP) AOAC-985.03 (p. 166) 4. GC (FID-IS).. AOAC-986.02* (p. 166) 5. GC (FID-IS) EPA-1 (4) 6. Identification (GC/HPLC/NMR/MS/IR) CIPAC-ID (p. 180) 7. GC(FID-ES) CAN; CYR.G Cyprazine (271D/22936-86-3/611) 1. Labile Chlorine (see "Chlorotriazine Herbicides/EPA-1") 2. GC (FID-ES) NEIC-271D-A 3. Non-aqueous Titration NEICT271D-B Cyprazole (271L/42089-03-2/612) ------- C-15 Cyprex (see "Dodine" 419) Cypromid (272/2759-71-9/613) Cyromazine (167B/66215-27-8/-) 1. GC (FID-IS; in Trigard®) EPA-1 (4) 2. GC (FID-IS; in Armor®) EPA-2 (4) 3. GC (FID-ES; in Armor® Premix) EPA-3 (4) Cythioate (272B/115-93-5/614) Cytrolane (see "Mephosfolan" 268H) ------- D-l 2,4-D (315/94-75-7/708) 1. HPLC (RP-IS; acids, esters, & amine salts) AOAC-978.05* (p. 184) 2. HPLC (RP-IS; with picloram) AOAC-976.03 (p. 196) 3. UV (with 2,4,5-T) (see "Chlorophenoxy Herbicides/EPA-2") 4. HPLC (see "Chlorophenoxy Herbicides/EPA-3") 5. GC (Butoxyethanol ester) (see "Chlorophenoxy/ Herbicides EPA-4") 6. GC (in fertilizers, with 2,4,5-T) (see "Chlorophenoxy Herbicides/EPA-5") 7. GC (FID-ES; as TMS ester) AMP VI (p. 630) 8. TLC NEIC-ClPh-A/B 9. IR CIPAC-1; p. 730 10. HPLC (Impurities) JAOAC 66. 804(1983) 11. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 12. Reference Std. (Purification and purity CIPAC-IC (p. 2307) 13. HPLC (RP-IS; with dicamba and mecoprop) AOAC-984.07* (p. 188) 14. HPLC (RP-ES; with dicamba and mecoprop in fertilizers) CAN; DGM.L Daconil 2727 (see "Chlorothalonil" 215B) Dacthal (see "DCPA" 382) Dalapon (273/75-99-0/615) and Sodium Salt (273A/127-20-8/618) 1. Titrimetric (Na Salt) AOAC-962.06 (p. 185) 2. HPLC (RP-ES) AOAC-984.06* (p. 185) 3. IR EPA-1 4. Colorimetric CIPAC-1 (p. 274/276) 5. GC (FID-ES; as methyl ester) NEIC-273-A Daminozide (808/1596-84-5/619) 1. Aqueous Base Titration AMP V (p. 501) 2. Non-aqueous Base Titration NEIC-808-A 3. Redox Titration NEIC-808-B Danitol (273H/39515-41-8/-) 1. GC (FID-IS) AMP XIII (p. 70) Dasanit (see "Fensulfothion" 343) ------- D-2 Dazomet (840/533-74-4/1952) 1. Hydrolysis/Titration AMP III (p. 121) 2. IR NEIC-840-A 3. Hydrolysis/Titration CIPAC-IC (p. 2074) 2,4-DB (316/94-82-6/765) 1. Titrimetric AMP V (p. 372) 2. GC (FID-ES; as TMS ester) AMP VI (p. 630) 3. HPLC(RP-IS) NEIC-316-A 4. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 5. Reference Std. (Purification and purity) CIPAC-IC (p. 2321) DBCP (see "l,2-Dibromo-3-chloropropane" 287) DCPA (382/1861-32-1/911) 1. GC (FID-ES; with HCB) AOAC-970.05* (p. 186) 2. IR AOAC-970.06* (p. 186) DDD (see "TDE" 307) D-D Mixture (324/78-87-5/790) 1. IR (with allyl alcohol) NEIC-324-A 2. GC (TCD-ES) NEIC-324-B 3. GC (with chloropicrin) [see "Chloropicrin/EPA-l(4)"] DDT (308/50-29-3/694) 1. Total Chlorine AOAC-947.02 (p. 186) 2. IR (Dusts and granules) AOAC-960.13 (p. 186) 3. IR (Emulsifiable concentrates) EPA-1 4. Hydrolyzable Chlorine JAOAC 29.188(1946) 5. IR NEIC-308-A 6. GC (FID-IS) JAOAC 73. 744 (1990) DDVP (see "Dichlorvos" 328) Deet (346/134-62-3/837) 1. IR EPA-1 2. GC(TCD-IS) EPA-2 3. GC (FID-IS) EPA-3 4. HPLC (NP-ES) EPA-4 (2) 5. GC (FID-IS; with MGK synergists) NEIC-346-A 6. GC (FID-ES) CAN; DEE.G ------- D-3 DEF (864/78-48-8/1991) 1. IR AMP IV (p. 90) Dehydroabietylamine (276/1446-61-3/624) 1. Colorimetric NEIC-276-A Delachlor (278AA/24353-58-0/631) 1. GC(TCD-IS) NEIC-278AA-A Delnav (see "Dioxathion" 393) Delphene (see "Deet" 346) Deltamethrin (463B/52918-63-5/ -) 1. HPLC (NP-ES) AMP XIII (p. 55) 2. HPLC (NP-ES) CIPAC-ID (p. 59) 3. Characterization (TLC/HPLC/IR/NMR/MS)...CIPAC-ID (p. 57) 4. HPLC (NP-ES) CAN; DBR.L 5. HPLC (NP-ES) JAOAC 73. 751 (1990) Demeton (279/8065-48-3/632) 1. GC(TCD-IS) AMP VI (p. 483) 2. Hydrolysis/Titration AMP II (p. 453) 3. IR NEIC-279-A Demeton-S-methyl (456/8022-00-2/1087) Demosan (see "Chloroneb" 198) 2,4-DEP (897/94-84-8/2105) 1. Titrimetric AMP IV (p. 127) Desmedipham (447AAA/13684-56-5/633) 1. HPLC (NP-IS) AMPX(p. 297) 2. Total Nitrogen AMPX(p. 295) 3. TLC NEIC-447AAA-A 4. Hydrolysis/Distillation NEIC-447AAA-B Desmetryne (509B/1014-69-3/1240) 1. GC (FID-IS) CIPAC-lB(p. 1765) ------- Dessin (see "Dinobuton" 128F) Destun (see "Perfluidone" 539C) Devrinol (see "Napropamide" 590A) Dexon (see "Fenaminosulf 359B) Dialifor (280A/10311-84-9/636) 1. UV NEIC-280A-A 2. HPLC(RP-IS) NEIC-280A-B Diallate (299/2303-16-4/682) 1. GC(TCD-IS) NEIC-299-A Diamidifos (654B/1754-58-1/650) Diazinon (342/333-41-5/824) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. GC (FID-IS; Encapsulated) AOAC-982.06 (p. 200) 3. GC(TCD-ES) EPA-1 4. HPLC (RP-ES) EPA-2 5. IR EPA-3 6. GC (FID-IS) EPA-4 7. TLC sIAQA£53,514(1970) 8. Potentiometric Titration NEIC-342-A 9. GC (FID-IS) NEIC-342-B 10. GC (FID-IS, with PBO) NEIC-342-C 11. GC (FID-ES/MB) CAN; DFN.G 12. HPLC (NP-ES) CAN; DFN.L 13. HPLC (RP-IS; with chlorpyrifos) JAOAC H, 321 (1988) Dibam (see "Sodium Dimethyldithiocarbamate" 762) Dibrom (see "Naled" 586) 1,2-Dibromo-3-chloropropane (287/96-12-8/656) 1. IR EPA-1 2. GC(TCD-ES) EPA-2 2,2-Dibromo-3-nitrilopropionamide(287AA/10222-81-2/659) 1. Titrimetric NEIC-287AA-A ------- D-5 Dibutalin (see "Butralin" 125E) Dibutyl Phthalate (292/84-74-2/668) Dibutyl Succinate (293/141-03-7/669) 1. Hydrolysis/Titration EPA-1 Dicamba (295/1918-00-9/671) 1. IR AOAC-969.07 (p. 187) 2. IR (with MCPA or 2,4-D) AOAC-971.07 (p. 187) 3. HPLC (HPLC-RP; with 2,4-D and mecoprop) AOAC-984.07* (p. 188) 4. GC (as TMS ester) AMP VI (p. 630) 5. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent") 6 GC (as methyl ester) NEIC-CIPh-A 7. GC (Use-dilutions, as methyl ester) NEIC-295-A 8. HPLC (RP-ES; with 2,4-D and mecoprop in fertilizers) CAN; DGM.L Dicapthon (296/2463-84-5/677) Dichlobenil (297/1194-65-6/678) 1. GC (FID-IS) AOAC-979.03 (p. 188) 2. IR EPA-1 3. GC (TCD-ES) NEIC-297-A 4. GC (FID-IS) AMPX(p. 313) 5. GC (FID-IS) CIPAC-lB(p. 1769) Dichlofenthion (321/97-17-6/679) Dichlofluanid (297A/1085-98-9/688) 1. HPLC (RP-ES) CIPAC-IC (p. 2083) 2. Hydrolyzable Chlorine CIPAC-1B (p. 1775) Dichlone (298/117-80-6/680) 1. IR EPA-1 Dichloran (311/99-30-9/704) 1. IR EPA-1 2. IR NEIC-311-A/B 3. GC (FID-IS) NEIC-311-C ------- D-6 Dichlorflurenol, methyl ester (557B/2536-31-4/1346) 1. TLC/UV AMP X (p. 527) 2. GC&HPLC JAQACfiQ, 728 (1977) 3. UV EPA-K3) Dichlormate (298A/1966-58-1/681) o-Dichlorobenzene (301/95-50-1/684) p-Dichlorobenzene (632/106-46-7/684.5) 1. IR EPA-1 2. GC(TCD-IS) EPA-2 Dichloroisocyanuric Acid (327/2782-57-2/795) (see "Available Chlorine") Dichlorophene (563/97-23-4/1376) 1. GC (TMS Der.) (see "Phenols and Chlorophenols/EPA-6-Tent.") 2. UV AOAC-972.48 (p. 529) 3. IR NEIC-563-A 4. GC (HCD-ES; as methyl ester) NEIC-563-B 5. HPLC (RP-ES) CAN; DIC.L 3,6-Dichloropicolinic Acid (323H/1702-17-6/791.05) l,3-Dichloropropene(324A/542-75-6/790.5) 1. GC (FID-ES) CAN; DIR.G 2. GC (FID-ES/MB; with chloropicrin) CAN; DIR.G/CKA.G Dichlorprop (320/120-36-5/774) 1. IR CIPAC-1 (p. 730) 2. Titration CIPAC-1A (p. 1211) 3. GC Characterization CIPAC-lA(p. 1211) 4. HPLC (RP-IS) CIPAC-IC (p. 2088) 5. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 6. Reference Std. (Purification and purity) CIPAC-IC (p. 2323) Dichlorvos (328/62-73-7/797) 1. IR (Baits and EC) AOAC-964.04 (p. 199) 2. IR (Sprays) AOAC-966.07 (p. 200) 3. GC (FID-ES; hexane/CH3CN partitioning) AMP VI (p. 529) 4. GC (FID-ES) NEIC-328-A 5. GC (FID/FPD-ES; with crotoxyphos) NEIC-328-B ------- D-7 Dichlorvos (328/62-73-7/797) (cont.) 6. GC (FPD-ES) NEIC-328-C 7. GC (Chloral content) CIPAC-1A (p. 1216) 8. Titrimetric CIPAC-1A (p. 1221) Diclofop-methyl (319A/51338-27-3/797.5) 1. GC (FID-IS) CIPAC-IC (p. 2098) 2. GC(FID-ES) NEIC-319A-A 3. GC (FID-ES/MB) CAN; DIB.G Dicofol (93/115-32-2/213) 1. Hydrolyzable Chlorine AOAC-976.02 (p. 189) 2. HPLC (RP-ES) AOAC-986.06* (p. 190) 3. IR CIPAC-1 (p. 730) 4. HPLC (RP-ES; with carbaryl, folpet, and malathion) NEIC-93-A 5. IR NEIC-93-B 6. HPLC (RP-ES) JAQAC 63.1296 (1980) 7. HPLC (with acephate and triforine) [see Acephate/EPA-1 (4)] Dicrotophos (376/141-66-2/900) 1. IR EPA-K3) 2. IR AMP V (p. 215) 3. GC (FID-ES) AMP VI (p. 290) 4. IR NEIC-376-A Dicryl (329/2164-09-2/798) Dieldrin (333/60-57-1/806) 1. Total Chlorine AOAC-961.04 (p. 175) 2. IR (HEOD) AOAC-961.05 (p. 175) 3. GC (FID-ES) AMP VI (p. 271) Dienochlor (see "Pentac" 274) Diethatyl-ethyl(179D/38727-55-8/808.5) 1. HPLC(RP-IS) NEIC-179D-A Difenacoum (-/56073-07-5/-) 1. HPLC (RP-ES) AMP XVI (p. 153) ------- D-8 Difenzoquat Methyl Sulfate (363A/43222-48-6/838) 1. UV AMP XI (p. 292) 2. HPLC(RP-IS) NEIC-363A-A 3. HPLC (RP-ES) JAOAC 63. 647 (1980 Diflubenzuron(346A/35367-38-5/839) 1. HPLC(RP-IS) AOAC-983.07 (p. 190) 2. HPLC(NP-IS) AMPX(p. 59) 3. UV AMP X (p. 62) 4. HPLC (NP-IS) NEIC-346A-A 5. HPLC (RP-ES) NEIC-346A-B Difolatan (see "Captafol" 828) Diiodomethyl-p-tolyl sulfone (353B/20018-89-1/853) 1. Titrimetric NEIC-353B-A Dilan (92A/117-26-0/212) Dimefox (843/115-26-4/1959) 1. Differential Hydrolysis CIPAC-1 (p. 330) Dimetan 1. Hydrolysis/Distillation AMP II (p. 166) Dimethoate (358/68-51-5/863) 1. GC (TCD-IS) EPA-1 (1) 2. GC (FID-IS) EPA-2 (1) 3. Hydrolysis/Distillation AMP II (p. 172) 4. Gravimetric AMP II (p. 174) 5. GC (FID-IS) AMP VI (p. 357) 6. Byproducts (TLC/GC) CIPAC-1A (p. 1232) 7. GC (FID or TSD-ES/CAP) CAN; DME.G Dimethrin (359/70-38-2/864) Dimethyl Phthalate (380/131-11-3/905) 1. GC (FID-IS; Mosquito clothwipes) EPA-1 (3) Dimetilan (496B/644-64-4/1214) ------- D-9 Dimilin (see "Diflubenzuron" 346A) Dimite (see "Chlorfenethol" 310) Dinitramine (335C/29091-05-2/917) 1. GC (FID-IS) EPA-1 (3) 2. GC (FID or TCD-IS) AMP VIII (p. 362) Dinitro-o-sec-Butyl Phenol (see "Dinoseb" 392DD) Dinobuton (128F/973-21-7/293) 1. Titrimetric AMP VII (p. 277) 2. Colorimetric AMP VIII (p. 278) 3. Non-aqueous Titration NEIC-128F-A Dinocap (391D/39300-45-3/927) 1. Total Nitrogen EPA-1 2. IR EPA-2 3. GC (FID-IS) AMP VI (p. 568) 4. Colorimetric JAOAC 57.653 (1974) 5. HPLC (RP-ES) NEIC-391D-A 6. Polarography NEIC-391D-B Dinoseb (392DD/88-85-7/932) 1. Stannous Chloride Reduction (see "Nitrophenols/EPA-1") 2. Total Nitrogen (see "Nitrophenols/EPA-2") 3. IR EPA-1 4. GC(TCD-ES) EPA-2 5. UV CIPAC-1 (p. 338) 6. HPLC (RP-ES) NEIC-392DD-A 7. UV (with Naptalam) NEIC-392DD-C 8. Redox Titration AMP V (p. 387) 9. HPLC (RP-ES) CAN; DOG.L Dinoterb (392F/1420-07-1/291) 1. GC (TCD or FID-IS; as methyl ester) CIPAC-1B; p. 1797 Dioxacarb (393A/6988-21-2/940) Dioxathion (393/78-34-2/941) 1. IR NEIC-393-A 2. GC (FID-ES; in formulations and dips)... JAOAC 5JJ,566 (1970) 3. HPLC(RP-IS) NEIC-393-B ------- D-10 Dioxathion (393/78-34-2/941) (cont.) 4. IR NEIC-393-C 5. GC (NPD-IS; in cattle dips) JAOAC 63. 33 (1980) 6. IR (Cattle dips) JAOAC 65. 930 (1982) Dioxin (393AB) 1. GC/MS (in 2,4-D and 2,4,5-T) EPA-1 (3) Diphacinone (394/82-66-6/942) 1. UV EPA-1 2. HPLC (RP-ES) EPA-2(2) 3. HPLC (RP-ES) EPA-3(3) 4. HPLC (RP-ES) JAOAC 65. 927 (1982) 5. UV NEIC-394-A 6. UV (0.1%) NEIC-394-B 7. HPLC (RP-ES) NEIC-394-C 8. HPLC (RP-ES; in cereal baits) AMP XVI (p. 130) Diphenamid (395/957-51-7/944) 1. IR EPA-1 (3) 2. GC (FID-IS) EPA-2(3) 3. IR AMP V (p. 376) 4. GC (FID-IS) AMP V (p. 376) Diphenylacetonitrile (396/86-29-3/945) 1. IR NEIC-396-A Diphenylamine (398/122-39-4/946) 1. GC (TCD-ES) EPA-1 (2) 2. GC (FID-IS/MB) CAN; DPF.G Dipropetryn (456AA/4147-51-7/952) Dipterex (see "Trichlorofon" 385) Diquat Dibromide (402/85-00-7/958) 1. UV AOAC-969.08 (p. 225) 2. HPLC (RP-IS) EPA-1 (3) 3. HPLC (RP-IS) NEIC-402-A Disodium N-(2-Hydroxyethyl)iminodiacetate (404/135-37-5/962) 1. Potentiometric Titration NEIC-404-A ------- D-ll Disulfoton (341/298-04-4/823) 1. GC (FID-IS) AOAC-980.10* (p. 201) 2. IR EPA-1 3. GC (FID-IS) EPA-2 4. GC (FID-IS) EPA-3 (3) 5. Hydrolysis/Titration AMP II (p. 189) 6. IR AMP II (p. 190) 7. IR sIAQAQ 41, 257(1974) 8. GC(TCD-ES) NEIC-341-A 9. GC (FID-IS; with fensulfothion) (see "Mixed pesticides EPA-3") 10. HPLC (NP-ES) CAN; DSN.L Di-Syston (see "Disulfoton1' 341) Dithane M-45 (913A/8018-01-7/2134) 1. Titrimetric CIPAC-1A (p 1289) Dithianon (349B/3347-22-6/843) 1. IR JAOAC 52. 659 (1969) 2. Colorimetric AMPX(p. 183) 3. Colorimetric NEIC-349B-A 4. Colorimetric CIPAC-IC (p. 2106) Dithiocarbamates 1. Carbon Disulfide Evolution AOAC-965.15 (p. 217) 2. Qualitative Test JAOAC 55. 939 (1972) 3. Qualitative Test CIPAC-ID (p. 179) 3. Degradation Product Analyses AMP XI (p. 197) Diuron (410/330-54-1/975) 1. Hydrolysis/Distillation EPA-1 2. HPLC (RP-ES) EPA-2 3. UV EPA-3 4. IR EPA-4 5. IR CIPAC-1; p. 731 6. HPLC (Use-dilutions) NEIC-410-A 7. HPLC (NP-IS) AMP XII (p. 162) 8. HPLC(RP-IS) AMP XIII (p. 227) 9. Tetrachloroazobenzene content (GC) JAQAC 23, 749 (1990) DNBP (see "Dinoseb" 392DD) Dodemorph (268C/31717-87-0/596) ------- D-12 Dodine (419/2439-10-3/1000) 1. Non-aqueous Titration AOAC-970.07 (p. 225) Dowicil 100 (181/4080-31-3/397) 1. Titrimetric NEIC-181-A 2. TLC JAOAC 63. 864 (1980) Dowicil S-13 (see "2,3,5,6-Tetrachloro-4-(methylsulfonyl)pyridine" 830A) 2,4-DP (see "Dichloroprop" 324) Drazoxolon (207C/5707-69-7/466) 1. Colorimetric AMP VII (p. 667) Drepamon (see "Tiocarbenil" 82AA) DSMA (405/144-21-8/963) 1. Titrimetric (see "Arsenic Compounds/EPA-3-Tent. & EPA-4") Duraset (860/85-72-3/1985) 1. Titrimetric AMP V (p. 407) Dursban (see "Chlorpyrifos" 219AA) Du-Ter (see "Triphenyltin Hydroxide" 896E) Dyfonate (see "Fonofos" 454B) Dylox (see "Trichlorofon" 385) Dymid (see "Diphenamid" 395) Dyrene (see "Anilizine" 302) ------- E-l Edifenphos (434B/17109-49-8/1041) 1. GC (FID-IS) EPA-1 (4) 2. GC(TCD-IS) NEIC-434B-A 3. HPLC (RP-ES) JAOACfiS, 138(1985) EDTA (438/60-00-4/1048) 1. Titrimetric NEIC-438-A 2. Colorimetric NEIC-438-B 3. Qualitative Test NEIC-438-C Endosulfan (420/115-29-7/1001) 1. GC (FID or TCD-IS) AOAC-983.08 (p. 191) 2. Hydrolysis/Titration EPA-1 3. IR EPA-2 4. GC (TCD-IS) EPA-3 5. GC (FID-IS) EPA-4 6. GC (FID-IS) EPA-5 (2) 7. GC(TCD-ES) AMP VI (p. 511) 8. Chromatography/IR CIPAC-1 (p. 361) 9. GC (FID-IS) CIPAC-IC (p. 2110) 10. GC (FID-ES/MB) CAN; ENA.G Endothall (421/129-67-9/1002) 1. Oxidation/Titration EPA-1 2. GC(FID-ES) EPA-2 3. GC (TCD or FID-ES) AMP X (p. 330) 4. GC(TCD-ES) NEIC-421-A 5. Titrimetric NEIC-421-B Endrin (423/72-20-8/1009) 1. IR AOAC-961.05 (p. 175) 2. Total Chlorine AOAC-961.04 (p. 175) 3. IR NEIC-423-A 4. IR (with methyl parathion) CIPAC-1B (p. 1819) Enide (see "Diphenamid" 395) Entex (see "Fenthion" 456F) Epichlorohydrin (424/106-89-8/1010) 1. GC (FID-ES) EPA-1 (3) ------- E-2 EPN (454/2104-64-5/1808) 1. Potentiometric Titration NEIC-454-A 2. GC (FID-IS) NEIC-454-B Eptam (see "EPTC" 435) EPTC (435/759-94-4/1042) 1. GC (FID-IS) AOAC-974.05 (p. 221) 2. GC(TCD-IS) EPA-1 3. HPLC(NP-ES) EPA-2 4. GC (FID-IS) EPA-3 5. GC (FID-IS) EPA-4 6. GC(TCD-IS) EPA-5 7. HPLC (RP-ES) EPA-6 (2) 8. IR NEIC-435-A Erbon (425/136-25-4/1012) 1. GC (FID-IS) JAOAC 56.1087 (1973) 2. Hydrolysis/Titration NEIC-425-A Ethafluralin (453B/55283-68-6/1015) 1. UV AMP X (p. 343) 2. GC (FID-IS) AMPX(p. 345) Ethanol (430/64-17-5/17) Ethephon (426A/16672-87-0/1018) 1. Titrimetric NEIC-426A-A 2. GC (FID-ES; as methyl ester) NEIC-426A-B Ethidimuron (902C/30043-49-3/-) Ethiolate (434AA/2941-55-1/1019) Ethion (427/563-12-2/1020) 1. HPLC(RP-IS) AOAC-979.04 (p. 201) 2. IR EPA-1 3. GC (TCD-ES) EPA-2 4. HPLC (RP-ES) CAN; ETI.L 5. HPLC (NP-ES; in oil base) CAN; ETI.L (2) ------- E-3 Ethirimol (128H/23947-60-6/297) 1. GC (FID-IS; as TMS derivative) AMP VIII (p. 288) 2. UV AMP VIII (p. 287) 3. TLC AMP VIII (p. 287) 4. GC (FID-IS; as TMS derivative) CIPAC-ID (p. 72) 5. Identification (GC/TLC/IR/NMR) CIPAC-ID (p. 182) 6. Reference Std. (Purification and purity) CIPAC-ID (p. 202) Ethofumesate(427BB/26225-79-6/1020.5) 1. GC (FID-IS) AMPX(p. 355) 2. GC (FID-IS) EPA-1 (2) Ethoprop (434C/13194-48-4/1021) 1. IR EPA-1 2. GC(TCD-IS) EPA-2 3. GC (FID-IS) EPA-3 4. GC (FID-IS NEIC-434C-A 5. GC (TCD-IS) AMP XVI (p. 7) Ethoxyquin (427D/91-53-2/1024) 1. Non-aqueous Titration NEIC-427D-A 2. Fluorescence NEIC-427D-B Ethrel (see "Ethephon" 426A) Ethylene Dibromide (439/106-93-4/1056) 1. GC (TCD or FID-ES) AOAC-966.05* (p. 164) Ethylene Dichloride (440/107-06-2/1057) 1. GC (TCD-ES) AOAC-966.05* (p. 164) 2. GC (FID) NEIC-FUM-A Ethylene Glycol (441/107-21-1/1058) 1. GC (TCD-ES) NEIC-441-A Ethylene Oxide (443/75-21-8/1061) Ethylene Thiourea (443AA/96-45-7/-) 1. GC (FID & TCD) EPA-1 (1) 2. GC&TLC JAOAC 55.923 (1972) 3. UV NEIC-443AA-A ------- E-4 Ethylene Thiourea (443AA/96-45-7/-) (cont.) 4. TLC NEIC-443AA-B 5. HPLC (RP-IS) CIPAC-IC (p. 2298) Ethyl Guthion (see "Azinphos ethyl" 344) 2-Ethyl-l,3-hexanediol (445/94-96-2/1064) 1. Acetylation EPA-1 2. GC(TCD-IS) EPA-2 Etrimfos (365AAA/38260-54-7/1091) 1. GC (FID-IS) AMP XI (p. 128) ETU (see "Ethylene Thiourea" 443AA) ------- F-l Falone (see "2,4-DEP" 897) Famphur (456D/52-85-7/1093) 1. Colorimetric NEIC-456D-A 2. IR (Encapsulated) JAOAC 61.1526(1978) 3. HPLC (RP-ES) NEIC-456D-B 4. GC (FID-IS) NEIC-456D-C Fenac (882/85-34-7/2050) Fenaminosulf (359B/140-56-7/866) 1. Colorimetric AMP III (p. 51) Fenarimol (207AA/60168-88-9/1097) 1. GC(FID-ES) AMP XIII (p. 175) Fenazaflor (654A/14255-88-0/1598) 1. UV NEIC-654A-A Fenbucarb (-/3766-81-2/-) 1. TUC/Colorimetric CIPAC-ID (p. 87) 2. HPLC (NP-IS) CIPAC-ID (p. 89) Fenbutatin Oxide (see "Hexakis" 481DD) Fenitrothion (373/122-14-5/897) 1. GC (FID-IS) AOAC-985.07 (p. 202) 2. GC (FID-IS) AOAC-989.02 (p. 203) 3. Hydrolysis/UV AMP VII (p. 461) 4. GC (FID-IS) NEIC-373-A 5. Titrimetric CIPAC-1A (p. 1255) 6. GC (FID-ES) CAN; FDN.G Fenoprop (see "Silvex" 2663) Fenoxycarb (652C/79127-80-3/-) 1. HPLC(RP-IS) AMP XVI (p. 23) Fenpropathrin (see "Danitol" 273H) ------- F-2 Fenson (207/80-38-6/462) 1. Hydrolysis/Titration CIPAC-1 (p. 392) 2. IR CIPAC-1 (p. 730) Fensulfothion (343/115-90-2/825) 1. GC (FID-IS) AOAC-986.07* (p. 203) 2. HPLC(RP-IS) AOAC-983.09* (p. 204) 3. GC (FID-IS, with disulfoton) (see "Mixed Pesticides EPA-3") 4. Titrimetric AMP VII (p. 256) 5. IR NEIC-343-A 6. HPLC(NP-ES) CANjFDS.L Fenthion (456F/55-38-9/1098) 1. GC(FID-ES) NEIC-456F-A 2. GC (FID-IS; in oil) NEIC-456F-B 3. IR AMP II (p. 45) 4. GC (FID-ES; in feeds) AMP VI (p. 301) 5. IR NEIC-456F-C 6. Colorimetric CIPAC-1B (p. 1831) Fentin Acetate (896C/900-95-8/2098) 1. Potentiometric Titration AOAC-979.02 (p. 156) 2. GC (FID-IS, with maneb) AOAC-984.04 (p. 157) Fentin Hydroxide (see "Triphenyltin Hydroxide" 896E) Fenuron (457/101-42-8/1099) 1. Dimethylamine Distillation NEIC-457-A 2. HPLC (see "Quintex") Fenvalarate (77A/51630-58-1/590) 1. HPLC(RP-IS) NEIC-77A-A 2. HPLC (RP-ES) AMP XIII (p. 124) 3. GC (FID-IS) CIPAC-ID(p. 101) 4. Identification (GC/HPLC/IR/NMR/MS) CIPAC-ID (p. 180) 5. GC (FID-ES/MB) CAN; FEW.G 6. HPLC (NP-ES/chiral separation) AMP XVI (p. 31) Ferbam (458/14484-64-1/1100) 1. Carbon Disulfide Evol'n AOAC-965.15 (p. 217) 2. UV CIPAC-1 (p. 398) ------- F-3 Ferrous Ammonium Sulfate (459B/10045-89-3/1104) 1. Titrimetric NEIC-459B-A Ferrous Sulfate (460/7782-63-0/1105) Ficam (see "Bendiocarb" 360B) Flamprop-methyl(903E/52756-22-6/-) Flammability 1. Flame Projection EPA-1 (2) 2. Closed Drum EPA-2 (2) Fluazifop-butyl(460C/69806-50-4/-) 1. GC (FID-IS) AOAC-984.08* (p. 192) 2. GC (FID-ES/MB) CAN; FKA.G Fluchloralin (460B/33245-39-5/1106) 1. GC(TCD-IS) EPA-1(4) Flucythrinate (2AA/70124-77-5/0 1. GC (FID-IS) NEIC-2AA-A Fluenetil (462A/4301-50-2/1112) Fluometuron (460A/2164-17-2/1107) 1. GC (FID-IS; TFA derivative) AOAC-977.07 (p. 218) 2. IR EPA-1 3. UV EPA-2 (2) 4. Dimethylamine Distillation AMP VII (p. 574) 5. Potentiometric Titration NEIC-460A-A 6. HPLC(RP-IS) AMP XIII (p. 241) Fluor Chrom Arsenate Phenol 1. Total Fluorine AWPA-A2-71-8 2. Total Chromium AWPA-A2-71-5 3. Total Arsenic AWPA-A2-71-2 4. Dinitrophenol Content AWPA-A2-71-7 5. Pentachlorophenol Content AWPA-A2-71-6 ------- F-4 Fluoridamid (889B/47000-92-0/1108) 1. GC (FID-IS) AMPX(p. 535) 2. Titrimetric NEIC-889B-A Fluoride 1. Titrimetric (Travers) AOAC-929.04 (p. 150) 2. Titrimetric (Mod. Travers) AOAC-921.04 (p. 151) 3 Distillation/Titration AOAC-933.03 (p. 152) 4. Spec. Ion Electrode (Haz. substances) AOAC-973.10 (p. 232) Fluoroacetamide (461/640-19-7/1109) Fluoroacetic Acid (462/144-9-0/1110) and Sodium Salt (770/62-74-8/1851) 1. HPLC (RP-ES; as ester) JAOAC 67.1058 (1984) 2. HPLC (IC-ES; in livestock collars) NEIC-462-A Fluorodifen (462AA/15457-05-3/1111) 1. GC (TCD-ES) NEIC-462AA-A Fluoromidine (217AA/13577-71-4/504) Flurecol butyl ester (130B/2314-09-2/302) 1. UV (as acid) AMP XI (p. 321) 2. GC (FID-IS; as butyl ester) AMP XI (p. 322) Fluridone (130C/59756-60-4/1113.5) 1. HPLC(RP) AMP XIII (p. 249) 2. GC (FID-IS) AMP XIII (p. 252) Fluriprimidol (266D/56425-91-3/-) Fluvalinate (934/69409-94-5/0 1. IR NEIC-934-A 2. HPLC (RP-ES) NEIC-934-B 3 HPLC (RP-IS) AMP XIII (p. 82) 4. HPLC (RP-IS) CAN; FVL.L 5. HPLC (RP-IS) NEIC-934-C 6. GC (FID-IS/MB) NEIC-934-D Folcidin (see "Cypendazole" 560) Folex (see "Merphos" 865) ------- F-5 Folpet (464/133-07-3/1114) 1. HPLC (NP-IS) AOAC-977.03 (p. 192) 2. IR EPA-1 3. GC(FID-ES) AMP VI (p. 546) 4. HPLC (RP-ES; with carbaryl, malathion and dicofol NEIC-464-A 5. HPLC (NP-IS) NEIC-464-B 6. HPLC(RP) JAOAC 66. 789 (1983) 7. HPLC(NP-ES) CAN; FOL.L Fonofos (454B/944-22-9/1081) 1. IR EPA-1 (3) 2. GC (FID-IS) AMP VII (p. 270) Formaldehyde (465/50-00-0/1115) 1. Oxidation/Titration AOAC-898.01* (p. 226) 2. Cyanide Method (Dilute (Sol'ns) AOAC-897.01 (p. 226) 3. Cyanide Method (See Disinfectants) AOAC-931.03 (p. 226) Formetanate (465A/22259-30-9/1116) & Formetanate Hydrochloride (465B/23422-53-9/1117) 1. Titrimetric AMP VII (p. 281) 2. TLC NEIC-465A-A Formothion (366C/2540-82-1/884) 1. GC(FPD-IS) AOAC-974.03 (p. 204) Fosamine Ammonium (465G/25954-13-6/1117.5) 1. HPLC (AX-IS) NEIC-465G-A 2. HPLC(AX-ES) NEIC-465G-B Fospirate (465CC/5598-52-7/1118) 1. UV NEIC-465CC-A Fumaric Acid (465E/110-17-8/1119) Fumarin (see "Coumafuryl" 5) Fumigants 1. GC (TCD/FID-ES) AOAC-966.05 (p. 164) 2. GC (FID) NEIC-FUM-A ------- F-6 Fumite (see "Tecnazene" 831) Fundal (see "Chlordimeform" 174A) Funginex (see "Triforine" 890AA) Furadan (see "Carbofuran" 160A) Furamethrin 1. GLC (Mosquito Coils) NEIC-Fur-A Furethrin (465F/17080-02-3/1121) ------- G-l Galban (471AC/71626-11-4/-) Galecron (see "Chlordimeform" 174A) Gamma BHC (see "BHC, Gamma Isomer" 527) Gardona (see "Tetrachlorvinphos" 217A) Genite 923 (322/97-16-5/780) 1. IR NEIC-322-A Gibberellic Acid (467/77-06-5/1123) 1. Fluorimetric AMP V (p. 415) 2. UV JAQA£fiO_, 859 (1977) 3. TLC (Gibberellins AjA? AMP X (p. 548) Glean (see "Chlorosulfuron" 194AA) Glutaraldehyde (468/111-30-8/1125) 1. Titrimetric NEIC-468-A 2. GC (FID-IS) NEIC-468-B Glycerol (469/56-81-5/1126) Glycolic Acid (470/79-14-1/1127) Glycophene (470A/36734-19-7/782) 1. HPLC (NP-IS) AMP XI (p. 250) 2. GC (FID-IS) AMP XI (p. 250) 3. GC (TCD-IS) NEIC-470A-A 4. GC (FID-IS) NEIC-470A-B 5. HPLC (RP-IS) CAN; IPO.L Glyodin (471/556-22-9/1130) 1. Titrimetric AMP III (p. 100) Glyphosate (661A/1071-83-6/1131) 1. HPLC(AX-ES) AOAC-983.10* (p. 205) 2. HPLC (RP/NH2-ES) NEIC-661A-A 3. UV NEIC-661A-B 4. HPLC (RP/NH2-RI) EPA-1 (4) 5. HPLC (AX-ES) CAN; GLP.L 6. HPLC (AX-ES) AMP XVI (p. 72) ------- G-2 Glyphosine (471A/2439-99-8/1133) Goal (see "Oxyfluorfen" 1888AAA) Gophacide (91A/4104-14-7/209) 1. HPLC (RP-ES) NEIC-91A-A Gossyplure HF (471AAA/53042-79-8/1156) Griseofulvin (471B/126-07-8/1134) 1. UV AOAC-966.30 (p. 130) Guthion (see "Azinphos Methyl" 374) ------- H-l Halazone (326/80-13-7/792) 1. Titrimetric NEIC-326-A HCB (see "Hexachlorobenzene" 477) Heptachlor (474/76-44-8/1139) 1. Labile Chlorine AOAC-962.07 (p. 193) 2. GC (FID-IS) AOAC-968.04 (p. 193) 3. IR EPA-1 4. IR NEIC-474-A Herban (see "Norea" 607) Hexachlorobenzene (477/118-74-1/1149) 1. GC (FID-ES; in dacthal) AOAC-970.05 (p. 186) Hexachlorocyclopentadiene (478/77-47-4/1151) 1. UV (in tech. chlordane) AOAC-966.06 (p. 183) Hexachlorophene (566/70-30-4/1383) 1. UV AOAC-974.28 (p. 363) 2. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") 3. GC (see "Phenols and Chlorophenols/EPA-8-Tent.") 4. HPLC (RP-ES) EPA-1 (3) 5. IR NEIC-566-A 6. GC (ECD-ES; as methyl ester) AMPX(p. 194) Hexakis (481DD/13356-08-6/1165) 1. Titration CIPAC-ID (p. 79) 2. IR NEIC-481DD-A 3. BHTO impurity (TLC) CIPAC-ID (p. 81) Hexamethylene Tetramine (482/100-97-0/1169) 1. Distillation/Titration NEIC-482-A Hexazinone (271AA/51235-04-2/1172) 1. GC (FID-IS) NEIC-271AA-A 2. HPLC (RP-IS) EPA-1 (4) 3. GC (FID-IS) EPA-2 (4) 4. GC (FID-ES) CAN; HXO.G ------- H-2 Hinosan (see "Edifenphos" 434B) Hormodin (see "Indole-3-butyric Acid" 499) HPMTS (495A/29803-57-4/1210) 1. Titrimetric NEIC-495A-A Hydramethylnon (642AB/67485-29-4/1763) Hydrochloric Acid (486/7647-01-0/1180) 1. Titrimetric NEIC-486-A 2. Titrimetric NEIC-486-B Hydroprene (456H/41096-46-2/1182) 1. GC (FID-IS; with propetamphos) NEIC-456H-A 2. GC (FID-IS) NEIC-456H-B 2-[(Hydroxymethyl)amino]ethanol(494C/34375-28-5/1204) 3-Hydroxy-5-methylisoxazole (-/10004-44-1/-) 1. GC (FID-IS) AMPX(p. 218) 2-(Hydroxymethyl)-2-nitro-l,2-propanediol (495/126-11-4/1207) 1. Colorimetric NEIC-495-A Hymexazol (see "3-Hydroxy-5-methylisoxazole") Hyvar (see "Isocil" 504) ------- 1-1 Igran (see "Terbutryn" 125D) Imidan (see "Phosmet" 543) Indalone (128/532-34-3/287) Indole-3-butyric Acid (499/133-32-4/1219) 1. UV EPA-1 Iodine (and Iodine Complexes) (501/7553-56-2/1222) 1. Potentiometric Titration NEIC-501-A lodobenzanilide (501AB/15310-01-7/1223) Iodofenphos(309B/18181-70-9/701) loxynil (353A/1689-83-4/852) 1. GC (FID-ES; as methyl ester) AMP V(p. 354/428) IPC (see "Propham" 510) Iprobenfos (-/26087-47-8A) 1. GC (FID-IS) CIPAC-ID(p. 112) 2. GC (FID-IS) CAN; IPR.G Iprodione (see "Glycophene" 470A) Irgasan DP 300 (186A/3380-34-5/411) 1. UV NEIC-186 A-A 2. Total Chlorine NEIC-186 A-B 3. HPLC (RP-IS) NEIC-186 A-C Isobenzan (609/297-78-9/1508) 1. IR NEIC-609-A 2. IR NEIC-609-B Isotil (504/314-42-1/1232) Isofenphos (447AB/25311-71-1/1391.3) 1. GC (FID-IS) AOAC-987.01* (p. 205) ------- 1-2 Isolan (511D/119-38-0/1245) 1. Dimethylamine Distillation AMP II (p. 258) Isophorone (506/78-59-1/1235) Isoprocarb (512B/2631-40-5/1250) 1. HPLC(NP-ES) CIPAC-K) (p. 120) 2. 2-Isopropyl phenol content (HPLC) CIPAC-ID (p. 121) 3. HPLC(NP-ES) CAN; ISO.L Isopropalin (506A/33820-53-0/1236) 1. Colorimetric AMP VIII (p. 371) 2. GC (FID-IS) AMP VIII (p. 373) Isopropanol (507/67-63-0/1237) 1. GC (FID-IS) AOAC-973.69 (p. 498) 2. GC (FID-IS) AOAC-975.06 (p. 232) 3. GC(FID-ES) NEIC-507-A Isopropyl Carbanilate (see "Propham" 510) Isoprothiolane 1. GC (FID-IS) AMPX(p. 231) Isothioate 1. TLC/Total Phosphorus AMP X (p. 76) 2. GC (FID-IS) AMP X (p. 76) Isoxathion 1. GC (FID-IS) AMP X (p. 85) ------- K-l Karathane (see "Dinocap" 391D) Karbutilate (516A/4849-32-5/1261) 1. IR EPA-1 2. HPLC (RP-IS; with simazine) EPA-1 (4) Kathon (see "2-n-Octyl-4-isothiozolinone" 613C) Kelthane (see "Dicofol" 93) Kepone (see "Chlordecone" 275) Kerb (see "Pronamide" 306A) Korlan (see "Ronnel" 724) Krenite (see "Fosamine Ammonium" 456G) ------- L-l Lamprecide (890/88-30-2/2081) 1. UV EPA-K3) Landrin (893A/2686-99-9/2093) Lannate (see "Methomyl" 549C) Lanstan (see "Chloro-2-nitropropane" 201A) Larvadex (see "Cyromazine" 167B) Lasso (see "Alachlor" 11) Lead and Lead Compounds 1. Gravimetric AOAC-922.04 (p. 149) Lead Arsenate (524/53404-12-9/1277) 1. Total Arsenic AOAC-920.17 (p. 154) 2. Total Arsenious Oxide AOAC-920.18 (p. 154) 3. Total Arsenic Oxide AOAC-920.19 (p. 154) 4. Total Lead AOAC-920.21 (p. 154) Lenacil (525A/2164-08-1/1279) 1. TLC NEIC-525A-A Leptophos (525B/21609-90-5/1280) 1. GC (FID-IS) NEIC-525B-A 2. IR NEIC-525B-B Lethane 60 (85/301-11-1/1972) Lethane 384 (84/112-56-1/277) 1. IR NEIC-84-A 2. GC (FID-IS; with malathion) NEIC-84-B Lime Sulfur (see "Calcium Polysulfide" 150) Limonene (526/138-86-3/1281) Lindane (see "BHC, Gamma Isomer" 527) ------- L-2 Linuron (528/330-55-2/1284) 1. HPLC (NP-ES) Linuron (528/330-55-2/1284) 1. HPLC (NP-ES) EPA-1 2. IR EPA-2 3. UV EPA-3(1) 4. Hydrolysis/Distillation AMP V (p. 434) 5. IR CIPAC-1 (p. 730) 6. HPLC (RP-ES) CAN; LIU.L 7. Tetrachloroazobenzene content (GO JAOAC13, 749 (1990) Lithium Hypochlorite (528A/13840-33-0/1285) 1. Titrimetric NEIC-528A-A Lorsban (see "Chlorpyrifos" 219AA) Lovozal (see "Fenazaflor" 654A) ------- M-l Maintain CF 125 (see "Dichlorflurenol, methyl ester" 557B) Malathion (535/121-75-5/1299) 1. GC (FID-IS) AOAC-979.05 (p. 206) 2. HPLC (RP-ES) EPA-1 3. IR EPA-2 4. HPLC (RP-IS) EPA-3 (3) 5. GC (FID-IS) AMP VI (p. 418) 6. HPLC (with carbaryl and dicofol NEIC-535-A 7. Total Phosphorus (see "Phosphorus Compounds/EPA-1") 8. GC (FID-ES/MB) CAN; MAL.G 9. HPLC (RP-ES) CAN; MAL.L Maleic Hydrazide (see "MH" 352) Maloran (see "Chlorbromuron" 173A) Maneb (539/12427-38-2/1302) 1. Carbon Disulfide Evolution AOAC-965.15 (p. 217) Matacil (see "Aminocarb" 360) Mavrik (see "Fluvalinate" 934) MCPA (557C/94-74-6/1347) 1. HPLC (RP-IS) AOAC-980.07 (p. 194) 2. Titrimetric AMP V (p. 412) 3. GC (FID-IS; as TMS ester) AMP VI (p. 663/630) 4. IR CIPAC-1 (p. 482) 5. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.) 6. HPLC (RP-IS) CIPAC-IC (p. 2139) 7. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 8. GC (FID-IS; with TEA as methyl esters) CIPAC-IC (p. 2148) 9. Characterization (IR/GC/TLC) CIPAC-IC (p. 2137) 10. Reference Std. (Purification and purity) CIPAC-IC (p. 2309) 11. Phenolic impurities (HPLC/Electro Chemical Detector) JAQAC 71. 325(1988) MCPA Esters 1. Hydrolysis/Titration CIPAC-IC (p. 2144) ------- M-2 MCPB (558/94-81-5/1362) 1. GC (FID-ES; as methyl ester) AMP VIII (p. 403) 2. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.) 3. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 4. Characterization (IR/GC/TLC) CIPAC-IC (p. 2153) 5. Reference Std. (Purification and purity) CIPAC-IC (p. 2316) MCPP (see "Mecoprop" 559) Mecarbam (340/2595-54-2/821) 1. GC (FID-IS) AMP VIII (p. 136) Mecoprop (559/7085-19-0/1364) 1. HPLC (RP-IS; with 2,4-D and dicamba)...AOAC-984.07* (p. 188) 2. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.") 3. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 4. Characterization (IR/GC) CIPAC-IA (p. 1298) 5. Reference Std. (Purification and purity) CIPAC-IA (p. 2319) 6. HPLC (RP-IS) CIPAC-IC (p. 2158) Mefiuidide (333AA/53780-36-2/3106) 1. GC (FID-IS; as methyl ester) NEIC-333AA-A Menazon (285A/78-57-9/652) 1. Colorimetric AMP VII (p. 320) Mephosfolan (268H/950-10-7/595) 1. UV AMP VII (p 233) 2. GC (FID-IS) AMP VII (p. 236) Merbac 35 (see "Benzyl Bromoacetate" 82A) Mercaptobenzothiazole (541/149-30-4/1308) and Sodium Salt (541C/2492-26-4/1311) 1. UV EPA-l(l) 2. Potentiometric Titration EPA-2 (1) 3. HPLC (RP-ES) NEIC-541-A 4. HPLC (RP-ES; in coolants) NEIC-541-B Mercaptophos (see "Fenthion" 456F) ------- M-3 Mercurial Seed Disinfectants 1. Gravimetric (as mercuric sulfide) AOAC-930.14 (p. 162) 2. Titrimetric AOAC-971.04 (p. 162) 3. Gravimetric (1,3-Propanediamine prec'n)...AOAC-973.11 (p. 163) Mercury (546/7439-97-6/1316) and Mercury Compounds 1. Titrimetric (Thiocyanate) NEIC-546-A 2. Titrimetric (Dithizone) NEIC-546-B 3. AA (in paints) NEIC-546-C Merphos (865/150-50-5/1992) 1. GC (FID-IS) EPA-1 (4) 2. IR NEIC-865-A Mesityl Oxide (547/141-79-7/1321) Mestranol (547A/72-33-3/1322) 1. Colorimetric NEIC-547A-A Mesurol (see "Methiocarb" 578B) Metalaxyl (375AA/57837-19-1/899.5) 1. GC (FID-IS) EPA-1 (4) Metaldehyde (548/108-62-3/1323) 1. Titrimetric EPA-1 2. GC(TCD-IS) EPA-2 3. IR EPA-3 4. GC(TCD) EPA-4 Metamitron (-/41394-05-2/-) 1. HPLC (RP-ES) CIPAC-ID(p. 125) Metam-Sodium (780/6734-80-1/1865) 1. Carbon Disulfide Evolution AMP III (p. 180) 2. Colorimetric AMP III (p. 180) 3. TLC (Qualitative) CIPAC-1B (p. 1863) Meta-Systox (see "Demeton-methyl" 456) Meta-Systox R (see "Oxydemeton-methyl" 455) ------- M-4 Methabenzthiazuron (8 IB/18691-97-9/185) Methalpropalin (548A/ - /1324.5) Methamidophos(378A/10265-92-6/1325) 1. GC (TCD-ES) AMP VII (p. 341) 2. IR NEIC-378A-A Methanol (552/67-56-1/1338) 1. GC (FID-ES) AOAC-971.03 (p. 233) 2. GC (FID-IS) AOAC-975.06 (p. 232) Methazole (549AA/20354-26-1/3326) 1. IR AOAC-982.03 (p. 194) 2. IR EPA-K3) Methidathion (378B/950-37-8/1327) 1. GC (FID-IS) EPA-1 2. GC (FID-IS) EPA-2 (3) 3. GC (FID-IS) AMP VIII (p. 147) Methiocarb (578B/2032-65-7/1436) 1. HPLC(RP-IS) AOAC-984.10*(p.218) 2. IR EPA-1 3. HPLC(RP-IS) JAQAC £2, 5(1979) 4. GC (TCD-IS; as trifluoroacetyl der.) NEIC-578B-A Methomyl (549C/16752-77-5/1328) 1. HPLC (NP-IS) AMP VII (p. 333) 2. HPLC (RP-ES) EPA-1 (2) 3. HPLC(RP-IS) NEIC-549C-A 4. IR NEIC-549C-B 5. HPLC(RP-IS) NEIC-549C-C 6. HPLC (RP-ES) CAN; MER.L Methoprene (28AAA/40596-69-8/1329) 1. GC (FID-IS) EPA-1 (3) 2. GC (FID-IS) AMPX(p. 96) 3. GC (FID-IS) NEIC-28AAA-A 4. GC (FID-ES; on treated grain) NEIC-28AAA-B 5. IR (Encapsulated) JAOAC 63.879 (1980) 6. GC (FID-IS; with propetamphos) NEIC-28AAA-C ------- M-5 Methoprotryne (509A/841-06-5/1239) 1. Titrimetric CIPAC-1A (p. 1302) 2. GC (FID-IS) CIPAC-lB(p. 1864) Methoxychlor (550/72-43-5/3133) 1. IR EPA-1 2. GC (FID-IS) EPA-2 3. HPLG EPA-3 (2) 4. GC (FID-ES; with captan and malathion) NEIC-550-A 5. IR CIPAC-1 (p. 730) 6. Characterization (GC/MS) JAOAC 63.1007 (1980) 7. IR NEIC-550-B 8. GC (FID-IS) NEIC-550-C 9. Characterization (HPLC) JAOAC 65.1457(1982) 10. GC (FID-ES/MB) CAN; MEY.G Methyl Bromide (555/74-83-9/1341) 1. GC (FID-ES; with chloropicrin) NEIC-555-A Methylenebis (thiocyanate) (565/6317-18-6/1382) 1. GC (FID-ES) NEIC-565-A 2. Hydrolysis/Titration NEIC-565-B 3. IR NEIC-565-C 4. HPLC(RP-IS) NEIC-565-D 5. HPLC (RP-ES) NEIC-565-E Methylene Chloride (568/75-89-2/1387) Methyl Isothiocyanate (573/556-61-6/3198) 1. Potentiometric Titration AMPX(p. 565) 2. GC (FID-IS) AMPX(p. 566) Methyl Nonyl Ketone (5730/112-12-9/1418) 1. GC (FID-IS) EPA-1 (3) 2. Titrimetric NEIC-5730-A 3. HPLC (RP-ES) JAOAC 73. 743 (1990) Methyl Parathion (372/298-00-0/896) 1. GC (FID-IS) AOAC-977.04 (p. 208) 2. HPLC (NP-IS) AOAC-977.05 (p. 209) 3. GC (FID-IS; microencapsulated) AOAC-980.11 (p. 209) 4. HPLC (RP-ES) EPA-1 ------- M-6 Methyl Parathion (372/298-00-0/896) (cont.) 5. IR EPA-2 6. Colorimetric EPA-3 7. GC (FID-IS EPA-5 8. HPLC (RP-ES) EPA-6(3) 9. Electrometric Titration NEIC-372-A 10. GC (FID-IS; with parathion) NEIC-372-B Methyl Salicylate (577/119-36-8/1430) 1. HPLC (RP-ES) NEIC-577-A 2. GC(FID-ES) NEIC-577-B Methyl Trithion (212/953-17-3/484) 1. IR NEIC-212-A 2. GC (FID-IS) AMP II (p. 315) 3. UV AMP II (p. 315) Metobromuron (579A/3060-89-7/1439) 1. IR EPA-1 2. GC (FID-ES) EPA-2 3. GC (FID-IS) EPA-3 4. UV AMP VII (p. 574) Metolachlor (188DD/51218-45-2/4140) 1. GC (FID-IS) AOAC-985.06* (p. 195) 2. GC (FID-IS; with atrazine) [see "Atrazine EPA-1(4)"] 3. GC (FID-IS) NEIC-188DD-A 4. HPLC (RP-ES) NEIC-188DD-B 5. GC (FID-ES) CAN; MHR.G 6. GC (FID-ES; in fertilizers) CAN; EPT.G Metoxuron (194B/19937-59-8/436) 1. Dimethylamine Distillation and TLC AOAC-977.06 (p. 216) 2. HPLC/TLC NEIC-194B-A 3. By-product (TLC) CIPAC-lA(p. 1306) Metribuzin (33D/21087-64-9/100) 1. GC (FID-IS) AOAC-984.11* (p. 219) 2. GC, IR and HPLC sIAQAG52,278(1976) 3. GC (FID-IS) NEIC-33D-A 4. GC(TCD-IS) NEIC-33D-B 5. HPLC (RP-ES) CAN; MGZ.L ------- M-7 Metsulfuron Methyl (419H/74223-64-6/-) 1. HPLC(RP-IS) AMP XVI (p. 85) 2. HPLC (NP-IS) AMP XVI (p. 87) Mevinphos (160B/7786-34-7/356) 1. GC (FID-ES) AMP VI (p. 450) 2. IR AMP II (p. 360) 3. Hydrolysis/Titration AMP II (p. 356) 4. GC (FID-ES; separates isomers) NEIC-160B-A Mexacarbate (579B/315-18-4/1441) 1. GC (TCD-IS) EPA-1 (2) 2. GC (FID-IS) NEIC-579B-A 3. IR NEIC-579B-B MGKR-11 (89/126-15-8/206) 1. Titrimetric NEIC-89-A 2. GC (FID-IS) NEIC-89-B MGK-264 (613/113-48-4/1512) 1. GC (FID-IS) AOAC-980.04* (p. 172) 2. GC (see "Pyrethrins/EPA-2") 3. GC (FID-IS) JAOAC 58. 845 (1975) 4. GC(FID) NEIC-613-A 5. GC (Pet shampoos) [see "Pyrethrins/EPA-1 (4)"] 6. GC (FID-IS; with allethrin and MGK-264). CAN; ALL/PFL/OCT.G 7. GC (FID-ES/CAP; with PBO and pyrethrins) CAN; OCT.G 8. GC (FID-IS/MB; with PBO and pyrethrins in pet shampoos).... CAN; OCT.G/OCT.L (2) MGK-326 (400/136^5-8/954) 1. UV NEIC-400-A 2. GC (FID-IS) NEIC-400-B MGK R-874 (489B/3547-33-9/1194) MH (352/123-33-1/847) 1. UV EPA-1 2. Titrimetric AMP IV (p. 149) 3. HPLC (RP-ES) NEIC-352-A 4. UV CAN; MHY ------- M-8 Mineral Oils (580/ - /1443) 1. Unsulfonated Residue AOAC-927.01 (p. 161) 2. Gravimetric JAOAC 56. 14(1973) 3. Gravimetric CIPAC-1A (p. 1320) Mineral Oil - Soap Emulsions 1. Water AOAC-926.02A (p. 162) 2. Total-Oil AOAC-926.02B (p. 162) 3. Soap AOAC-926.02C (p. 162) 4. Unsulfonated Residue AOAC-926.02D (p. 162) 5. Ash AOAC-926.02E (p. 162) Mirex (411/2385-85-5/976) 1. GC (EC-IS) NEIC-411-A Mitox (see "Chlorbenside" 173) Mobam (see "Benzothienyl Methylcarbamate" 8 ID) Moisture (in Inorganic Arsenicals) AOAC-920.12 (p. 147) Mocap (see "Ethoprop" 434C) Modown (see "Bifenox" 561AA) Molinate (444/2212-67-1/1063) 1. GC (FID-IS) AOAC-974.05 (p. 221) Monitor (see "Methamidophos" 378A) Monocrotophos (377/6923-22-4/901) 1. IR EPA-1 2. GC (FID-IS) EPA-2 3. GC (FID-IS) EPA-3 (1) 4. GC (FID-ES) AMP VI (p. 287) 5. IR AMPV(p. 194) Monolinuron (207D/1746-81-2/467) Monuron (583/150-68-5/1450) 1. Dimethylamine Distillation EPA-1 2. UV EPA-2 3. IR EPA-3 ------- M-9 Monuron (583/150-68-5/1450) (cont.) 4. HPLC (RP-ES) NEIC-583-A 5. IR CIPAC-1 (p. 730) 6. HPLC (NP-IS) AMP XII (p. 162) Monuron Trichloroacetate (583A/140-41-0/1451) Morestan (see "Oxythioquinox" 576) MSMA (582/2163-80-6/1448) 1. Titrimetric (see "Arsenic Compounds/EPA-3-Tent. & EPA-4") 2. 1C (Conductivity detector) JAOAC 72. 994 (1989) Murfotox (see "Mecarbam" 340) Muscalure [see "(z)-9-Tricosene" 883C Mylone (see "Dazomet" 840) ------- N-l Nabam (585/142-59-6/1456) 1. Carbon Disulfide Evolution AOAC-965.15 (p. 217) Naled (586/300-76-5/1457) 1. GC (TCD-ES) AMP VI (p. 350) 2. IR NEIC-586-A 3. GC (FID-IS) JAOAC 58. 1162(1975) 4. GC (with captan and carbaryl) NEIC-586-B 5. GC (FID-ES/MB; in pet collars with propoxur) CAN; NAD.G/PPO.G Naphthalene (587/91-20-3/1458) 1. Sublimation NEIC-587-A 2. GC (FID-IS) NEIC-587-B 1-Naphthaleneacetamide (588/86-86-2/1459) 1-Naphthaleneacetic Acid (589/86-87-3/1460) 1. HPLC (RP-ES) EPA-1 (3) 2. Titrimetric AMP V (p. 457) 3. IR NEIC-589-A 4. HPLC (RP-ES) CAN; NAP.L 1,8-Naphthalic Anhydride (see "Protect") 2-Naphthol (590/135-19-3/1467) 1. Colorimetric AOAC-950.70 (p. 1126) 2-Naphthoxyacetic Acid (590B/120-23-0/1468) 1. UV (Aqueous Sol'ns) NEIC-590B-A 2. UV (Alcohol Sol'ns) NEIC-590B-B Napropamide (590A/15299-99-7/827) 1. GC (FID-IS) AMP VIII (p. 349) 2. GC (FID-IS/MB) CAN; NBE.G Naptalam (592/132-66-1/1470) 1. UV EPA-1 (3) 2. Gravimetric (with DNSBP) NEIC-592-A 3. Titrimetric NEIC-592-B 4. HPLC (RP-IS; with DNSBP) NEIC-592-C ------- N-2 Naptalam (592/132-66-1/1470) (cont.) 5. HPLC (RP-ES; with DNSBP) NEIC-592-D 6. HPLC (RP-ES) CAN; NBL.L Neburon (594/555-37-3/4173) 1. IR EPA-1 2. UV EPA-2(3) 3. Hydrolysis/Distillation AMP IV (p. 159) Neguvon (see "Trichlorofon" 385) Nellite (see "Diamidofos" 654B) Nemacur (453A/22224-92-6/1079) 1. GC(TCD-IS) NEIC-453A-A Nemagon (see "l,2-Dibromo-3-chloropropane" 287) Neopynamin (see "Tetramethrin" 844) Neotran (91/555-89-5/208) Niclosamide (see "Clonitralid" 314) Nicotine (597/54-11-5/1479) and Nicotine Sulfate (597A/65-30-5/1480) 1. Gravimetric AOAC-920.35 (p. 173) 2. HPLC (RP) EPA-1 (3) 3. UV NEIC-597-A 4. HPLC (RP-ES) NEIC-597-B 5. HPLC(RP-IS) NEIC-597-C Nitralin (578/4726-14-1/1433) 1. IR AMP VII (p. 628) 2. GC (FID-ES) AMP VII (p. 630) 3. IR NEIC-578-A Nitrapyrin (217/1929-82-4/1482) 1. GC(TCD-IS) NEIC-217-A Nitrofen (323D/1836-75-5/786) 1. GC (FID-IS) AMPX(p.405) ------- N-3 Nitrophenols 1. Stannous Chloride Reduction EPA-1 2. Total Nitrogen EPA-2 Nitroso Compounds 1. Description and Analysis (GO AMP XI (p. 363) 2. In Dimethyldithiocarbamates (GC) JAOAC 22, 663 (1989) 3. In 2,4-D and MCPA (GC) JAOAC 72. 508 (1989) 4. In dinoseb (GC) JAOAC 70. 792 (1987) Norbormide (606/991-42-4/1502) 1. UV EPA-1 Norea (607/18530-56-8/1503) 1. IR NEIC-607-A Norflurazon (195AA/27314-13-2/1504) 1. GC (FID-IS) AMPX(p. 417) 2. TLC/UV AMP X (p. 419) Nortron (see "Ethofumesate" 427BB) Nuarimol (419G/63284-71-9/1505) 1. GC(FID-ES) AMP XIII (p. 185) ------- 0-1 OCS-21693 (578A/ - /1434) 1. IR NEIC-578A-A Octhilinone (613C/26530-20-1/1510.5) 1. GC (FID-IS) NEIC-613C-A Oil of Citronella (618/8000-29-1/1526) Oil of Lemongrass (618DA/ - /1530) 1. GC(TCD-ES) EPA-1 Omite (see "Propargite" 1301) Ordram (see "Molinate" 444) Organophosphates 1. TLC with carbamates (cross-contamination) NEIC-TLC-A 2. GC (FID-IS/MS; screening) CAN; OP1.G/OP2.G Organotin Compounds 1. Titrimetric EPA-1 Ornitrol (286A/1249-84-9/655) 1. Total Chlorine NEIC-286A-A Orthene (see "Acephate" 2A) Oryzalin (623A/19044-88-3/1539) 1. Colorimetric AMP VIII (p. 435) 2. Colorimetric EPA-1 (2) 3. HPLC (RP-IS) AMP XII (p. 208) OUST (see "Sulfometuron Methyl" 56ID) Outfox (see "Cyprazine" 27 ID) Ovex (624/80-33-1/1540) 1. IR EPA-1 2. Hydrolysis/Titration CIPAC-1 (p. 214) 3. IR CIPAC-1 (p. 730) ------- O-2 Oxadiazon (624A/19666-30-9/1541) 1. GC (TCD-IS) AMP VII (p. 597) Oxalic Acid (625/144-62-7/1542) 1. Titrimetric NEIC-625-A Oxamyl (561A/23135-22-0/1543) 1. HPLC(NP-IS) AMPX(p. 113) 2. HPLC (RP-IS) EPA-1 (4) Oxycarboxin (627A/5259-88-1/1549) 1. IR NEIC-627A-A 2. HPLC (RP-ES) NEIC-627A-B Oxydemeton-methyl (455/301-12-2/1084) 1. GC (FID-IS) JAQAC 61. 500 (1978) 2. Hydrolysis/Titration AMP II (p. 300) 3. Redox Titration AMP II (p. 300) 4. IR NEIC-455-A 5. TLC/total Phosphorus CIPAC-1B (p. 1872) 6. GC (FID/ES/MB; after oxidation) CAN; OXM.G 7. HPLC (RP-IS) JAQAQ13,431(1990) Oxyfluorfen (188AAA/42874-03-3/1551) 1. GC (FID-IS) AMP XI (p. 332) Oxythioquinox (576/2439-01-2/1428) 1. HPLC (RP-IS) AOAC-986.08 (p. 226) 2. UV AMP V (p. 279) 3. HPLC (RP-ES) CIPAC-IC (p. 2021) 4. IR CIPAC-IC (p. 2022) ------- p-1 Paarlan (see "Isopropalin" 506A) Padan (see "Cartap" 360C) Panogen (268) (see "Mercury") Paradichlorobenzene (see "p-Dichlorobenzene" 632) Paraformaldehyde (see "Formaldehyde" 633) Paraquat Bichloride (634/1910-42-5/1555) and bis(Methylsulfate) (635/2074-50-2/1556) 1. Colorimetric AOAC-969.09 (p. 227) 2. HPLC (RP-ES) EPA-1 (3) 3. HPLC (CX-ES) AMP XII (p. 211) 4. HPLC (RP-ES) NEIC-634-A 5. GC (NPD-ES; reduction with NaBH4)) CAN; PAQ.G Parathion (637/56-38-2/1558) 1. GC (FID-IS) AOAC-978.06 (p. 207) 2. HPLC(NP-IS) AOAC-978.07 (p. 208) 3. Titrimetric AOAC-978.08 (p. 207) 4. Colorimetric AOAC-978.09 (p. 207) 5. GC (Encapsulated) AOAC-978.11 (p. 209) 6. HPLC (RP-ES) EPA-1 7. GC (FID-IS) EPA-2 8. GC (FID-IS) EPA-3 (2) 9. HPLC (RP-IS) EPA-4 (2) 10. IR NEIC-637-A 11. GC (FID-ES; use-dilutions) NEIC-637-B 12. GC (FID-ES/MB) CAN; PAR.G Parinol (637A/17781-31-6/1559) 1. GC (FID-IS) NEIC-637A-A Paris Green (229A/12002-03-8/529) 1. Total Arsenic AOAC-920.13 (p. 153) 2. Total Arsenious Oxide AOAC-920.14 (p. 153) 3. Total Copper (Electrolytic) AOAC-920.15A(p. 154) 4. Total Copper (Titrimetric) AOAC-920.15B (p. 154) Parnon (see "Parinol" 637A) Patoran (see "Metobromuron" 579A) ------- P-2 Pay-off (see "Flucythrinate" 2AA) PBO (see "Piperonyl Butoxide" 670) PCNB (see "Pentachloronitrobenzene" 640) PGP (see "Pentachlorophenol" 641) Pebulate (710/1114-71-2/1746) 1. GC (FID-IS) AOAC-974.05 (p. 221) 2. GC(TCD-ES) EPA-1 3. GC (FID-IS) EPA-2 4. GC (FID-IS) EPA-3 Pendimethalin (454BB/40487-42-1/1559.5) 1. GC (TCD-IS) EPA-1 (3) 2. GC (FID-IS) AMPX(p. 463) Pentac (274/2227-17-0/620) 1. GC (TCD-IS) NEIC-274-A 2. HPLC (RP-IS) NEIC-274-B Pentachloronitrobenzene (640/82-68-8/1563) 1. GC (FID-IS) AOAC-982.04* (p. 195) 2. IR AMP III (p. 129) 3. GC (FID-IS) AMP VI (p. 577) 4. GC (FID-IS; in fertilizer mixtures) JAQAC 55. 657 (1972) 5. Colorimetric NEIC-640-A Pentachlorophenol (641/87-86-5/1564) and Sodium Salt (784/131-52-2/1566) 1. HPLC (see "Phenols and Chlorophenols/EPA-5-Tent.") 2. GC (FID-ES; as methyl ester) NEIC-641-A 3. HPLC (with bromacil in oil sprays) NEIC-641-B 4. GC (FID-IS, TMS derivative) EPA-1 (3) 5. HPLC (RP-IS) EPA-2 (3) 6. UV AMP V (p. 314) 7. IR CIPAC-1 (p. 730) 8. Total Chlorine (see "Phenols and Chlorophenols/EPA-3") 9. Total Acidity AWPA; A5-74-1 10. Colorimetric AWPA; A5-74-6 11. GC and TLC (in paints) JAOAC 58.19(1975) 12. HPLC (RP-ES) JAOAC 62. 1004(1979 ------- P-3 Perfluidone (539C/37924-13-3/1575) 1. GC (FID-IS) AMPXCp. 437) Permethrin (652BB/52645-53-1/1575.5) 1. GC (FID-IS) AOAC-986.03* (p. 167) 2. GC (FID-ES; aqueous formulations) JAOAC 60. 9 (1977) 3. GC (FID-IS) NEIC-652BB-A 4. GC (FID-IS) NEIC-652BB-B 5. GC (FID-IS) AMP XIII (p. 106) 6. Identification (GC/HPLC/IR/NMR/MS) CIPAC-ID (p. 180) 7. GC (FID-IS; with allethrin/MGK-264) CAN: ALL/PFL/OCT.G Perthane (337/72-56-0/220) 1. IR NEIC-337-A Petroleum Oils (817A/ - /1583) 1. Gravimetric (Neutral Oil Content) CIPAC-1 (p. 583) Phaltan (see "Folpet" 464) Phenkapton (335B/2275-14-1/816) Phenmedipham (648B/13684-63-4/1588) 1. TLC AMP VII (p. 615) 2. Hydrolysis/Titration NEIC-648B-A 3. Redox Titration NEIC-648B-B 4. Titrimetric CIPAC-IC (p. 2181) 5. HPLC (RP-IS) CIPAC-IC (p. 2184) Phenol (649/108-95-2/1589) Phenols and Chlorophenols 1. Definition, Structure, and Tech. Data EPA-1 2. UV (o-Phenylphenol EPA-2 3. Total Chlorine (Lime fusion) ! EPA-3 4. Bromination/Titration (o-phenylphenol EPA-4 5. HPLC (Pentachlorophenol) EPA-5 6. GC (FID-ES) EPA-6 7. GC (FID/TCD; 4-chloro-3,5-xylenol) EPA-7 8. GC (TCD-IS/TMS Der.) ...EPA-8 9. HPLC (RP-ES) NEIC-Phenols-A ------- P-4 Phenothizine (652/92-84-2/1591) 1. Colorimetric AOAC-967.37 (p. 106) 2. GC (FID-IS) AOAC-968.47 (p. 574) 3. IR EPA-1-Tent. 4. HPLC (RP-ES) JAOAC 59. 693 (1976) 5. GC (FID-IS) NEIC-652-A 6. GC (FID-IS; in feeds) NEIC-652-B 7. GC (FID-IS) NEIC-652-C Phenothrin (652B/26002-80-2/1595) 1. GC (FID-IS) NEIC-652B-A 2. GC (FID-IS) AMP XIII (p. 134) 3. GC [see "Tetramethrin/EPA-l(4)"] 4. HPLC(RP-IS) NEIC-652B-B 5. GC (FID-ES; separates isomers) JAQAC 68. 911 (1985) Phenoxy Herbicides (see "Chlorophenoxy Herbicides") Phenthoate (427B/2597-03-7/1040) 1. GC (TCD-IS) AMP VIII (p. 161) 2. TLC AMP VIII (p. 164) 3. GC (FID-IS) NEIC-427B-A Phenylmercuric Acetate (656/62-38-4/1606) o-Phenylphenol (623AA/90-43-7/1631) and Sodium Salt (787/132-27-4/1636) 1. UV (see "Phenols and Chlorophenols/EPA-2") 2. Bromination/Titr'n (see "Phenols and Chlorophenols/EPA-4") 3. GC (see "Phenols and Chlorophenols/EPA-6 and EPA-8-Tent.") 4. HPLC (RP-ES) NEIC-623AA-A Phorate (660/298-02-2/1639) 1. IR AOAC-964.05 (p. 210) 2. IR EPA-1 3. GC (FID-IS) AMP VI (p. 493) 4. GC (FID-IS) NEIC-660-A Phosalone (660A/2310-17-0/1640) 1. GC (TCD-IS) AMP VII (p. 387) 2. GC (FID-IS) CIPAC-ID(p. 142) 3. HPLC (NP-ES; with captan) CAN; PHE.L/CAP.L 4. GC (FID-ES/MB) CAN; PHE.G ------- P-5 Phosdrin (see "Mevinphos" 160B) Phosfolan (268B/947-02-4/594) 1. UV AMP VII (p. 419) 2. GC (FID-IS) AMP VII (p. 236) Phosmet (543/732-11-6/1312) 1. IR AMP V (p. 261) 2. GC (FID-IS) AMP VI (p. 408) 3. IR, GC and Colorimetric JAQAC 52,1017 (1969) 4. HPLC(NP-ES) CAN; PHI.L Phosnichlor (see "Dicapthon" 296) Phosphamidon (661/13171-21-6/1641) 1. Titrimetric AMP II (p. 377) 2. GC (FID-IS) NEIC-661-A 3. IR NEIC-661-B Phosphoric Acid (662/7664-38-2/1642) 1. Potentiometric Titration (also with HC1) NEIC-662-A Phosphorus (Total) 1. Gravimetric EPA-1 Phosphorus Paste (663/7723-14-0/1644) 1. Gravimetric (see "Phosphorus/EPA-1") Phostoxin (see "Aluminum Phosphide" 31) Phosvel (see "Leptophos" 525B) Phoxim (902IV14186-18-3/1603) 1. HPLC (NP-ES) CIPAC-IC (p. 2188) Phthalthrin (see "Tetramethrin" 844) Phygon (see "Dichlone" 298) ------- P-6 Picloram (39/1918-02-1/1645) 1. HPLC (RP-IS; with 2,4-D) AOAC-976.03 (p. 196) 2. HPLC (RP-ES) EPA-1 3. IR AMP V (p. 512) 4. GC (FID-ES; as methyl ester) NEIC-39-A 5. UV NEIC-39-B 6. HPLC(AX-ES) CAN; PIC.L Pindone (671/83-26-1/1661) 1. UV (Ether extraction) EPA-1 2. UV (Pyrophosphate extraction) EPA-2 3. UV (Water soluble formulations) EPA-3 4. HPLC (RP-ES) EPA-4 (4) Pine Oil (665/8002-09-3/1651) 1. Gravimetric NEIC-665-A 2. Fatty or Rosin Acid Content NEIC-665-B 3. Water/Alcohol Content NEIC-665-C Piperalin (575/3478-94-2/1424) Piperonal (669/5281-13-0/1656) 1. GC (FID-IS) NEIC-669-A Piperonyl Butoxide (670/51-03-6/1657) 1. Colorimetric AOAC-960.11 (p. 170) 2. GC (FID-IS) AOAC-982.02* (p. 172) 3. Qualitative Test EPA-1 4. GC (FID-IS) EPA-2 5. GC (see "Pyrethrins/EPA-2") 6. IR NEIC-670-A 7. IR CIPAC-1 (p. 730) 8. TLC (Semi-quantitative) NEIC-670-B 9. GC (FID-IS; with Diazinon) NEIC-670-C 10. HPLC (RP-ES; with folpet/pyrethrins) JAOAC fig, 789 (1983) 11. HPLC (Pet Shampoos) [see Pyrethrins/EPA-1 (4)] 12. GC (FID-ES/CAP; with MGK-264/pyrethrins) CAN; OCT.G 13. GC (FID-ES/MB; with MGK-264/pyrethrins) CAN; OCT.G/OCT.L(2) Pirimicarb (359C/23103-98-2/1658) 1. GC (FID-IS) AOAC-982.08 2. Titrimetric AMP VII (p. 401) ------- P-7 Pirimicarb (359C/23103-98-2/1658) (cont.) 3. Colorimetric AMP VII (p. 401) 4. UV EPA-K2) 5. Identification (GC/TLC/IR/NMR) CIPAC-ID (p. 182) 6. Reference Std. (Purification and purity) CIPAC-ID (p. 197) Pirimiphos Ethyl (334A/23505-41-1/1659) 1. GC (FID-IS) AMP VIII (p. 174) 2. TLC/UV AMP VIII (p. 177) 3. Hydrolysis/UV AMP VIII (p. 179) 4. GC (FID-IS) EPA-1 (4) 5. GC (FID-IS) CIPAC-ID (p. 147) 6. Identification (GC/TLC/IR/NMR) CIPAC-ID (p. 182) 7. Reference Std. (Purification and purity) CIPAC-ID (p. 199) Pirimiphos Methyl (334B/29232-93-7/1660) 1. GC (FID-IS) AMP VIII (p. 189) 2. TLC/UV AMP VIII (p. 190) 3. Hydrolysis/UV AMP VIII (p. 190) 4. HPLC (RP-IS) JAOAC 60. 14(1977) 5. GC (FID-IS) EPA-1 (4) 6. GC (FID-IS) CIPAC-IC (p. 2193) 7. Reference Std. (Purification and purity) CIPAC-IC (p. 2337) 8. Identification (GC/TLC/IR/NMR) CIPAC-ID (p. 182) Pival (see "Pindone" 671) Planavin (see "Nitralin" 578) Plantvax (see "Oxycarboxin" 627A) Plictran (see "Cyhexatin" 884A) PMP (515/83-28-3/1257) 1. UV (Ether extraction EPA-1 2. UV (Pyrophosphate extraction) EPA-2 3. UV (Aqueous formulations) EPA-3 Polaris (see "Glyphosine" 471A) Polychlorinated Biphenyls (672A/1336-36-3/1666) 1. GC (EC-ES; in oils, soils, and wipes) NEIC-672A-1 ------- P-8 Polyram (41A/9006-42-2/108) 1. Carbon Disulfide Evolution NEIC-41A-A Potassium Azide (682B/20762-60-1/1695) 1. GC(ES) NEIC-682B-A Potassium Bisulfate (682C/7646-93-7/1692) Potassium Chromate (687/7789-00-6/1700) 1. Titrimetric NEIC-687-A Potassium Cyanate (688/590-28-3/1701) 1. Gravimetric AOAC-952.01* (p. 159) Potassium Cyanide (688A/151-50-8/1702) 1. Titrimetric AOAC-920.30 (p. 159) Potassium Dichloro-s-triazinethone (689) (see "Available Chlorine") Potassium-N-methyldithiocarbamate (696/137-41-7/1715) Potassium Permanganate (699/7722-64-7/1719) 1. Titrimetric NEIC-699-A Potassium Persulfate (700/7727-21-1/1721) 1. Titrimetric NEIC-700-A Pramitol (see "Prometone" 96) Prefar (see "Bensulide" 357) Preforan (see "Fluorodifen" 462AA) Pressurized Containers 1. Nonvolatiles (High-pressure) NEIC-PC-A 2. Nonvolatiles (Refillable High-pressure) NEIC-PC-B 3. Non-volatiles (Low-pressure) NEIC-PC-C 4. Flame Projection Test NE1C-PC-D 5. Drum Test (Flammability- NEIC-PC-E 6. Total Container NEIC-PC-F 7. Direct. Sampling NEIC-PC-G ------- P-9 Primidophos (5C/39247-96-6/12) Princep (see "Simazine" 740) Probe (see "Methazole" 549AA) Procyazine(186ABC/32889-49-9/1733) 1. GC (FID-IS) NEIC-186ABC-A Profluralin (271BB/54460-46-7/1734) 1. GC (FID-IS) AMP X (p. 453) Promacyl 1. GC (FID-IS) AMP VIII (p. 209) 2. GC (FID-IS) AMP XI (p. 141) 3. GC (FID-IS; in cattle dips) AMP XI (p. 144) Promecarb (271C/2631-37-0/609) Prometon (see "2,4-Prometone" 96) 2,4-Prometone (96/1610-18-0/1735) 1. GC (FID-IS) AOAC-971.08* (p. 222) 2. GC(TCD-IS) EPA-1 3. GC (FID-IS) EPA-2 4. GC (FID-IS; with simazine) EPA-1 (4) 5. Nonaqueous Titration AMP IV (p. 173) Prometryn (97/7287-19-6/1736) 1. GC (FID-IS) AOAC-971.08* (p. 222) 2. Nonaqueous Titration AMP IV (p. 181) Pronamide (see "Propyzamide" 306A) Propachlor (194/1918-16-7/432) 1. GC (FID-IS) AOAC-986.05* (p. 196) 2. GC (FID-IS) NEIC-194-A 3. GC (FID, with atrazine) NEIC-194-B 4. Labile Chlorine (Titration) NEIC-194-C 5. GC (FID-IS) CAN; POE.G ------- P-10 Propanil (325/709-98-8/791) 1. Total Chlorine AMP IV (p. 326) 2. GC (FID-IS) NEIC-325-A 3. GC (TCD-IS) AMP XIII (p. 282) Propargite (130i;2312-35-8/1737) 1. IR EPA-1 2. GC (TCD-IS) EPA-2 3. HPLC (RP-ES) CAN; POT.L Propazine (184/139-40-2/1740) 1. GC (FID-IS) AOAC-971.08* (p. 222) 2. Labile Chlorine AMP IV (p. 188) Propetamphos(706A/31218-83-4/1741.5) 1. GC (FID-IS) NEIC-706A-A 2. GC (FID-IS; with hydroprene) NEIC-706A-B 3. GC (FID-IS; with methoprene) NEIC-706A-C Propham (510/122-42-9/1241) 1. Hydrolysis/Titration CIPAC-1 (p. 593) 2. HPLC (see "Quintex") 3. GC (see "Chlorpropham/CIPAC-IC; p. 2025") Prophos (see "Propham" 510) Propionic Acid (707/79-9-4/1742) 1. GC(FID-ES) EPA-1 (3) Propoxur (508/114-26-1/1238) 1. HPLC (RP-IS) AOAC-984.12* (p. 220) 2. IR AMP VII (p. 165) 3. Colorimetric NEIC-508-A 4. IR (bait formulations) NEIC-508-B 5. HPLC (RP-ES; oil sprays) NEIC-508-C 6. GC (FID-IS; as TFA derivative) NEIC-508-D 7. IR NEIC-508-E 8. HPLC (RP-IS) NEIC-508-F 9. HPLC(NP-ES) AMP XII (p. 7) 10. GC (FID-ES/MB; in pet collars) CAN; NAD.G/PPO.G 11. GC (FID-ES) CAN; PRO.G 12. HPLC (RP-ES) CAN; PRO.L ------- p-11 Propylene Glycol (713/57-55-6/1749) 1. GC (TCD-IS) EPA-1 (1) 2. GC (FID-IS) AOAC-970.61 (p. 360) 3. GC (FID-IS/CAP; with aromatic naphtha) CAN; HAN/POJ.G n-Propyl Isome (401/83-59-0/955) Propyzamide (306A/23950-58-5/690) 1. GC (FID-IS) AMP VIII (p. 445) 2. GC (FID-IS) NEIC-306A-B Prosulfalin (399D A/51528-03-1/1754) Protect (-/81-84-5/-) 1. IR AMP VIII (p. 484) 2. GC(FID-ES) NEIC-Protect-A Prothoate (344B/2275-18-5/832) 1. GC (TCD-IS) AMP VIII (p. 215) 2. TLC/Totar Phosphorus AMP VIII (p. 217) Prowl (see "Pendimethalin" 454BB) Proxel (79A/ - /181) Pydrin (see "Fenvalarate" 77A) Pyrazon (714C/1698-60-8/1756) 1. HPLC (RP-ES) CIPAC-ID (p. 35) 2. IR EPA-1 (2) 3. HPLC (RP-ES) JAQAQ1L 1064 (1988) Pyrazophos (714D/13457-18-6/1070) 1. TLC/Total Sulfur AMP X (p. 239) 2. HPLC (NP-IS) CIPAC-IC (p. 2206) Pyrethrins (715/121-21-1/1757) 1. Titrimetric (Deniges) AOAC-936.05 (p. 170) 2. GC (FID-IS) AOAC-982.02* (p. 172) 3. Description EPA-1 4. GC(FID-ES) EPA-2 ------- P-12 Pyrethrins (715/121-21-171757) (cont.) 5. Titrimetric (Sell) EPA-3 6. HPLC (RP-ES) EPA-4(3) 7. TLC (with PBO) NEIC-715-A 8. GC (FED-IS; with PBO and MGK-264) AMP VIII (p. 232) 9. HPLC (RP-ES) NEIC-715-B 10. HPLC(RP-IS) JAQAC 66. 789 (1983) 11. HPLC (RP-IS; in pet shampoos) EPA-1 (4) 12. GC (FID-ES/CAP; with PBO and MGK-264) CAN; OCT.G 13. HPLC (NP-IS; with MGK-264 and PBO in pet shampoos CAN; OCT.G/OCT.L (2) Pyridine (717/110-86-1/1759) 1. Distillation/Titration NEIC-717-A Pyrinuron (718B/53558-25-1/1763.5) 1. HPLC (NP-IS) AMP XII (p. 233) Pyrolan (574A/87-47-8/1422) 1. Hydrolysis/Distillation AMP II (p. 416) Pyroxychlor (194C/7159-34-4/1764) ------- Q-l Quaternary Ammonium Compounds 1. Chloride Titration (Potentiometric) AOAC-960.14A (p. 228) 2. Chloride Titration (Absorption indicator)AOAC-960.14B (p. 228) 3. Conversion Factors EPA-1 4. Auerbach Qualitative Test EPA-2 5. Ferricyanide Method EPA-3 6. Epton Titration EPA-4 7. Chloride/Bromide (Potentiometric titr'n) EPA-5 8. Colorimetric NEIC-Quat-A 9. Titrimetric NEIC-Quat-B 10. Gravimetric NEIC-Quat-C 11. Titrimetric CAN; QA7.P Quinalphos (662A/ 13593-03-8/835) 1. TLC/UV AMP XI (p. 149) 2. GC (FID-IS) AMP XI (p. 151) 8-Quinolinol Sulfate (719B/134-31-6/1768) 1. UV NEIC-719B-A Quintex® (Fenuron + Propham + Chlorpropham) 1. HPLC (RP-ES) AMP XI (p. 344) Quintiofos (454D/ - /1083) 1. GC (FID-ES; Dip washes) NEIC-454D-A Quintozine (see "Pentachloronitrobenzene" 2328) ------- R-l Rabon (see "Tetrachlorvinphos" 217A) Ramrod (see "Propachlor" 194) Randox (see "Allidochlor" 284) Raticate (see Norbormide" 606) Red SquiU (722/507-60-8/1772) 1. Paper Chromatography/Fluorescence NEIC-722-A 2. General Description NEIC-722-B Resmethrin (83E/10453-86-8/1773.5) 1. IR EPA-1 2. GC(TCD-ES) EPA-2 3. GC (TCD-IS) EPA-3 4. HPLC (RP-ES) EPA-4 5. GC (FID-IS) EPA-5 6. GC (FID-IS) AMP VII (p. 445) 7. GC (separates isomers) AMP VII (p. 447) 8. Colorimetric AMP VII (p. 448) 9. HPLC(RP-IS) AMP XII (p. 70) RH-787 (see "Pyrinuron" 718B) Rogor (see "Dimethoate" 358) Rogue (see "Propanil" 325) Ro-Neet (see "Cycloate" 432A) Ronnel (724/299-84-3/1775) 1. GC (FID-IS; in feeds) AOAC-969.56 (p. 108) 2. IR EPA-1 3. GC (FID-IS) EPA-2 4. IR (Korlan, smears, etc) NEIC-724-A 5. GC (FID-IS) NEIC-724-B 6. Colorimetric (Feeds and dips) NEIC-724-C 7. IR CIPAC-1 (p. 730) Rotenone (725/83-79-4/1776) 1. Crystallization AOAC-938.01 (p. 168) 2. Total Ether Extract AOAC-940.04 (p. 169) 3. IR AOAC-961.03 (p. 169) 4. HPLC (RP-ES) AOAC-983.06* (p. 169) ------- R-2 Rotenone (725/83-79-4/1776) (cont.) 5. Qualitative Test EPA-1 6. HPLC (RP-ES) EPA-2 (3) 7 TLC NEIC-725-A 8. GC (Reduction with NaBH4).....!..........."."...........! NEIC-725-B 9. Colorimetric CIPAC-1 (p. 611) 10. GC(FID-ES) sIAQAQSfi, 1342(1973) 11. HPLC(NP-ES) 51^0^052,958(1975) 12. UV and IR (Effects of other rotenoids) JAOAC 59. 703 (1976) 13. HPLC (RP-ES) JAOAC 66. 783 (1983) 14. HPLC (RP-ES) CAN; ROT.L 15. HPLC (RP-ES) JAOAC 71. 323 (1988) Round-Up (see "Glyphosate" 661 A) Rowmate (see "Dichlormate" 298A) Rowtate (see "Cisanilide" 380A) Rozol (see "Chlorophacinone" 211C) Ruelene (see "Crufomate" 263A) Ryanodine (727/15662-33-6/1777) 1. UV NEIC-727-A ------- S-l Sabadilla Alkaloid (728/8051-02-3/1778) 1. Gravimetric AOAC-960.12 (p. 173) Safrole (729/94-59-7/1779) Salicylanilide (730/87-17-2/1780) 1. UV EPA-1 Salithion (549D/3811-49-2/1330) 1. Colorimetric AMP VII (p. 433) 2. GC (FID-IS) AMP VII (p. 435) Sampling 1. Solids and Liquids AOAC-935.06 (p. 147) Saturn (see "Benthiocarb" 207DA) SBP-1382 (see "Resmethrin" 83E) Schraden (610/152-16-9/1509.5) 1. Differential Hydrolysis CIPAC-1 (p. 621) 2. Hydrolysis/Titration NEIC-610-A Secbumaton (125C/26259-45-0/1783) 1. Potentiometric Titration NEIC-125C-A Sector (see "Butralin" 125E) Selenium (732/7782-49-2/1784) 1. Gravimetric NEIC-732-A 2. Gravimetric NEIC-732-B Sencor (see "Metribuzin" 33D) Sendran (see "Propoxur" 508) Sesame Oil (733/8008-74-0/1786) 1. Qual. Test AOAC-893.01 (p. 979) ------- S-2 Sesone (319/136-78-7/772) 1. Hydrolysis/Titration AMP IV (p. 201) Sethoxydim (72A/74051-80-2/174) 1. HPLC (NP-ES) NEIC-72A-A Sevin (see "Carbaryl" 160) Siduron (733A/1982-49-6/1787) 1. UV EPA-1 2. Hydrolysis/Distillation NEIC-733A-A Silica Gel (734/1343-98-2/1788) 1. Gravimetric NEIC-734-A Silver (735/7440-22-4/1790) Silvex (739/93-72-1/1795) 1. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.") 2. GC (see "Chlorophenoxy Herbicides/EPA-5-.") 3. GC (as TMS ester) AMP VI (p. 688) 4. Titration CIPAC-IC (p. 2121) 5. GC (FID-IS; as methyl ester) 6. Reference Std. (Purification and purity) CIPAC-IC (p. 2333) Silvex, Propylene Glycol Butyl Ester Ester (739N/53466-84-5/1798) 1. Hydrolysis/Titration NEIC-1798-1 Simazine (740/122-34-9/1816) 1. GC (FID-IS) AOAC-971.08* (p. 222) 2. Labile Chlorine (see "Chloro-Triazine Herbicides/EPA-1") 3. UV (0.1% Aqueous Suspension) EPA-1 4. GC [see " Prometone/EPA-1 (4)"] 5. HPLC [see "Karbutilate/EPA-1 (4)"] 6. Non-aqueous Titration AMP IV (p. 217) Simetryn (94B/1014-70-6/218) 1. GC (FID-IS) CIPAC-lB(p. 1895) ------- S-3 Soap (741/68952-95-4/1817) 1. Moisture by Distillation AOAC-926.01A (p. 162) 2. Sodium and Potassium AOAC-926.01B (p. 162) Sodium Arsenate (743/13464-38-5/1822) Sodium Arsenite (744/7784-46-5/1823) Sodium Benzoate (746/532-32-1/1825) 1. Titrimetric NEIC-746-A Sodium Bisulfate (742/7681-38-1/1819) Sodium Carbonate (752/497-19-8/1832) 1. Titrimetric AOAC-911.01 (p. 232) Sodium Chlorate (753/7775-09-9/1833) 1. Titrimetric EPA-1 2. Titrimetric CIPAC-1 (p. 626) 3. Titrimetric (with Sodium Metaborate) EPA-1 (4) Sodium Cyanide (758/143-33-9/1843) 1. Titrimetric AOAC-920.30 (p. 159) 2. Titrimetric NEIC-758-A Sodium Diacetate (758C/ - /1844) 1. Titration NEIC-758C-A Sodium Dichloro-s-triazinetrione (759) (see "Available Chlorine") Sodium Dimethyldithiocarbamate (762/128-04-1/1846) Sodium Fluoride (769/7681-49-4/1850) 1. Total Fluorine AOAC-929.04 (p. 150) 2. Titrimetric NEIC-769-A 3. Ion Chromatography EPA-1 (4) Sodium Fluoroacetate (770/62-74-8/1851) 1. GC (Derivitization) JAOAC 63.49 (1980) 2. HPLC (NP-ES) NEIC-770-A ------- S4 Sodium Fluosilicate (771/16893-85-9/1852) 1. Total Fluorine AOAC-945.05 (p. 152) Sodium Hydroxide (773/1310-73-2/1854) 1. Titrimetric AOAC-911.01 (p. 232) Sodium Hypochlorite (776/7681-52-9/1856) 1. Titrimetric AOAC-935.07 (p. 160) 2. Chloride Content AOAC-935.08B (p. 160) 3. Sodium Hydroxide Content AOAC-935.08C (p. 160) 4. Titrimetric (Rel. Iodine) NEIC-776-A Sodium Metaborate (779AA/7775-19-1/1863) 1. Titrimetric [see "Sodium Chlorate/EPA-1 (4)"] Sodium Selenate (791/13410-01-0/1880) Sodium Trichloroacetate (797/650-51-1/1888) 1. Titrimetric AOAC-962.08 (p. 197) 2. Decarboxylation/Titration CIPAC-1 (p. 691) Solan (800/2307-68-8/1892) 1. Total Chlorine NEIC-800-A Sorbic Acid (801/110-44-1/1893) and Potassium Salt (80 LA/ - /1894) Spectracide (see "Diazinon" 342) Spergon (see "Chloranil" 171) Spike (see "Tebuthiuron" 366AA) Stabilene (see "Butoxypropylene Glycol" 122) Stam (see "Propanil" 325) Starlicide (216A/7745-89-3/499) 1. Colorimetric NEIC-216A-A Streptomycin (804/57-92-1/1898) and Sulfate (804A/298-39-5/1899) 1. UV EPA-1 ------- S-5 Strobane (822/8001-50-1/1927) Strychnine Alkaloid (805/57-24-9/1900) and Sulfate (806/60-41-3/1901) 1. Gravimetric EPA-1 2. UV EPA-2 3. HPLC EPA-3(2) Strychnine Alkaloid (805/57-24-9/1900) and Sulfate (806/60-41-3/1901) (cont.) 4. HPLC (RP-ES) NEIC-805-A 5. GC (FID-ES) JAOAC 58. 961 (1975) 6. HPLC (RP-ES) JAQAC 58. 957 (1975) 7. UV NEIC-805-B 8. HPLC(RP) JAQA£fil, 612 (1978) 9. HPLC (RP-IS) EPA-4 (3) Sulfallate (180/95-06-7/396) 1. Total chlorine AMP IV (p. 249) Sulfamic Acid (809/5329-14-6/1904) 1. Titrimetric NEIC-809-A Sulfanilamide (809A/63-74-1/1905) Sulfaquinoxaline (721/59-40-5/1771) 1. Colorimetric AOAC-963.35 (p. 112) 2. HPLC (with warfarin) EPA-MP-1 (2) Sulfometuron Methyl (561D/74222-97-2A) 1. HPLC (RP-IS) AMP XVI (p. 108) Sulfotepp (837/3689-24-5/1948) 1. GC (TCD-IS) AMP VI (p. 483) Sulfoxide (615/120-62-7/1522) 1. UV AOAC-968.05 (p. 230) Sulfur (812/7704-34-9/1911) 1. Gravimetric (Water soluble sulfur) AOAC-920.31 (p. 159) 2. Gravimetric (CS2 extraction) EPA-1 3. Gravimetric (Nitric acid oxidation) EPA-2 ------- S-6 Sulfur (812/7704-34-9/1911) (cont.) 4. Gravimetric (Acetone method) EPA-3 5. Titrimetric CIPAC-1 (p. 632) 6. HPLC (RP-ES) JAQAC 71. 617 (1988) Sulfur Dioxide (813/7446-09-5/1912) 1. Titrimetric (Fumigants) EPA-1 Sulfuric Acid (815/7664-93-9/1914) 1. Titrimetric NEIC-815-A Sulfuryl Fluoride (816A/2699-79-8/1916) Sulphenone (211D/80-00-2/482) Sulprofos (453AA/35400-43-2/1078) 1. GC (FID-IS) AOAC-980.12 (p. 210) Sumithion (see "Fenitrothion" 373) Supona (see "Chlorfenvinphos" 187) Supracide (see "Methadathion" 378B) Surflan (see "Oryzalin" 623A) Sustar (see "Fluridamid" 889B) Sutan (see "Butylate" 434A) Swep (818/1918-18-9/1917) Systox (see "Demeton" 279) ------- T-l 2,4,5-T (881/93-76-5/2024) 1. HPLC (RP-IS) AOAC-980.08* (p 196) 2. UV (with 2,4-D) (see "Chlorophenoxy Herbicides/EPA-2") 3. HPLC (see "Chlorophenoxy Herbicides/EPA-3-Tent.") 4. Extraction/Titration CIPAC-1 (p. 642) 5. GC (FID-ES; as methyl ester) NEIC-881-A 6. HPLC (RP-ES) NEIC-881-B 7. GC (as TMS ester) AMP VI (p. 630) 8. GC (as TMS ester, on-column) NEIC-881-C 9. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2257) 10. Characterization (IR/GC/TLC) CIPAC-IC (p. 2220) 11. Reference Std. (Purification and purity) CIPAC-IC (p. 2312) 12. TCDD content (GC-MS) CIPAC-IC (p. 2284) 2,4,5-T, Butoxyethanol Ester (881N/2545-59-7/2039) 1. GC (see "Chlorophenoxy Herbicides/EPA-4-Tent.") 2. Hydrolysis/Titration CIPAC-1 (p. 646) 2,4,5-T, 2-Ethylhexyl Ester (881R/1928-47-8/2043) Tabutrex (see "Dibutyl Succinate" 293) Tackle (see "Aciflurfen Sodium Salt" 755D) Talon (see "Brodifacoum" 114AAA) Tandex (see "Karbutylate" 516A) 2,4,5-TB (881/93-80-1/2048) 2,3,6-TBA (873/3426-62-8/2008) 1. Characterization (IR/MP) CIPAC-IC (p. 2226) 2. GC (FID-IS; as methyl ester) CIPAC-IC (p. 2227) 3. Reference Std. (Purification and purity) CIPAC-IC (p. 2314) TCA (see "Trichloroacetic Acid" 870) TCC (874/101-20-2/2011) TCNB (see "Tecnazine" 831) TDE (307/72-54-8/693) 1. IR NEIC-307-A ------- T-2 Tebuthiuron (366AA/34014-18-1/1920) 1. UV EPA-K3) 2. GC (FID-IS) AMP XI (p. 355) 3. HPLC (Silica) AMP XI (p. 353) 4. HPLC (RP-ES) CAN; TDU.L Tecnazene (831/117-18-0/1934) 1. Polarography CIPAC-1 (p. 663) 2. GC (FID-IS) EPA-1 (3) Tedion (see "Tetradifon" 836) Telodrin (see "Isobenzan" 609) Telone (see "D-D Mixture" 324) Telvar (see "Monuron" 583) Temephos (845/3383-96-8/1921) 1. HPLC (NP-IS) AOAC-982.07* (p. 211) 2. UV AMP VII (p. 121) 3. GC (FID-IS) AMP VII (p. 125) 4. HPLC(NP-ES) CANjTEF.L Temik (see "Aldicarb" 11A) Tenoran (see "Chloroxuron" 217B) TEPP (838/107-49-3/1949) 1. Titrimetric AOAC-949.06 (p. 211) 2. Hydrolysis/Titration CIPAC-1 (p. 667) Terbacil (821A/5902-51-2/1922) 1. HPLC (NP-IS) AMPX(p.485) 2. IR AMP X (p. 486) 3. UV ; EPA-1 (3) 4. HPLC (RP-ES) CAN; TELL Terbucarb (see "Terbutol" 294) Terbufos (131A/13071-79-9/1924) 1. GC (FID-IS) AMP XI (p. 166) 2. HPLC (NP-ES) CAN; TDS.G ------- T-3 Terbut (see "Secbumeton" 125C) Terbuthylazine (125B/5915-41-3/1925) 1. GC (FID-IS) AOAC-981.04 (p. 220) Terbutol (294/1918-11-2/670) 1. IR EPA-1 2. GC (FID-IS) EPA-2 3. UV NEIC-294-A Terbutryn (125D/886-50-0/1926) 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. IR NEIC-125D-A Terpene Polychlorinates (see "Strobane" 822) Terraclor (see "Pentachloronitrobenzene" 640) Terramytin (628/2058-46-0/1552) Terrazole (428/2593-15-9/1029) 1. GC (TCD-ES) NEIC-428-A 2. IR (with PCNB) NEIC-428-B 3. GC (FID-ES; with PCNB) NEIC-428-C 2,3,5,6-Tetrachloro-4-(methylsulfonyl)pyridine(830A/13108-52-6/1933) 1. GC (TCD-IS) NEIC-830A-A 2. UV NEIC-830A-B Tetrachlorophenols (832/25167-83-3/1935) and salts 1. IR CIPAC-1 (p. 730) 2. Titrimetric NEIC-832-A 3. IR NEIC-832-B 5. GC (see "Pentachlorophenol/NEIC-1564-2") 6. HPLC (see "Pentachlorophenol/NEIC-1564-4") Tetrachlorothiophene (834/6012-97-1/1943) Tetrachlorvinphos (217A/961-11-5/503) 1. GC (FID-IS) EPA-1 (3) 2. GC (FID-ES) AMP VII (p. 299) 3. IR AMP VII (p. 302) 4. GC (Premixes) NEIC-217A-A ------- T-4 Tetradifon (836/116-29-0/1946) 1. GC (FID-IS) AOAC-981.02 (p. 197) 2. GC (FID-IS) AMPX(p. 121) 3. Total Chlorine (Na reduction) AMP II (p. 475) 4. IR CIPAC-1 (p. 730) Tetralin (842A/119-64-2/1953.5) Tetraethylpyrophosphate (see "TEPP" 838) Tetramethrin (844/7696-12-0/1957) 1. GC (FID-IS) AMP VII (p.349) 2. TLC/UV AMP VII (p. 347) 3. GC (TCD-IS; with resmethrin) NEIC-844-A 4. GC (FID-IS; with synergists) NEIC-844-B 5. GC (FID-IS; with d-phenothrin) EPA-1 (4) Tetrasul (213/2227-13-6/487) TFM (see "Lamprecide" 890) Thallium Sulfate (849/7446-18-6/1964) 1. Gravimetric AOAC-939.01* (p. 163) 2. A A NEIC-849-A Thanite (503/115-31-1/1227) 1. Total Nitrogen AOAC-951.02 (p. 228) Thiabendazole (849A/148-79-8/1965) 1. Colorimetric AOAC-966.28 (p. 114) 2. Titrimetric NEIC-849A-A 3. UV AMP VIII (p. 301) 4. Colorimetric JAOAC 58. 971 (1975) Thimet (see "Phorate" 660) Thiobencarb (207DA/28249-77-6/1968) 1. GC (FID-IS) EPA-1 (4) 2. GC (FID-IS) CIPAC-ID(p. 160) ------- T-5 Thiocarbamate Herbicides 1. GO (FID-IS) AOAC-974.05 (p. 221) 2. GC (GC-ES) CAN; EPT.G Thiocyanates 1. Total Nitrogen AOAC-951.02 (p. 228) Thiocyclam-Hydrogen Oxalate (853F/-/-) 1. HPLC (RP-IS) AMP XI (p. 187) Thiodan (see "Endosulfan" 420) Thiodicarb (900AA/59669-26-0/911.5) 1. HPLC (RP-IS) NEIC-900AA-A Thiofanox (368BB/39196-18-4/1974) Thiometon (455B/640-15-3/1086) 1. IR CIPAC-1 (p. 730) 2. GC (FID-IS) AMP VIII (p. 242) 3. GC (FID-IS) NEIC-455B-A Thiophanate (344A/23564-06-9/829) 1. UV EPA-K3) 2. HPLC (RP-ES; with thiram) NEIC-344A-A Thiophanate-Methyl(375A/23564-05-8/1975) 1. UV EPA-K3) 2. Colorimetric NEIC-375A-A 3. HPLC (RP-IS) CIPAC-ID (p. 163) Thiourea (855/62-56-6/1977) Thiram (856/137-26-8/1978) 1. CS2 Evolution AOAC-966.08 (p. 222) 2. UV EPA-1 3. IR EPA-2 4. IR CIPAC-1 (p. 730) 5. HPLC (RP-ES; with thiophanate) NEIC-856-A 6. HPLC (RP-IS) EPA-3 (4) 7. HPLC (NP-IS) CIPAC-ID (p. 169) 8. HPLC (RP-ES; with carborin) CAN; CBX.L/THR.L ------- T-6 Thymol (856A/89-83-8/1979) 1. Titrimetric AOAC-929.12 (p. 552) TIBA (890A/88-82-4/2084) Tiguvon (see "Fenthion" 456F) Tillam (see "Pebulate" 710) Tin & Tin Compounds 1. Titrimetric [see "Bis(tributyltin)oxide/EPA-l"] Tiocarbenil (82AA/36756-79-3/1629.3) 1. GC (FID-IS) AMP XI (p. 309) 2. TLC AMP XI (p. 311) Tirpate (364/26419-73-8/878) TOK (see "Nitrofen" 323D) Tolban (see "Profluralin" 27IBB) Toluene (859/108-88-3/1982) 1. GC (FID-IS) AOAC-975.06 (p. 232) Topcide (see "Benzadox" 75C) Topsin (see "Thiophanate" 344A) Topsin M (see "Thiophanate-Methyl" 375A) Torak (see "Dialifor" 280A) Tordon (see "Picloram" 39) Toxaphene (861/8001-35-2/1986) 1. IR AMP II (p. 531) 2. Total Chlorine AMP II (p. 525) 3. IR CIPAC-1 (p. 730) 4. IR NEIC-861-A 2,4,5-TP (see "Silvex" 739) Treflan (see "Trifluralin" 889) ------- T-7 Triadimeform (862AA/43121-43-3/457) 1. HPLC (NP-IS) AOAC-985.08 (p. 228) 2. HPLC(RP-IS) NEIC-862AA-A 3. HPLC (RP-IS) CIPAC-IC (p. 2236) Triallate (870A/2303-17-5/2006) 1. GC (FID-IS) EPA-1 (4) 2. GC (FID-ES/MB) CAN; TQA.G 3. GC (FID-ES; in fertilizers) CAN; TQA.G (2) Triamiphos (37A/1031-47-6/103) Triarimol (861A/26766-27-8/1987) 1. GC JAOAC 56. 11 (1973) Triazine Herbicides 1. GC (FID-IS) AOAC-971.08 (p. 222) 2. Titrimetric JAQACM, 4, (1971) 3. GC (FID-IS) AMPX(p. 513) 4. HPLC (RP-ES) CAN;ATR/.../CUC.L s-Triazinetriol (862/108-80-5/593) (see "Available Chlorine") Triazophos (344G/24017-47-8/831) 1. TLC/Total Sulfur AMPX(p. 129) 3,4,5-Tribromosalicylanilide (863/87-10-5/1989) 1. UV (see "Brominated Salicylanilides/EPA-1") Tributyltin Fluoride (867C/1983-10-4/1997) (see "Tin" and "Fluorine") Tributyltin Oxide (see "Bis(tributyltin)oxide" 101) Tricamba (869/2307-49-5/2004) Trichlorfon (385/52-68-6/913) 1. IR EPA-1 (1) 2. GC (FID-IS) EPA-2 (1) 3. GC (FID-IS; TMS Der.) EPA-3 (3) 4. HPLC (RP-IS) EPA-4 (3) 5. Hydrolyzable Chlorine AMP II (p. 201) 6. Dehydrohalogenation AMP II (p. 202) ------- T-8 Trichlorfon (385/52-68-6/913) (cont.) 7. GC(NPD-ES) AMP VI (p. 387) 8. HPLC(RP-IS) NEIC-385-A 9. HPLC (RP-IS) JAOAC 71. 317 (1988) 10. GC (Impurities) JAQAQIi, 440 (1988) Trichlormethylfos (see "Chlorpyriphos Methyl" 179AA) Trichloroacetic Acid (870/76-03-9/2005) 1. Decarboxylation/Titration CIPAC-1 (p. 691) 2,3,6-Trichlorobenzoic Acid (873/3426-62-8/2008) 3,4,4'-Trichlorocarbanilide (874/101-20-2/2011) 1. UV EPA-1 1,1,1-Trichloroethane (875/71-55-6/2103) Trichloroethylene (876/79-01-6/2014) Trichloromelamine (877/7673-09-8/2016) (see "Available Chlorine") Trichloronitromethane (see "Chloropicrin" 214) Trichloronat (456A/327-98-0/1090) 2,4,5-Trichlorophenol (879/95-95-4/2020) and Potassium Salt Trichloro-s-triazinetrione (883/ - /2060) (see "Available Chlorine") Triclopyr, butoxyethyl ester (8821/55335-06-3/2062) 1. HPLC (RP-IS) EPA-1 (4) (Z>9-Tricosene (883C/27519-02-4/2064) 1. GC (FID-IS) NEIC-883C-A 2. GC (FID-IS) NEIC-883C-B Tricresyl Phosphate (884/1330-78-5/2065) Tricyclazole (884C/41814-78-2/2066) 1. GC (FID-IS) AMP XI (p. 265) 2. HPLC (RP-IS) AMP XI (p. 267) ------- T-9 Tridemorph (386/24602-86-6/915) Triethanolamine (886/102-71-6/2070) Triethylene Glycol (888/112-27-6/2078) 1. GC (TCD-IS) EPA-1 (1) Trifenofos (888D/38524-82-2/2080) Trifenson (see "Sulphenone" 211D) Trifluralin (889/1582-09-8/2082) 1. UV AOAC-973.13(p. 179) 2. GC (FID-IS) AOAC-973.14(p. 180) 3. GC (FID-IS) EPA-1 4. IR EPA-2 5. GC (Separation from benefin) NEIC-889-A 6. GC (FID-ES/WB) CAN; TSU.G 7. GC (FID-ES/CAP; in fertilizers) CAN; TSU.G (2) 8. GC (FID-IS; with benfluralin) JAOAC 73. 981 (1990) Triforine (890AA/26644-46-2/2083) 1. TLC/Densitometry AMP X (p. 245) 2. Total Chlorine AMPX(p. 247) 3. Non-aqueous Titration NEIC-890AA-A 4. HPLC (NP-ES) NEIC-890AA-B 5. HPLC (RP-ES) NEIC-890AA-C 6. HPLC (with acephate and dicofol) [see "Acephate/EPA-1 (4)"] Triphenyltin Acetate (896C/900-95-8/2098) 1. Potentiometric Titration AOAC-979.02 (p. 156) 2. GC (with dithiocarbamates) AOAC-984.04 (p. 157) Triphenyltin Hydroxide (896E/76-87-9/2101) 1. Potentiometric Titration AOAC-979.02 (p. 156) 2. GC (with dithiocarbamates) AOAC-984.04 (p. 157) 3. UV NEIC-896E-A 4. GC JAOAC 61.1507 (1978) Triprene (896J/2103) Tris-Nitro (see "2-Hydroxymethyl-2-nitro-l,3-propanedior 495) Trithion (see "Carbophenothion" 165) ------- T-10 4-Tritylmorpholine (898A/1420-6-0/2108) Tropital (see "Piperonal" 669) Troysan 174 [see "2-((Hydroxymethyl)amino)ethanol" 494C] Trysben (see "TEA" 873) Tunic (see"Methazole" 549AA) Tupersan (see "Siduron" 733A) Turkey Red Oil (899/8002-33-3/2109) Turpentine (900/8006-64-2/2111) Tyrothricin (900A/1404-88-2/2112) ------- U-l Urea (902/57-13-6/2114) Ureas, Substituted 1. HPLCCNP&RP) NEIC-SU-A Urox (see "Monuron Trichloroacetate" 583A) ------- V-l Vacor (718B/53558-25-i;i763.5) 1. UV EPA-l(l) 2. HPLC (RP-ES) EPA-2 (1) 3. HPLC (NP-IS) JAOAC 60. 1375(1977) 4. Potentiometric Titration NEIC-718B-B Valone (see "PMP" 515) Vamidothion (379A/2275-23-2/904) 1. Titrimetric AMP VII (p. 483) 2. GC (TCD-IS) AMP VII (p. 481) Vapam (see Metam-Sodium, 780) Vapona (see "DDVP" 328) VBT (see "Vinylene Bisthiocyanate" 902A) Vegadex (see "CDEC" 180) Vendex (see "Hexakis" 481DD) Venzar (see "Lenacil" 525A) Vernolate (711/1929-77-7/1747) 1. GC (FID-IS) AOAC-974.05 (p. 221) 2. IR EPA-1 3. GC (FID-IS) EPA-2 4. GC (TCD-IS) EPA-3 5. HPLC (RP-ES) EPA-4 (2) 6. GC (FID-IS) NEIC-711-A Vikane (see "Sulfuryl Fluoride" 816A) Vinclozolin (323C/50471-44-8/ -) 1. GC (FID-IS) CIPAC-ID(p. 174) Vinyl Chloride (902B/75-01-4A) 1. GC (Qual. test) NEIC-VCM-A 2. IR (Qual. test) NEIC-VCM-B 3. GC/IR (Qual. test, also other propellants) NEIG-VCM-C ------- V-2 Vinylene Bisthiocyanate (902A/14150-71-1/2116) 1. Polarographic NEIC-902A-A Vitavax (see "Carboxin" 165A) Vydate (see "Oxamyl" 561A) ------- W-l Warfarin (903/81-81-2/2117) 1. UV (Ether Extraction) AOAC-960.15 (p. 229) 2. HPLC (RP-ES) EPA-1 3. UV (Pyrophosphate extraction) EPA-2 4. HPLC (Sodium salt) EPA-3 5. HPLC (RP-ES) EPA-4 (3) 6. UV (Silicic acid clean-up) AMP III (p. 203) 7. UV (Ether/hexane extraction) AMP VII (p. 678) 8. HPLC (RP-ES) JAOAC 59.1104(1976) 9. HPLC (RP-ES with sulfaquinoxaline) EPA-MP-1 (2) 10. HPLC (RP-ES with sulfaquinoxaline) NEIC-903-A 11. HPLC (RP-ES) CAN; WAR.L 12. HPLC (RP-ES; with sulfoquinoxaline in concentrates) AMP XVI (p. 155) 13. HPLC (RP-ES; with sulfoquinoxaline in wheat baits) AMP XVI (p. 156) Water (903B/ - / -) 1. Distillation (Soap) AOAC-14; 6.123 2. Distillation (Pine oils) NEIC-903B-A 3. Distillation (Phenolic or coal-tar creosote) NEIC-903B-B 4. Distillation (Liquor creosolis saponatus) NEIC-903B-C 5. Isopropanol Conversion Table NEIC-903B-D Wepsyn (see "Triamiphos" 37A) ------- X-l Xylene (906/1330-20-7/2121) ------- Z-l Zectran (see "Mexacarbate" 579B) Zinc and Zinc Compounds 1. Gravimetric AOAC-918.01 (p. 150) 2. Titrimetric NEIC-ZN-A Zinc Arsenite (909/28837-97-0/2126) 1. Total Arsenic AOAC-920.22B (p. 155) 2. Water Soluble Arsenic AOAC-920.22C (p. 155) 3. Total Zinc AOAC-920.22D (p. 155) 4. Total Arsenious Oxide AOAC-920.23 (p. 155) Zinc Fluosilicate (914/16871-71-9/2131) Zinc Naphthenate (919/1338-02-9/2137) 1. Gravimetric AOAC-918.01 (p. 150) Zinc Phosphide (922/1314-84-7/2141) 1. Phosphine Evolution (KMn04 oxidation) EPA-1 2. Phosphine Evolution (GLC-FPD) EPA-2 3. Phosphine Evolution (lodometric Titration).... CIPAC-1 (p. 703) Zineb (930/12122-67-7/2151) 1. Carbon Bisulfide Evolution AOAC-965.15 (p. 217) Ziram (931/137-30-4/2153) 1. Carbon Bisulfide Evolution AOAC-965.15 (p. 217) 2. UV EPA-1 (3) Zolone (see "Phosalone" 660A) Zytron (323/299-85-4/783) 1. IR NEIC-323-A ------- |